Index of /docs/tenders
![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | vacancies/ | 2022-08-23 08:39 | - | |
![[IMG]](/icons/image2.gif) | menu_m1_0.gif | 2001-04-21 09:22 | 105 | |
| menu_m1iad.gif | 1999-04-15 13:34 | 825 | |
| menu_m1sup.gif | 2002-04-23 08:22 | 825 | |
| menu_m1ia.gif | 1999-04-07 10:38 | 826 | |
| menu_m1sdown.gif | 2002-04-23 08:22 | 826 | |
![[ ]](/icons/unknown.gif) | WinSCP.lnk | 2017-10-25 08:14 | 1.0K | |
| menu_opera_frame.js | 2012-07-25 10:32 | 2.5K | |
| menu_scr.js | 2014-02-14 09:31 | 2.9K | |
![[TXT]](/icons/text.gif) | rfq.php | 2016-11-28 14:09 | 6.1K | |
| received.php | 2014-03-03 15:02 | 7.2K | |
| awarded.php | 2014-02-19 14:55 | 7.6K | |
| contacts.php | 2014-02-19 14:55 | 7.6K | |
| projects to be plac..> | 2015-08-03 11:05 | 9.5K | |
| menu_ns4.js | 2012-07-25 10:32 | 9.6K | |
| menu_opera.js | 2012-07-25 10:32 | 10K | |
| menu_ie4.js | 2012-07-25 10:32 | 10K | |
![[ ]](/icons/layout.gif) | 04-24-25.pdf | 2025-01-30 10:14 | 11K | |
| tenders.php | 2014-03-03 15:16 | 11K | |
| menu_dom.js | 2012-07-25 10:32 | 15K | |
| Cancellation Notice2..> | 2022-06-22 15:45 | 16K | |
| Pool of Consultants ..> | 2018-09-10 17:45 | 16K | |
| NOTICES.xlsx | 2015-08-24 09:23 | 19K | |
| Bid No.11-18-19.pdf | 2020-01-21 12:12 | 21K | |
| Bid No 01-19-20.pdf | 2020-01-21 12:04 | 21K | |
| Bid No 10-18-19.pdf | 2020-01-21 12:13 | 21K | |
| Bid No13-18-19.pdf | 2020-01-21 12:05 | 21K | |
| Tender No. 01-20-21 ..> | 2020-11-10 14:52 | 25K | |
| Tender 06-20-21 Not..> | 2020-11-17 11:33 | 25K | |
| Tender 06-20-21 Not..> | 2020-11-17 11:37 | 25K | |
| Proposal for Sound, ..> | 2018-09-10 17:29 | 27K | |
| Scanner_20250507_185..> | 2025-05-07 15:10 | 29K | |
| Scanner_20250507_185..> | 2025-05-08 21:29 | 29K | |
| Rental, Installation..> | 2018-09-10 17:34 | 29K | |
| Proposal for Audio S..> | 2019-01-16 11:21 | 30K | |
| SUPPLY & DELIVERY OF..> | 2024-01-10 15:43 | 31K | |
| Install Server backu..> | 2023-09-05 16:03 | 31K | |
| Install backup at Fl..> | 2023-09-05 16:03 | 31K | |
| SUPPLY & DELIVERY OF..> | 2024-01-10 15:43 | 31K | |
| SUPPLY AND DELIVERY ..> | 2024-01-10 15:43 | 31K | |
| REQ4693.pdf | 2024-01-25 12:01 | 31K | |
| Manholes 3 050923.pdf | 2023-09-05 16:02 | 31K | |
| 5000 litre of Water ..> | 2023-09-05 16:02 | 31K | |
| Floor Pine gel 25L11..> | 2023-10-31 12:04 | 31K | |
| 100m x 80mm Sunction..> | 2023-09-05 16:02 | 31K | |
| 105 - 110mm Cascade ..> | 2023-11-14 08:18 | 31K | |
| BOARDROOM CHAIRS2310..> | 2023-10-10 15:18 | 31K | |
| valve keenflo SII Al..> | 2023-09-05 16:02 | 31K | |
| 25mm Air Valves 0411..> | 2023-10-04 16:19 | 31K | |
| Unblock the out chan..> | 2023-10-04 16:19 | 31K | |
| 179 - 199mm Cascade ..> | 2023-09-05 16:02 | 31K | |
| Supply and deliver 2..> | 2023-10-03 08:10 | 31K | |
| 236 - 245mm Cascade ..> | 2023-09-05 16:02 | 31K | |
| 135 - 145mm Cascade ..> | 2023-09-05 16:02 | 31K | |
| Portable water pump ..> | 2023-09-05 16:02 | 31K | |
| Isolation valves0411..> | 2023-10-04 13:35 | 31K | |
| Glove High Voltage i..> | 2023-11-03 09:32 | 31K | |
| PRESIDENT HIGH BACK ..> | 2023-10-10 07:36 | 31K | |
| Hire TLB(4X4) for 15..> | 2023-08-24 11:18 | 31K | |
| Supply and delivery ..> | 2023-10-03 08:10 | 31K | |
| Manholes 2 050923.pdf | 2023-09-05 16:02 | 31K | |
| Manholes 050923.pdf | 2023-09-05 16:02 | 31K | |
| SUPPLY AND DELIVERY ..> | 2023-10-10 07:39 | 31K | |
| Joint Kit 11kv 25mm ..> | 2023-10-10 08:28 | 31K | |
| Pipe Sewerage upvc 1..> | 2023-10-19 09:04 | 31K | |
| Flushing of sewer sy..> | 2023-10-04 16:19 | 31K | |
| Flushing of sewer sy..> | 2023-10-04 16:19 | 31K | |
| Hiring of Tipper tru..> | 2023-08-31 12:58 | 31K | |
| Supply and delivery ..> | 2023-09-26 14:50 | 31K | |
| Breakdown repairs of..> | 2023-11-14 08:18 | 31K | |
| LAPTOPS AND BAGS2809..> | 2023-09-28 08:31 | 31K | |
| Hiring of TLB needed..> | 2023-10-04 16:19 | 31K | |
| Hiring of TLB for 30..> | 2023-08-31 12:56 | 31K | |
| Flushing of sewer sy..> | 2023-10-04 16:19 | 31K | |
| 70 x 1 + 50 BN ABC 1..> | 2023-11-14 08:18 | 31K | |
| Handrails.pdf | 2023-10-19 09:04 | 31K | |
| Hiring of TLB for 30..> | 2023-10-31 12:07 | 31K | |
| Steel Palisade Panel..> | 2023-09-05 16:02 | 31K | |
| Hiring of bulldozer ..> | 2023-08-24 11:18 | 31K | |
| Hiring of Excavator ..> | 2023-09-05 16:02 | 31K | |
| Root Auger 8mm x 100..> | 2023-08-21 08:33 | 31K | |
| Fire Hydrant Heads 8..> | 2023-11-17 15:13 | 31K | |
| supply and delivery ..> | 2023-11-14 08:18 | 31K | |
| Insertion rubber (ro..> | 2023-08-21 08:33 | 31K | |
| Supply and delivery ..> | 2023-08-24 11:18 | 31K | |
| Supply and Dellivery..> | 2023-09-26 14:50 | 31K | |
| Horsebibcock x 15mm2..> | 2023-08-21 08:33 | 31K | |
| Supply and delivery ..> | 2023-09-26 14:50 | 31K | |
| Horsebibcock x 20mm2..> | 2023-08-21 08:33 | 31K | |
| Supply and delivery ..> | 2023-09-26 14:50 | 31K | |
| 160mm PVC Adaptors 2..> | 2023-08-21 08:33 | 31K | |
| 2m x 8mm Sewerage st..> | 2023-08-21 08:33 | 31K | |
| Hiring of Excavator ..> | 2023-09-26 14:50 | 31K | |
| Hiring of Excavator ..> | 2023-09-26 14:50 | 31K | |
| Hiring of TLB for 30..> | 2023-10-25 09:58 | 31K | |
| Unblock both operati..> | 2023-10-04 16:19 | 31K | |
| Hiring of Excavator ..> | 2023-10-03 08:10 | 31K | |
| Hiring of an excavat..> | 2023-10-04 16:19 | 31K | |
| BTU AIR CONDITIONERS..> | 2023-10-10 07:33 | 31K | |
| Hiring of TLB for 30..> | 2023-10-25 09:58 | 31K | |
| A self contained flo..> | 2023-11-14 08:18 | 31K | |
| Hiring of TLB at Lul..> | 2023-10-25 09:58 | 31K | |
| Maintenance of Trans..> | 2023-08-31 12:54 | 31K | |
| Supply and delivery ..> | 2023-09-26 14:50 | 31K | |
| Valve parkings210823..> | 2023-08-21 08:33 | 31K | |
| Hiring of TLB needed..> | 2023-09-05 16:02 | 31K | |
| Hiring of TLB needed..> | 2023-09-05 16:02 | 31K | |
| Supply and delivery ..> | 2023-08-22 08:57 | 32K | |
| Supply and delivery ..> | 2023-09-26 14:50 | 32K | |
| Supply and delivery ..> | 2023-09-26 14:50 | 32K | |
| 4231.pdf | 2023-11-14 08:18 | 32K | |
| Quality of supply in..> | 2023-10-10 07:42 | 32K | |
| Poles and hardware r..> | 2023-11-14 08:18 | 32K | |
| Hedge trimmer.pdf | 2023-11-08 08:24 | 32K | |
| Construction of MV o..> | 2023-11-14 08:18 | 32K | |
| REQUEST FOR ONE NEW ..> | 2023-11-08 08:24 | 32K | |
| Cable 50x3 core xlpe..> | 2023-11-17 15:13 | 32K | |
| CABLE 25MMX4 CORE CO..> | 2023-11-17 15:13 | 32K | |
| Cable 35mm x 4 Core ..> | 2023-11-17 15:13 | 32K | |
| Cable 95mm x 3 core ..> | 2023-11-17 15:13 | 32K | |
| Cable 70mm x 3 PILC ..> | 2023-11-17 15:13 | 32K | |
| Cable LT PVC 16MM x ..> | 2023-11-17 15:13 | 32K | |
| Cable 25mm x 3 core ..> | 2023-11-17 15:13 | 32K | |
| CABLE 16MMX4 CORE CO..> | 2023-11-17 15:13 | 32K | |
| CABLE 120MM 3CORE XL..> | 2023-11-17 15:13 | 32K | |
| Cable XLPE SWA 95mm ..> | 2023-11-17 15:13 | 32K | |
| Cable 50mm x 4 core ..> | 2023-11-17 15:13 | 32K | |
| Hiring of TLB for 21..> | 2023-11-17 15:13 | 32K | |
| Cable LT PVC 25MMx2 ..> | 2023-11-17 15:13 | 32K | |
| CABLE 120MMX4 CORE C..> | 2023-11-17 15:13 | 32K | |
| Hiring of Tipper tru..> | 2023-11-17 15:13 | 32K | |
| Unblocking and free ..> | 2023-11-17 15:13 | 32K | |
| Roofing Materials ne..> | 2023-09-05 16:02 | 32K | |
| Hiring of TLB needed..> | 2023-11-17 15:13 | 32K | |
| Hiring of TLB needed..> | 2023-11-17 15:13 | 32K | |
| REQUEST FOR D8 BULLD..> | 2023-11-17 15:13 | 32K | |
| REQUEST FOR D8 BULLD..> | 2023-11-17 15:13 | 32K | |
| Road Marking Materia..> | 2023-11-17 15:13 | 32K | |
| MBD 6.2 Declaration ..> | 2023-12-04 16:23 | 35K | |
| Rental of multifunct..> | 2018-09-11 20:27 | 38K | |
| Proposal for the fin..> | 2020-01-23 07:13 | 38K | |
| Construction of Stor..> | 2018-09-10 17:41 | 39K | |
| Review of Ba-phalabo..> | 2018-09-11 20:27 | 39K | |
| Vat recovery and Rec..> | 2019-07-15 19:41 | 41K | |
| LIST OF ALL TENDERS ..> | 2014-02-27 15:03 | 43K | |
| Pool of Debt Collect..> | 2018-09-11 20:27 | 44K | |
| prepaid meter verifi..> | 2017-08-11 10:17 | 48K | |
| Submersible Pumps fo..> | 2025-10-17 16:25 | 48K | |
| 202007231232.pdf | 2020-07-23 15:37 | 49K | |
| TENDER NO. 06-18-19 ..> | 2019-06-30 18:30 | 52K | |
| Tender No. 15-21-22.pdf | 2022-06-15 12:20 | 53K | |
| Tender No. 19-21-22.pdf | 2022-06-15 12:20 | 53K | |
| 20170522093413141.pdf | 2017-05-22 08:52 | 54K | |
| Addendum no 1 - 08-..> | 2024-11-14 11:17 | 56K | |
| Tender No. 11-21-22.pdf | 2022-06-15 12:20 | 59K | |
| TENDER NO 10.25.26.tif | 2026-03-25 11:17 | 59K | |
| Tender No.11-20-21.pdf | 2022-01-26 12:06 | 59K | |
| Tender Advertisement..> | 2020-10-19 07:59 | 59K | |
| Tender No 10-20-21_2..> | 2021-07-26 13:16 | 59K | |
| Tender No. 05-21-222..> | 2021-08-25 12:04 | 59K | |
| Tender No. 17-21-22.pdf | 2022-06-15 12:20 | 59K | |
| Addendum no 1 - 07-..> | 2024-11-14 11:17 | 59K | |
| Tender No 04-20-21_2..> | 2021-07-26 13:16 | 60K | |
| TENDER NO 21.24.25 R..> | 2026-03-25 11:17 | 60K | |
| TENDER NO- 21-23-24.pdf | 2025-04-11 08:46 | 60K | |
| Tender No.12-20-21.pdf | 2022-01-26 12:06 | 60K | |
| Tender No.06-21-22.pdf | 2022-01-26 12:06 | 61K | |
| Surfix cable 4mm x 4..> | 2023-12-04 16:23 | 61K | |
| Tender 04-21-22.pdf | 2021-08-25 12:04 | 61K | |
| Tissue Paper 500 she..> | 2023-12-04 16:23 | 61K | |
| Paper blank 80gsm wh..> | 2023-12-04 16:23 | 61K | |
| Tender No 03-20-21_2..> | 2021-07-26 13:16 | 61K | |
| Tender No 09-20-21_2..> | 2021-07-26 13:16 | 61K | |
| 1462.pdf | 2024-04-04 11:18 | 61K | |
| REQ5132.pdf | 2024-04-04 11:18 | 61K | |
| REQ5064.pdf | 2024-04-04 11:18 | 61K | |
| REQ4929.pdf | 2024-03-25 15:43 | 61K | |
| REQ4226.pdf | 2024-03-25 15:43 | 61K | |
| Tender No.05-21-22.pdf | 2022-01-26 12:06 | 61K | |
| REQ4847.pdf | 2024-03-25 15:43 | 61K | |
| REQ4846.pdf | 2024-03-25 15:43 | 61K | |
| REQ4436.pdf | 2023-12-12 08:37 | 61K | |
| REQ4437.pdf | 2023-12-12 08:37 | 61K | |
| REQ4438.pdf | 2023-12-12 08:37 | 61K | |
| REQ4440.pdf | 2023-12-12 08:37 | 61K | |
| REQ4848.pdf | 2024-03-25 15:43 | 61K | |
| REQ4687.pdf | 2024-02-13 11:12 | 61K | |
| REQ4439.pdf | 2023-12-12 08:37 | 61K | |
| REF1655.pdf | 2024-07-09 14:13 | 62K | |
| REF1656.pdf | 2024-07-09 14:13 | 62K | |
| REF1654.pdf | 2024-07-09 14:13 | 62K | |
| REQ4831.pdf | 2024-03-25 15:43 | 62K | |
| REQ4829.pdf | 2024-03-25 15:43 | 62K | |
| REQ5182.pdf | 2024-04-05 08:51 | 62K | |
| Tender No 08-20-21_2..> | 2021-07-26 13:16 | 62K | |
| OFFICE DESKS WITH CR..> | 2023-10-09 16:01 | 62K | |
| Tender No 07-20-21_2..> | 2021-07-26 13:16 | 62K | |
| REQ4323 (1).pdf | 2023-12-04 16:23 | 62K | |
| REQ4323.pdf | 2023-12-04 16:21 | 62K | |
| REQ4961.pdf | 2024-04-17 08:29 | 62K | |
| REQ4948.pdf | 2024-04-17 08:29 | 62K | |
| REQ4949.pdf | 2024-04-17 08:29 | 62K | |
| REQ5529.pdf | 2024-06-19 16:31 | 62K | |
| REQ4950.pdf | 2024-04-17 08:29 | 62K | |
| REQ36863008.pdf | 2023-08-30 07:54 | 62K | |
| REQ3686.pdf | 2023-08-29 08:58 | 62K | |
| REQ4962.pdf | 2024-04-17 08:29 | 62K | |
| REQ3993 191023.pdf | 2023-10-19 09:06 | 63K | |
| REQ136915.pdf | 2024-06-11 08:04 | 63K | |
| REQ3559.pdf | 2023-10-05 09:45 | 63K | |
| Tender No. 14-21-22.pdf | 2022-06-15 12:20 | 63K | |
| Tender No.03-21-22.pdf | 2022-01-26 12:06 | 64K | |
| Tender No. 13-21-22.pdf | 2022-06-15 12:20 | 64K | |
| Tender No. 18-21-22.pdf | 2022-06-15 12:20 | 64K | |
| Tender No.01-21-22.pdf | 2022-01-26 12:06 | 64K | |
| REQ4685.pdf | 2024-02-13 11:12 | 64K | |
| REQ4684.pdf | 2024-02-13 11:12 | 64K | |
| REQ4686.pdf | 2024-02-13 11:12 | 64K | |
| Tender No.02-21-22.pdf | 2022-01-26 12:06 | 65K | |
| TENDER NO- 01-24-25.pdf | 2025-04-11 08:46 | 66K | |
| Tender No. 09-21-22 ..> | 2022-06-08 09:29 | 67K | |
| Tender No.09-21-22.pdf | 2022-01-26 12:06 | 67K | |
| Tender No.08-21-22.pdf | 2022-01-26 12:06 | 67K | |
| TENDER NO 05.25.26.tif | 2026-03-25 11:17 | 68K | |
| TENDER NO 06.25.26.tif | 2026-03-25 11:17 | 69K | |
| REQ4699.pdf | 2024-02-13 11:12 | 69K | |
| TENDER NO 11.25.26.tif | 2026-03-25 11:17 | 69K | |
| RFQ 8204.pdf | 2025-07-23 09:18 | 69K | |
| TENDER 26.24.25.tif | 2026-03-25 11:17 | 69K | |
| TENDER NO 21.23.24 R..> | 2026-03-25 11:17 | 71K | |
| TENDER NO 07.25.26.tif | 2026-03-25 11:17 | 72K | |
| TENDER NO 24.24.25 R..> | 2026-03-25 11:17 | 73K | |
| TENDER NO 20.24.25.tif | 2026-03-25 11:17 | 74K | |
| 09-25-26.pdf | 2026-03-25 10:51 | 75K | |
| 05-25-26.pdf | 2026-03-25 10:51 | 75K | |
| TENDER NO 19.24.25.tif | 2026-03-25 11:17 | 75K | |
| 13-24-25.pdf | 2026-03-25 10:51 | 75K | |
| 19-24-25.pdf | 2026-03-25 10:51 | 76K | |
| 21-24-25.pdf | 2026-03-25 10:51 | 76K | |
| 12-24-25.pdf | 2026-03-25 10:51 | 76K | |
| TENDER NO 23.24.25.tif | 2026-03-25 11:17 | 76K | |
| 24-24-25.pdf | 2026-03-25 10:51 | 77K | |
| 04-25-26.pdf | 2026-03-25 10:51 | 77K | |
| Database invitations..> | 2016-03-15 10:27 | 78K | |
| 07-25-26.pdf | 2026-03-25 10:51 | 78K | |
| 08-25-26.pdf | 2026-03-25 10:51 | 78K | |
| REF2024.pdf | 2024-06-26 09:03 | 79K | |
| TENDER NO- 20-23-24.pdf | 2025-04-11 08:46 | 80K | |
| TENDER NO- 18-23-24.pdf | 2025-04-11 08:46 | 81K | |
| Request for cleaning..> | 2024-12-12 11:13 | 81K | |
| PROPOSAL FOR THE MAR..> | 2020-01-22 09:05 | 82K | |
| 01-24-25.pdf | 2025-01-30 12:33 | 82K | |
| 26-23-24.pdf | 2025-01-30 10:14 | 82K | |
| 04-24-25[1].pdf | 2025-01-30 10:14 | 83K | |
| 18-23-24.pdf | 2024-10-30 13:02 | 83K | |
| 14-23-24.pdf | 2024-10-30 13:02 | 84K | |
| TENDER NO 01.25.26.tif | 2026-03-25 11:17 | 84K | |
| 17-23-24.pdf | 2024-10-30 13:02 | 84K | |
| 28-23-24.pdf | 2025-01-30 12:33 | 84K | |
| 25-23-24.pdf | 2025-01-30 10:14 | 84K | |
| Awarded tenderssdfd.pdf | 2017-05-19 08:46 | 84K | |
| 24-23-24.pdf | 2025-01-30 10:14 | 84K | |
| Tender No. 09-20-21.pdf | 2021-07-09 14:17 | 85K | |
| 12-23-24.pdf | 2024-10-30 13:02 | 85K | |
| 19-23-24.pdf | 2024-10-30 13:02 | 85K | |
| Erratum Advert Tende..> | 2019-08-06 11:26 | 85K | |
| 07-24-25.pdf | 2025-01-30 10:14 | 85K | |
| Orange PPE, Safety b..> | 2025-09-10 22:58 | 85K | |
| 08-24-25.pdf | 2025-01-30 10:14 | 86K | |
| TENDER NO- 05-24-25.pdf | 2025-04-11 08:46 | 86K | |
| Tender No. 05-21-22.pdf | 2021-07-09 14:17 | 88K | |
| Tender No. 06-21-22.pdf | 2021-07-09 14:17 | 88K | |
| TENDER NO 03.25.26.tif | 2026-03-25 11:17 | 89K | |
| TYRES.pdf | 2025-09-10 22:49 | 90K | |
| DOC100825-1008202515..> | 2025-10-16 09:03 | 91K | |
| bids recieved for pr..> | 2018-01-15 11:43 | 92K | |
| Tender No. 10-20-21.pdf | 2021-07-09 14:17 | 93K | |
| Tenders Awarded.pdf | 2015-12-01 10:12 | 94K | |
| TENDER NO- 18-24-25.pdf | 2025-04-11 08:46 | 94K | |
| TENDER NO 25.24.25.tif | 2026-03-25 11:17 | 94K | |
| TENDER NO 02.25.26.tif | 2026-03-25 11:17 | 94K | |
| TENDER NO 09.25.26.tif | 2026-03-25 11:17 | 94K | |
| TENDER NO- 16-24-25.pdf | 2025-04-11 08:46 | 94K | |
| TENDER NO- 15-24-25.pdf | 2025-04-11 08:46 | 95K | |
| Tender No. 16-21-22.pdf | 2022-06-15 12:20 | 95K | |
| TENDER NO 08.25.26.tif | 2026-03-25 11:17 | 95K | |
| REQ9357 Repair gears..> | 2026-02-11 15:53 | 95K | |
| Tender No. 07-20-21.pdf | 2021-07-09 14:17 | 98K | |
| 202011160714 1612202..> | 2020-11-16 09:37 | 99K | |
| TENDER NO- 06-24-25.pdf | 2025-04-11 08:46 | 100K | |
| REQ6169.pdf | 2024-09-16 12:37 | 101K | |
| RE7033.pdf | 2025-01-20 09:31 | 101K | |
| REQ6161.pdf | 2024-09-16 12:37 | 101K | |
| REQ6555.pdf | 2024-11-05 08:49 | 101K | |
| REQ6554.pdf | 2024-11-05 08:49 | 101K | |
| REQ6712.pdf | 2024-11-19 09:03 | 101K | |
| REQ6052.pdf | 2024-09-16 12:37 | 101K | |
| REQ6133.pdf | 2024-09-16 12:37 | 101K | |
| REQ6920.pdf | 2025-01-06 08:43 | 101K | |
| REQ6971.pdf | 2025-01-09 14:55 | 101K | |
| 06-24-25.pdf | 2025-04-03 12:17 | 102K | |
| Tender No. 04-21-22.pdf | 2021-07-09 14:17 | 102K | |
| REQ7922.pdf | 2025-06-05 09:01 | 102K | |
| 02-24-25.pdf | 2025-04-03 12:17 | 103K | |
| SPOTLIGHT.pdf | 2025-10-24 15:22 | 103K | |
| TENDER NO 10.24.25.tif | 2026-03-25 11:17 | 104K | |
| TENDER NO- 23-23-24.pdf | 2025-04-11 08:46 | 105K | |
| 14-24-25.pdf | 2025-04-03 12:17 | 106K | |
| TENDER NO- 10-24-25.pdf | 2025-04-11 08:46 | 106K | |
| Bids received for in..> | 2017-12-07 09:58 | 106K | |
| TENDER NO- 22-23-24.pdf | 2025-04-11 08:46 | 106K | |
| 09-24-25.pdf | 2025-04-03 12:17 | 106K | |
| TENDER NOTICE (2).pdf | 2016-02-22 09:50 | 106K | |
| 03-24-25.pdf | 2025-04-03 12:17 | 107K | |
| POLY PIPES .pdf | 2023-10-19 09:04 | 108K | |
| Renatal of Multifuct..> | 2018-09-10 18:00 | 109K | |
| Review of Baphalabor..> | 2018-09-10 18:06 | 110K | |
| CHIAMELO STREET BOQ...> | 2025-02-27 09:27 | 110K | |
| Tender No. 07-18-19 ..> | 2019-07-15 17:18 | 111K | |
| TENDER NO 04.25.26.tif | 2026-03-25 11:17 | 111K | |
| Tender No. 08-20-21.pdf | 2021-07-09 14:17 | 111K | |
| REQ5467.pdf | 2024-06-11 08:04 | 112K | |
| Servicing of Air con..> | 2023-10-19 09:04 | 113K | |
| Bid No 12-18-19 Supp..> | 2020-01-22 09:06 | 113K | |
| 05-24-25.pdf | 2025-04-03 12:17 | 113K | |
| Installation of clea..> | 2024-11-19 10:29 | 113K | |
| TENDER NO- 17-24-25.pdf | 2025-04-11 08:46 | 114K | |
| Coral Etna Tiles.pdf | 2017-08-11 10:14 | 114K | |
| TRASH PUMPS FOR HEAV..> | 2025-09-15 10:49 | 115K | |
| Tender No. 09-21-22.pdf | 2022-06-15 12:20 | 117K | |
| Bid No 09-18-19 Shor..> | 2020-01-22 09:07 | 118K | |
| TENDER NO- 28-23-24.pdf | 2025-04-11 08:46 | 119K | |
| Pool of consultants ..> | 2018-07-10 16:40 | 120K | |
| ben farm upgrading b..> | 2017-07-26 11:07 | 120K | |
| Proposal for Online ..> | 2020-01-22 09:05 | 120K | |
| TENDER NO- 14-24-25.pdf | 2025-04-11 08:46 | 121K | |
| Tenders Awarded05011..> | 2017-01-05 09:30 | 121K | |
| Touchlees Automated ..> | 2021-01-15 14:16 | 122K | |
| Bid No 07-18-19 Proc..> | 2020-01-22 09:08 | 122K | |
| TENDER NO 24.24.25.tif | 2026-03-25 11:17 | 122K | |
| TENDER NO. 06-18-19 ..> | 2019-07-15 17:13 | 123K | |
| Repairs on a Truck F..> | 2023-10-10 15:45 | 123K | |
| Tender No. 07-18-19 ..> | 2019-06-30 18:24 | 123K | |
| Awarded Tenders.pdf | 2018-07-10 16:40 | 124K | |
| TENDER NO- 19-23-24 ..> | 2025-04-11 08:46 | 124K | |
| 248mm – 257mm Casc..> | 2023-08-21 08:33 | 128K | |
| Bid No 06-18-19 Pool..> | 2020-01-22 09:09 | 128K | |
| 167mm – 176mm Casc..> | 2023-08-21 08:33 | 128K | |
| 259mm – 275mm Casc..> | 2023-08-21 08:33 | 128K | |
| 110mm – 130mm Cascad..> | 2023-11-14 08:18 | 129K | |
| 205 – 218mm Cascad..> | 2023-09-05 16:02 | 129K | |
| 189mm – 210mm Cascad..> | 2023-11-14 08:18 | 129K | |
| 455mm – 479mm Casc..> | 2023-08-21 08:33 | 129K | |
| Supply, deliver and ..> | 2023-10-03 08:10 | 129K | |
| Internal Assessment ..> | 2025-07-26 18:57 | 130K | |
| Internal Assessment ..> | 2025-07-31 10:51 | 130K | |
| RE6387.pdf | 2024-10-11 14:15 | 131K | |
| BPM Declaration of i..> | 2024-01-10 15:43 | 133K | |
| Tender No.12-21-22.pdf | 2022-06-15 12:20 | 133K | |
| Tyres of a Refuse co..> | 2023-09-05 16:02 | 134K | |
| Tyres of a Refuse co..> | 2023-09-05 16:02 | 134K | |
| Rental instatllation..> | 2020-01-22 09:04 | 135K | |
| Tender Advert 20 220..> | 2022-06-22 15:46 | 135K | |
| Office blinds.pdf | 2024-05-28 11:52 | 136K | |
| REQ6804 Strategic Se..> | 2024-11-27 10:51 | 136K | |
| TENDER NO. 08-18-19 ..> | 2019-07-15 17:22 | 136K | |
| Membership cards.pdf | 2024-11-14 15:29 | 137K | |
| Tender Advert 20 ADD..> | 2022-06-29 15:15 | 137K | |
| TENDER NO- 03-24-25.pdf | 2025-04-11 08:46 | 138K | |
| REQ6402.pdf | 2024-10-07 12:39 | 139K | |
| Scanner_20250508_210..> | 2025-05-08 16:47 | 139K | |
| RFQ7142 115 LADIES S..> | 2025-02-25 15:11 | 139K | |
| TENDER NO- 02-24-25.pdf | 2025-04-11 08:46 | 140K | |
| Bid No 10-18-19 Supp..> | 2020-01-22 09:07 | 141K | |
| ADVERT Template_2505..> | 2021-05-25 15:27 | 141K | |
| Tender Advert - 09...> | 2024-07-10 15:24 | 141K | |
| Lawn Mowers.pdf | 2022-04-08 14:31 | 143K | |
| Addendum Tenders No...> | 2024-12-09 07:58 | 143K | |
| Advert for 500 split..> | 2022-08-05 13:32 | 144K | |
| Tender advert 10-22-..> | 2022-09-19 15:12 | 144K | |
| REQ9587 (SS60).pdf | 2026-02-11 13:50 | 144K | |
| ELECTRICAL AND STORM..> | 2022-06-29 15:17 | 144K | |
| BPM Supplier Databas..> | 2016-03-15 10:27 | 145K | |
| REQ9583(ASPHALT).pdf | 2026-02-11 13:50 | 145K | |
| TENDER Adverts Dinik..> | 2024-10-11 15:27 | 145K | |
| TENDER Adverts Dinik..> | 2024-10-11 15:37 | 145K | |
| REQ9809.pdf | 2026-02-11 13:50 | 145K | |
| TENDER Security 1.pdf | 2024-11-05 08:49 | 146K | |
| Request for establis..> | 2024-12-12 11:13 | 146K | |
| REQ9810.pdf | 2026-02-11 13:50 | 146K | |
| TENDER Security late..> | 2024-11-28 07:53 | 146K | |
| Requisition for 400 ..> | 2024-10-22 08:47 | 146K | |
| Request for procurem..> | 2024-12-12 11:13 | 148K | |
| REQ9629.pdf | 2026-02-06 14:40 | 148K | |
| Removal of Asbestos ..> | 2022-06-15 13:27 | 148K | |
| Training programme r..> | 2023-10-19 09:04 | 149K | |
| REQ9625.pdf | 2026-02-06 14:40 | 149K | |
| REQ9632 (GRADER).pdf | 2026-02-06 14:40 | 149K | |
| REQ9626 (TIPPER TRUC..> | 2026-02-06 14:40 | 149K | |
| RFQ7144 SAFETY SIGNA..> | 2025-02-25 15:11 | 149K | |
| BOQ 8B.pdf | 2025-10-16 10:47 | 150K | |
| Tender No. 03-21-22.pdf | 2021-07-09 14:17 | 150K | |
| Requesting training ..> | 2023-10-19 09:04 | 151K | |
| Tender advert Benfar..> | 2022-06-29 15:19 | 151K | |
| Procurement of envir..> | 2024-12-12 11:13 | 151K | |
| TENDER ADVERTS.pdf | 2024-10-11 08:30 | 152K | |
| REQ6714.pdf | 2024-11-25 11:24 | 152K | |
| 126665.pdf | 2016-09-13 14:33 | 152K | |
| 126665a.pdf | 2016-09-13 14:33 | 152K | |
| Tender No.10-21-22.pdf | 2022-06-15 12:20 | 152K | |
| Request for a procur..> | 2024-12-12 11:13 | 152K | |
| REQ9656 (TIPPER TRUC..> | 2026-02-09 07:49 | 153K | |
| Water Meter 15mm PVC..> | 2022-07-28 08:48 | 154K | |
| 124766.pdf | 2016-09-13 14:33 | 154K | |
| Water Meter 20mm PVC..> | 2022-07-28 08:48 | 154K | |
| TENDER NO. 08-18-19 ..> | 2019-06-30 18:44 | 155K | |
| 124760.pdf | 2016-09-13 14:33 | 155K | |
| 125072.pdf | 2016-09-13 14:33 | 155K | |
| 125454.pdf | 2016-09-13 14:33 | 155K | |
| Removal of Asbestos ..> | 2022-03-25 09:08 | 156K | |
| 124745.pdf | 2016-09-13 14:33 | 156K | |
| 126010.pdf | 2016-09-13 14:33 | 156K | |
| 126010a.pdf | 2016-09-13 14:33 | 156K | |
| REQ9661 (EXCAVATOR).pdf | 2026-02-09 07:49 | 157K | |
| 126722.pdf | 2016-09-13 14:33 | 158K | |
| 126722a.pdf | 2016-09-13 14:33 | 158K | |
| Prool of Consulting ..> | 2018-09-10 17:51 | 158K | |
| RFQ 7201 (1).pdf | 2025-02-10 10:17 | 158K | |
| Installation of clea..> | 2022-03-25 09:08 | 158K | |
| REQ135121.pdf | 2025-07-11 13:31 | 158K | |
| 126947.pdf | 2016-09-13 14:33 | 158K | |
| 126947a.pdf | 2016-09-13 14:33 | 158K | |
| 124925.pdf | 2016-09-13 14:33 | 158K | |
| 125846.pdf | 2016-09-13 14:33 | 158K | |
| 125846a.pdf | 2016-09-13 14:33 | 158K | |
| 124772.pdf | 2016-09-13 14:33 | 158K | |
| 126351.pdf | 2016-09-13 14:33 | 159K | |
| 126351a.pdf | 2016-09-13 14:33 | 159K | |
| TENDER NO- 04-24-25.pdf | 2025-04-11 08:46 | 159K | |
| RFQ 7202.pdf | 2025-02-10 10:17 | 159K | |
| new tender advert.pdf | 2025-05-16 13:53 | 160K | |
| Medical Surveillance..> | 2024-04-29 14:03 | 160K | |
| Tender No. 02-21-22.pdf | 2021-07-09 14:17 | 162K | |
| REQ135120.pdf | 2025-07-11 13:31 | 163K | |
| BID AWARDED TO TRAIN..> | 2018-01-09 08:13 | 163K | |
| BID AWARDED FOR PROC..> | 2018-01-09 08:13 | 164K | |
| tender awarded for M..> | 2017-07-26 14:14 | 164K | |
| tender awarded for u..> | 2017-07-26 11:06 | 166K | |
| Tender Advert (003).pdf | 2025-01-22 13:14 | 166K | |
| Request for Training..> | 2023-10-19 09:04 | 167K | |
| Scanner_20240819_152..> | 2024-08-20 08:58 | 167K | |
| TENDER AWARDED FOR T..> | 2017-07-26 11:07 | 167K | |
| DIARIES012211.pdf | 2022-11-01 16:08 | 167K | |
| BID AWARDED TO RIVIS..> | 2018-01-10 10:39 | 168K | |
| electrical maintenan..> | 2023-09-18 11:39 | 168K | |
| MASHELE ADVERT.pdf | 2023-08-01 08:20 | 169K | |
| CABLE CU PILC.pdf | 2025-02-24 12:56 | 169K | |
| CABLE 25X3 CORE CU.pdf | 2025-02-24 12:56 | 169K | |
| CABLE 50X3 CORE XLPE..> | 2025-02-24 12:56 | 169K | |
| electrical maintanen..> | 2023-09-18 11:39 | 170K | |
| TENDER ADVERT LANDFI..> | 2026-02-06 14:50 | 170K | |
| Tender No. 01-21-22.pdf | 2021-07-09 14:17 | 170K | |
| Slurry seal230310.pdf | 2023-03-10 08:27 | 170K | |
| Cable LT PVC 16mm.pdf | 2025-05-07 15:10 | 172K | |
| Cable SWA 95mm x 4 C..> | 2025-05-07 15:10 | 172K | |
| Lip channel 175 X 75..> | 2025-02-12 15:22 | 172K | |
| Supply and delivery ..> | 2025-02-19 14:17 | 172K | |
| Blankets and Mattres..> | 2025-03-31 08:23 | 172K | |
| Supply of 200W LED f..> | 2025-04-16 10:24 | 172K | |
| Supply and delivery ..> | 2025-02-21 14:26 | 172K | |
| TLB needed to assist..> | 2025-03-18 12:12 | 172K | |
| Supply and delivery ..> | 2025-03-11 16:14 | 172K | |
| 2m x 3mm steel roads..> | 2025-02-19 14:17 | 172K | |
| Supply and delivery ..> | 2025-02-19 14:17 | 172K | |
| Supply and delivery ..> | 2025-03-11 16:14 | 172K | |
| De Weeding and pouri..> | 2025-02-19 14:17 | 172K | |
| Request for fifty (5..> | 2025-02-21 14:26 | 172K | |
| TLB needed to assist..> | 2025-03-18 12:12 | 172K | |
| TLB request for digg..> | 2025-05-07 15:10 | 172K | |
| Request for Bulldoze..> | 2025-02-19 14:17 | 172K | |
| BTU REQ7250.pdf | 2025-03-24 15:55 | 172K | |
| Environment monitori..> | 2025-04-08 09:02 | 172K | |
| BTU Repairs and main..> | 2025-04-08 09:08 | 172K | |
| supply and delivery ..> | 2025-03-11 16:14 | 172K | |
| Excavator needed to ..> | 2025-04-29 15:12 | 172K | |
| 20 litre paints REQ7..> | 2025-05-05 15:49 | 172K | |
| Hiring of grader at ..> | 2025-03-11 16:14 | 172K | |
| tipper truck0402.pdf | 2025-02-04 08:58 | 172K | |
| ADVERT Template -Err..> | 2021-05-27 07:57 | 173K | |
| Fire Extinguisher se..> | 2024-05-31 09:28 | 173K | |
| 7885 TOILET PAPER .pdf | 2025-05-21 09:17 | 173K | |
| REQ7631 TLB .pdf | 2025-06-03 09:56 | 173K | |
| 7887 REFUSE BAGS.pdf | 2025-05-21 09:17 | 173K | |
| TLB 763025.pdf | 2025-06-09 09:10 | 173K | |
| RFQ7488 BUILDING PLA..> | 2025-05-07 15:10 | 173K | |
| RFQ7488 BUILDING PLA..> | 2025-05-08 21:29 | 173K | |
| RFQ7685 .pdf | 2025-05-12 14:55 | 173K | |
| RFQ7685 130525.pdf | 2025-05-13 09:46 | 173K | |
| SERVICING OF FIRE EX..> | 2022-03-30 14:59 | 174K | |
| ELECTRONIC DOCUMENT ..> | 2017-05-22 12:14 | 174K | |
| Requesting training ..> | 2023-10-19 09:04 | 174K | |
| Bids received for re..> | 2017-12-11 07:58 | 175K | |
| bids received for pr..> | 2017-12-11 11:02 | 175K | |
| Construction of 16m ..> | 2025-05-30 15:28 | 175K | |
| 20L of white paint f..> | 2025-05-08 21:24 | 175K | |
| Uniform for 5 offici..> | 2025-05-14 16:11 | 175K | |
| Book vehicle Itinera..> | 2025-05-26 09:45 | 175K | |
| REQ8272.pdf | 2025-07-26 18:55 | 175K | |
| REQ8270.pdf | 2025-07-26 18:55 | 176K | |
| MEETING LINKS.pdf | 2026-02-11 10:54 | 176K | |
| REQ9327 DIARIES.pdf | 2025-11-24 12:03 | 176K | |
| SHORT-TERM INSURANCE..> | 2017-05-22 12:15 | 176K | |
| 135608.pdf | 2020-05-11 15:59 | 176K | |
| Refurbishment of Cle..> | 2017-05-22 12:15 | 177K | |
| bids received for up..> | 2017-07-26 11:07 | 177K | |
| Bids received for ap..> | 2018-01-25 09:00 | 177K | |
| REQ8271.pdf | 2025-07-26 18:55 | 177K | |
| Tshelang Gape to R71..> | 2017-05-22 12:15 | 177K | |
| Bids received for tr..> | 2017-12-06 09:02 | 177K | |
| Tender Advert 825.pdf | 2025-09-04 07:30 | 177K | |
| Notice - Extention o..> | 2019-06-07 10:10 | 178K | |
| bids received for el..> | 2017-12-13 09:06 | 178K | |
| POTHOLE PATCHING MAT..> | 2017-05-22 12:15 | 178K | |
| REQ8001.pdf | 2025-06-11 09:06 | 178K | |
| bids received for MF..> | 2017-07-26 14:14 | 178K | |
| bids received for po..> | 2017-12-13 10:34 | 178K | |
| Supply and delivery ..> | 2017-05-22 12:15 | 178K | |
| bids received for el..> | 2017-12-08 11:11 | 179K | |
| TENDER NO 04-18-19 P..> | 2019-07-15 17:10 | 181K | |
| ADVERT 2024 (AutoRec..> | 2024-11-07 08:47 | 181K | |
| Notice - Extention o..> | 2020-06-08 08:40 | 181K | |
| ADVERT 2024 (AutoRec..> | 2024-11-07 08:47 | 182K | |
| RFQ7143 GOLF SHIRTS.pdf | 2025-02-25 15:11 | 183K | |
| training for Compute..> | 2018-10-04 19:52 | 183K | |
| Scanner_20240320_194..> | 2024-03-20 15:00 | 183K | |
| Bids received for up..> | 2017-12-08 10:20 | 184K | |
| 129062sf.pdf | 2017-05-11 08:49 | 184K | |
| Litter Pickers231101..> | 2023-10-31 12:18 | 184K | |
| TENDER NO- 12-24-25.pdf | 2025-04-11 08:46 | 184K | |
| Training First AID L..> | 2018-10-04 19:52 | 185K | |
| TENDER NO 04-18-19 P..> | 2019-06-30 18:36 | 185K | |
| REQ6701.pdf | 2024-11-12 13:58 | 186K | |
| Provision Waste Disp..> | 2017-05-22 12:15 | 186K | |
| Conducting of medica..> | 2023-02-07 07:57 | 186K | |
| Conducting of instit..> | 2023-02-07 07:57 | 187K | |
| bids received for su..> | 2017-12-05 08:04 | 187K | |
| Meter Water PVC 15MM..> | 2022-06-15 13:21 | 188K | |
| Servicing of fire ex..> | 2023-06-13 10:24 | 188K | |
| METER WATER PVC 15mm..> | 2023-03-29 09:21 | 189K | |
| OFFICE FURNITURE2310..> | 2023-10-10 15:15 | 189K | |
| Cable LT PVC 10MM4 C..> | 2025-02-25 15:10 | 189K | |
| Cable SWA 95mm x4 co..> | 2025-02-25 15:10 | 189K | |
| Request for one thou..> | 2024-09-17 15:48 | 189K | |
| 420-440 CASCADE CLAM..> | 2024-10-25 08:20 | 189K | |
| 420-440mm Cascade cl..> | 2024-10-25 09:54 | 189K | |
| Refuse Bag heavy dut..> | 2025-02-03 08:31 | 189K | |
| 80mm pillar head fir..> | 2024-10-31 08:13 | 189K | |
| TLB Needed to assist..> | 2024-09-17 15:48 | 189K | |
| 400-420mm Cascade cl..> | 2024-10-25 09:54 | 189K | |
| snake repellents err..> | 2024-12-18 07:32 | 189K | |
| 400-420mm Cascade cl..> | 2024-10-25 08:20 | 189K | |
| Paper blank A4 80GSM..> | 2025-02-25 15:10 | 189K | |
| Paper blank A4 80GSM..> | 2025-02-25 15:10 | 189K | |
| 318-345mm Cascade cl..> | 2024-10-25 08:20 | 189K | |
| 318-345mm Cascade cl..> | 2024-10-25 09:54 | 189K | |
| Cable 95mmx3 CORE co..> | 2025-02-24 11:51 | 189K | |
| 80mmx1.8m galv pipe ..> | 2024-10-31 08:13 | 189K | |
| Cable LT PVC 10MM RE..> | 2025-02-24 11:51 | 189K | |
| Cable LT PVC 16MMx4 ..> | 2025-02-24 11:51 | 189K | |
| Cable 25MMx4 CORE CO..> | 2025-02-24 11:51 | 189K | |
| Resilient seated gat..> | 2024-10-25 08:20 | 189K | |
| Resilient seated gat..> | 2024-10-25 09:54 | 189K | |
| Cable 35mmx4 CORE CU..> | 2025-02-24 11:51 | 189K | |
| Supply and delivery ..> | 2025-02-19 14:17 | 189K | |
| Resilient seated gat..> | 2024-10-31 08:13 | 189K | |
| Cable LT PVC 16mm CO..> | 2025-02-24 11:51 | 189K | |
| TLB Needed to assist..> | 2025-01-13 10:05 | 189K | |
| advert REQ7008.pdf | 2025-01-10 11:13 | 189K | |
| TLB Needed to assist..> | 2025-01-13 09:51 | 189K | |
| TLB Needed to assist..> | 2025-01-13 10:00 | 189K | |
| Request for 100m x 5..> | 2024-11-19 09:39 | 189K | |
| Hiring of 10 cubes t..> | 2024-09-17 15:48 | 189K | |
| Supply and delivery ..> | 2025-02-19 14:17 | 189K | |
| Request for TLB 4 x ..> | 2024-09-17 15:48 | 189K | |
| REQUEST FOR BULLDOZE..> | 2024-10-11 08:11 | 189K | |
| Hiring of TLB for th..> | 2024-09-17 15:48 | 189K | |
| TLB request for digg..> | 2025-02-19 14:17 | 189K | |
| 1883E Namakgale stre..> | 2025-01-13 10:19 | 189K | |
| Supply and delivery ..> | 2025-02-19 14:17 | 189K | |
| REQUEST FOR BULLDOZE..> | 2024-10-11 08:11 | 189K | |
| ADVERT 2025 REQ7002.pdf | 2025-01-10 11:18 | 189K | |
| Request TLB for 20 d..> | 2025-02-03 08:31 | 189K | |
| ADVERT 2025 REQ7000.pdf | 2025-01-10 11:26 | 189K | |
| ADVERT 2025 REQ7001.pdf | 2025-01-10 11:23 | 189K | |
| Security doors.pdf | 2025-02-04 08:58 | 189K | |
| REQUEST FOR TLB AND ..> | 2024-10-11 08:11 | 189K | |
| Hiring of TLB for 21..> | 2025-03-12 15:48 | 189K | |
| Hiring of Tipper Tru..> | 2025-03-12 15:48 | 189K | |
| elect2.pdf | 2026-03-26 12:02 | 189K | |
| Hiring of Excavator ..> | 2025-03-12 15:48 | 189K | |
| Hiring of excavator ..> | 2024-10-22 08:47 | 189K | |
| Hiring of Grader at ..> | 2025-03-12 15:48 | 189K | |
| Hiring of Bulldozer ..> | 2025-03-12 15:48 | 189K | |
| Hiring of bulldozer ..> | 2024-10-22 08:47 | 189K | |
| Request for procurem..> | 2025-04-02 15:40 | 189K | |
| Cleaning materils RE..> | 2025-03-19 14:06 | 189K | |
| Supply and commissio..> | 2025-01-02 08:27 | 190K | |
| Toner cartridge Lex..> | 2025-02-03 08:31 | 190K | |
| Transformer 200 KVA ..> | 2024-10-22 08:47 | 190K | |
| Transformer- pole mo..> | 2024-10-22 08:47 | 190K | |
| Supply and delivery ..> | 2024-10-01 10:16 | 190K | |
| Transformer 150 KVA ..> | 2024-10-22 08:47 | 190K | |
| 455mm-500mm cascade ..> | 2024-11-06 08:14 | 190K | |
| Cooling system or ge..> | 2024-11-01 10:16 | 190K | |
| Refuse bags heavy du..> | 2024-11-07 07:53 | 190K | |
| Cooling system or ge..> | 2024-10-31 08:14 | 190K | |
| waste rag & pine gel..> | 2024-11-07 07:53 | 190K | |
| 340-365mm Cascade Cl..> | 2024-11-06 08:14 | 190K | |
| ADVERT 2024 CABLE SW..> | 2024-11-11 12:12 | 190K | |
| ADVERT 2024 CABLE 15..> | 2024-11-11 12:08 | 190K | |
| Paper blank A4 80GSM..> | 2024-10-04 15:13 | 190K | |
| 365- 385mm Cascade C..> | 2024-11-06 08:14 | 190K | |
| MAC AFRIC Lt 690 Tru..> | 2024-11-11 14:57 | 190K | |
| Toilet paper 500 she..> | 2025-02-03 09:11 | 190K | |
| ADVERT 2024 CABLE LT..> | 2024-11-11 12:06 | 190K | |
| 3 in 1 Laser-jet pri..> | 2024-12-18 07:32 | 190K | |
| Supply and delivery ..> | 2024-10-01 10:09 | 190K | |
| Types for truck DZB ..> | 2024-12-10 14:22 | 190K | |
| Supply and delivery ..> | 2024-10-01 10:11 | 190K | |
| Repairs for crane tr..> | 2025-01-28 07:49 | 190K | |
| One drive for offlin..> | 2024-12-18 07:32 | 190K | |
| Water and sanitation..> | 2024-11-07 15:26 | 190K | |
| Request for twenty f..> | 2024-11-11 10:59 | 190K | |
| Current transformer2..> | 2024-10-01 09:10 | 190K | |
| Filter 20 minutes.pdf | 2025-01-17 14:49 | 190K | |
| Water and sanitation..> | 2024-11-07 15:24 | 190K | |
| Road marking paints.pdf | 2025-01-22 12:33 | 190K | |
| Types for truck size..> | 2024-12-10 14:23 | 190K | |
| Supply and deliver o..> | 2024-11-06 08:14 | 190K | |
| Supply and delivery ..> | 2024-10-01 10:14 | 190K | |
| Supply and delivery ..> | 2024-11-06 08:14 | 190K | |
| Repairs for cherry p..> | 2024-10-17 07:54 | 190K | |
| Supply and deliver o..> | 2024-11-06 08:14 | 190K | |
| Supply and delivery ..> | 2025-02-03 07:55 | 190K | |
| 50W LED Streetlight ..> | 2025-01-17 14:49 | 190K | |
| SF6 breaker refills ..> | 2025-01-17 12:09 | 190K | |
| Self contained floor..> | 2024-10-17 07:57 | 190K | |
| Manhole chamber.pdf | 2024-11-19 11:05 | 190K | |
| Supply, Delivery and..> | 2024-11-14 15:29 | 190K | |
| TLB request for digg..> | 2025-01-02 08:27 | 190K | |
| Hiring of excavator ..> | 2024-12-10 14:16 | 190K | |
| Request for sports 4..> | 2024-11-11 11:06 | 190K | |
| Request for six (6) ..> | 2024-11-11 11:09 | 190K | |
| Supply a 22Kv curren..> | 2025-01-17 14:49 | 190K | |
| 100W Solar floor lig..> | 2025-01-17 14:49 | 190K | |
| TLB 4 X 2 request fo..> | 2024-11-11 10:57 | 190K | |
| Supply and delivery ..> | 2024-10-14 11:35 | 190K | |
| Excavator needed to ..> | 2024-10-07 09:43 | 190K | |
| Hiring of dozer @ we..> | 2024-12-10 14:16 | 190K | |
| Page C.2.2.132 - Bil..> | 2021-01-22 11:27 | 190K | |
| Supply and delivery ..> | 2024-10-14 11:47 | 190K | |
| Supply and delivery ..> | 2024-10-14 11:44 | 190K | |
| Supply and delivery ..> | 2024-10-14 11:48 | 190K | |
| Hiring of 10m3 of ti..> | 2024-12-10 14:16 | 190K | |
| voltage transformer ..> | 2024-11-06 08:14 | 190K | |
| Hiring of TLB @ wet ..> | 2024-12-10 14:16 | 190K | |
| Hiring of TLB for 21..> | 2024-10-01 09:59 | 190K | |
| Hiring of roller wit..> | 2025-02-03 07:55 | 190K | |
| Laptops.pdf | 2024-12-18 07:32 | 190K | |
| Hiring of the grader..> | 2024-10-01 09:52 | 190K | |
| Supply and delivery ..> | 2025-02-05 14:14 | 190K | |
| Maintenance of isola..> | 2024-11-07 07:53 | 190K | |
| Supply and delivery ..> | 2025-02-05 14:14 | 190K | |
| Supply and delivery ..> | 2025-02-05 14:14 | 190K | |
| Supply and delivery ..> | 2025-02-05 14:14 | 190K | |
| Construct a 1kkV ove..> | 2025-01-17 14:49 | 190K | |
| Hiring of 10m3 Tippe..> | 2024-10-01 10:07 | 190K | |
| 1x 65 seater luxury ..> | 2024-09-23 14:19 | 190K | |
| Maintenance of airco..> | 2024-11-06 08:14 | 190K | |
| Request for two (2) ..> | 2025-04-03 10:31 | 190K | |
| Servicing of fire ex..> | 2022-06-15 13:21 | 190K | |
| Cable 95mm REQ7472.pdf | 2025-03-19 14:06 | 190K | |
| Cable 70mm REQ7471.pdf | 2025-03-19 14:06 | 190K | |
| Cable LT PVC 16MMX4.pdf | 2025-03-19 14:06 | 190K | |
| Pipe Poly 20mm REQ74..> | 2025-03-19 14:06 | 190K | |
| Cable 120mm REQ7473.pdf | 2025-03-19 14:06 | 190K | |
| REQ9932.pdf | 2026-03-03 10:36 | 190K | |
| Exchange online on o..> | 2024-12-18 07:32 | 191K | |
| ADVERT 2024 FERRULE..> | 2024-11-11 13:11 | 191K | |
| ADVERT 2024 ferrules..> | 2024-11-11 14:33 | 191K | |
| ADVERT 2024 POLY PIP..> | 2024-11-19 09:03 | 191K | |
| ADVERT 2024 POLY PIP..> | 2024-11-19 09:03 | 191K | |
| ADVERT 2024 REQ6627.pdf | 2024-11-20 10:25 | 191K | |
| ADVERT 2024 SEW PIPE..> | 2024-11-19 09:03 | 191K | |
| Repairs for Tafe Tra..> | 2025-03-10 09:10 | 191K | |
| ADVERT 2024 REQ6626.pdf | 2024-11-20 11:27 | 191K | |
| ADVERT 2024 REQ 6783..> | 2024-11-20 11:38 | 191K | |
| section 56 .pdf | 2025-02-04 08:58 | 191K | |
| ADVERT 2024 (AutoRec..> | 2024-11-07 08:47 | 191K | |
| ADVERT 2024 PIPE POL..> | 2024-11-19 09:03 | 191K | |
| ADVERT 2024 (AutoRec..> | 2024-11-07 08:47 | 191K | |
| Stationery REQ7295.pdf | 2025-03-19 14:06 | 191K | |
| Meter water PVC 20mm..> | 2022-06-15 13:21 | 191K | |
| ADVERT 2024 REQ6779.pdf | 2024-11-20 10:44 | 191K | |
| BENFARM UPGRADING OF..> | 2017-02-22 08:56 | 191K | |
| ADVERT 2024 REQ 6780..> | 2024-11-20 10:58 | 191K | |
| ERRATUM FOR WARD COM..> | 2017-10-31 15:25 | 192K | |
| UPGRADING OF SELWANE..> | 2017-05-19 08:46 | 192K | |
| Erratun to Tender No..> | 2021-06-02 14:31 | 192K | |
| Refurbishment of at ..> | 2023-09-05 16:02 | 193K | |
| Uniform (3).pdf | 2025-05-16 13:53 | 193K | |
| INTENTION TO AMEND C..> | 2024-07-25 12:13 | 193K | |
| CONTRACT REGISTER FO..> | 2015-04-24 11:18 | 193K | |
| High back ergonomic ..> | 2025-07-31 11:00 | 194K | |
| TENDER NO- 11-24-25.pdf | 2025-04-11 08:46 | 195K | |
| REQ6427.pdf | 2024-10-11 14:15 | 195K | |
| METER WATER PVC 20mm..> | 2023-03-29 09:21 | 195K | |
| TENDER NO- 13-24-25.pdf | 2025-04-11 08:46 | 198K | |
| Hire a CPC100 Hi cur..> | 2024-12-09 07:55 | 199K | |
| Excavator needed at ..> | 2024-11-19 09:51 | 200K | |
| advert benfarm upgra..> | 2016-08-25 08:14 | 200K | |
| advert FOR MFMP TRAI..> | 2017-01-25 12:55 | 200K | |
| PPE For EPWP Program..> | 2022-09-13 14:52 | 201K | |
| Toilet Paper 500 She..> | 2024-10-04 15:13 | 202K | |
| Tender Advert (003)-..> | 2025-08-15 08:29 | 202K | |
| Bids received for up..> | 2017-12-07 09:58 | 203K | |
| TENDER NO- 24-23-24.pdf | 2025-04-11 08:46 | 203K | |
| EPWP PPE.pdf | 2024-08-26 14:00 | 204K | |
| Bids Received Meter ..> | 2018-07-10 16:11 | 204K | |
| tender advert July 2..> | 2025-07-28 09:59 | 204K | |
| REQ6710.pdf | 2025-02-13 14:43 | 204K | |
| Kilimanjaro desert b..> | 2024-11-19 10:38 | 204K | |
| 14days TLB and tippe..> | 2021-01-15 14:16 | 205K | |
| Proposal for general..> | 2019-01-16 11:34 | 205K | |
| Remove, supply and i..> | 2024-11-19 10:50 | 205K | |
| Guardrails standard ..> | 2024-12-12 10:06 | 206K | |
| REQ9268.pdf | 2025-11-18 12:49 | 206K | |
| Provision of service..> | 2019-01-16 11:26 | 206K | |
| Request for treatmen..> | 2024-12-12 11:13 | 206K | |
| VISUAL MEETINGS LINK..> | 2026-02-12 16:14 | 207K | |
| Req No.95345.pdf | 2025-12-24 10:21 | 208K | |
| RFQ9373.pdf | 2025-11-26 15:21 | 208K | |
| REQ9896 (TRAINING).pdf | 2026-03-10 15:53 | 209K | |
| RFQ9374.pdf | 2025-11-26 15:21 | 210K | |
| Pool of travel agenc..> | 2019-07-15 19:35 | 211K | |
| Pool of travel agenc..> | 2019-01-16 11:38 | 211K | |
| REQ7169.pdf | 2025-02-17 12:32 | 211K | |
| ADVERT-POOL OF CONSU..> | 2018-04-25 14:58 | 211K | |
| TENDER ADVERT PANEL ..> | 2026-02-06 14:50 | 211K | |
| NAME BADGES.pdf | 2026-02-18 14:53 | 211K | |
| ADVERT-TRAVEL AGENCY..> | 2018-04-25 14:46 | 211K | |
| Pre-Engineering desi..> | 2023-08-21 08:33 | 211K | |
| ADVERT-DESIGN AND CO..> | 2018-04-25 14:40 | 212K | |
| Bids Received Rental..> | 2018-07-10 16:11 | 212K | |
| ADVERT-SUPPLY AND DE..> | 2018-04-25 14:49 | 212K | |
| Erratum REQ4814 Supe..> | 2025-01-06 12:43 | 212K | |
| ADVERT-POOL OF CONSU..> | 2018-04-25 14:55 | 212K | |
| ADVERT-PROPOSAL FOR ..> | 2018-04-25 14:36 | 212K | |
| ADVERT- PROPOSAL FOR..> | 2018-04-25 15:00 | 212K | |
| REQ4814 Supervision ..> | 2024-12-09 07:49 | 212K | |
| ADVERT-RENTAL OF MUL..> | 2018-04-25 14:52 | 212K | |
| Pre-Engineering desi..> | 2023-08-21 08:33 | 213K | |
| RFQ95335.pdf | 2025-12-24 10:21 | 213K | |
| advert FOR the indig..> | 2016-11-21 10:53 | 213K | |
| SUPPLY AND DELIVERY ..> | 2026-02-18 14:53 | 214K | |
| Bids Received Pool o..> | 2018-07-10 16:11 | 216K | |
| Provision of Securit..> | 2022-08-11 08:52 | 216K | |
| PPE for EPWP210723.pdf | 2023-07-21 15:28 | 216K | |
| Tender Advert 925.pdf | 2025-09-25 07:45 | 217K | |
| Bids Received Propos..> | 2018-07-10 16:11 | 218K | |
| ADVERT - TENDER NO 0..> | 2018-08-07 14:58 | 218K | |
| REQ4064.pdf | 2024-02-12 10:29 | 218K | |
| SUPPLY AND DELIVERY ..> | 2026-02-20 10:50 | 218K | |
| ADVERT -PROPOSAL FOR..> | 2018-06-06 07:59 | 218K | |
| ADVERT - TENDER NO 0..> | 2018-08-07 14:58 | 219K | |
| advert-Refuse Remova..> | 2017-08-03 12:43 | 219K | |
| REQUEST FOR AN ENVIR..> | 2023-08-07 09:01 | 219K | |
| REQUEST FOR AN ENVIR..> | 2023-01-27 11:30 | 219K | |
| ADVERT -PROPOSAL FOR..> | 2018-06-06 08:00 | 219K | |
| ADVERT - PROPOSAL FO..> | 2018-09-10 07:45 | 219K | |
| ADVERT - PROPOSAL FO..> | 2018-09-10 07:45 | 219K | |
| ADVERT - TENDER NO ..> | 2018-08-07 14:58 | 219K | |
| ADVERT - PROCUREMENT..> | 2017-05-15 08:45 | 219K | |
| bids received for ap..> | 2017-12-05 14:00 | 220K | |
| Refurbishment of Tha..> | 2022-08-22 08:22 | 220K | |
| ADVERT - PROPOSAL FO..> | 2018-06-01 09:55 | 221K | |
| ERRATUM For Paper bl..> | 2021-09-23 14:00 | 222K | |
| Toilet Papers.pdf | 2021-09-14 08:08 | 223K | |
| Spray Painting of Tr..> | 2021-09-14 16:27 | 223K | |
| E650 Smart meter24.pdf | 2024-10-01 09:12 | 223K | |
| TENDER NO- 09-24-25.pdf | 2025-04-11 08:46 | 224K | |
| METER WATER PVC 15MM..> | 2023-01-24 16:41 | 225K | |
| 20180601094940084.pdf | 2018-06-01 09:47 | 226K | |
| METER WATER PVC 20MM..> | 2023-01-24 16:41 | 226K | |
| REQ7892.pdf | 2025-05-29 15:27 | 226K | |
| REQ74602.pdf | 2025-05-08 21:29 | 227K | |
| Email Security.pdf | 2021-08-18 08:02 | 227K | |
| tyres for a truck an..> | 2024-11-11 10:52 | 228K | |
| TENDER NO- 07-24-25.pdf | 2025-04-11 08:46 | 228K | |
| REQ7463.pdf | 2025-03-31 08:23 | 229K | |
| Uniform of traffic o..> | 2024-11-08 09:04 | 229K | |
| ADVERTISEMENT OF DIF..> | 2019-01-30 13:48 | 229K | |
| EL1- CABLE 50X3 CORE..> | 2025-12-24 10:21 | 230K | |
| TENDER NO- 27-23-24.pdf | 2025-04-11 08:46 | 231K | |
| POE Switch and Line ..> | 2022-08-11 08:52 | 233K | |
| EL5- 35MM 3 CORE2512..> | 2025-12-24 11:01 | 233K | |
| Hiring of Grader for..> | 2025-09-10 23:02 | 234K | |
| EL5- 35MM 3 CORE 25.pdf | 2025-12-24 10:21 | 234K | |
| hiring of a grader f..> | 2025-09-10 23:02 | 234K | |
| ADVERT - SUPPLY AND ..> | 2017-10-05 15:30 | 234K | |
| Hiring of excavator.pdf | 2025-09-10 23:02 | 234K | |
| ADVERT - POOL OF CON..> | 2017-09-14 09:35 | 235K | |
| ADVERT - PROPOSAL FO..> | 2017-11-14 10:14 | 235K | |
| ADVERT - PROPOSAL FO..> | 2018-02-14 14:25 | 236K | |
| ADVERT - PROPOSAL FO..> | 2017-04-10 09:06 | 237K | |
| Crusher Dust .pdf | 2021-09-29 10:11 | 237K | |
| Inspection of defect..> | 2021-08-25 14:01 | 237K | |
| REQUEST FOR 25 LEARN..> | 2025-09-11 07:53 | 237K | |
| EL2- CABLE 70MMX3 CO..> | 2025-12-24 10:21 | 237K | |
| Ethics Management Tr..> | 2023-10-13 14:00 | 238K | |
| RFQ 11308.pdf | 2021-08-13 11:56 | 239K | |
| Roadstones .pdf | 2021-09-29 10:11 | 240K | |
| EL3-CABLE 120MM 3 CO..> | 2025-12-24 10:21 | 240K | |
| Tender No.08-21-22 0..> | 2022-02-04 09:02 | 240K | |
| EL4 - CABLE XLPE SWA..> | 2025-12-24 10:21 | 240K | |
| 139796.pdf | 2021-08-18 14:56 | 240K | |
| 2021_2022 DRAFT IDP ..> | 2021-08-06 15:10 | 240K | |
| 125182 Flexiback.pdf | 2016-05-16 08:37 | 241K | |
| EL4 - CABLE XLPE SWA..> | 2025-12-24 11:01 | 241K | |
| Steel doors250821.pdf | 2021-08-25 14:01 | 242K | |
| 125181 Root Saw.pdf | 2016-05-16 08:37 | 243K | |
| ADVERT - LIST OF TEN..> | 2017-08-16 13:58 | 245K | |
| ADVERT - POOL OF CON..> | 2017-08-14 16:06 | 245K | |
| ADVERT - TSHELANG TO..> | 2017-08-16 12:59 | 245K | |
| TENDER NO- 08-24-25.pdf | 2025-04-11 08:46 | 245K | |
| ADVERT - PROPOSAL FO..> | 2018-04-20 08:54 | 248K | |
| Catering services fo..> | 2025-02-17 12:33 | 249K | |
| Meter Water PVC 20mm..> | 2023-06-05 08:53 | 249K | |
| TENDER NO- 26-23-24.pdf | 2025-04-11 08:46 | 250K | |
| PLAIN COUNTER SCREEN..> | 2022-06-15 13:21 | 250K | |
| REQ9843.pdf | 2026-02-26 09:37 | 250K | |
| 13-23-24.pdf | 2024-04-10 12:06 | 250K | |
| 09-22-23.pdf | 2023-04-25 13:12 | 250K | |
| IMBIZO TRANSPORT-25.pdf | 2025-08-06 14:38 | 250K | |
| 10-23-24.pdf | 2024-04-10 12:06 | 251K | |
| 19-21-22.pdf | 2022-12-07 12:32 | 252K | |
| 7-22-2023.pdf | 2023-04-25 13:12 | 252K | |
| 09-23-24.pdf | 2024-04-10 12:06 | 252K | |
| 01-22-23-A.pdf | 2022-12-07 12:32 | 252K | |
| 20-21-22.pdf | 2022-12-07 12:32 | 252K | |
| Meter Water PVC 15mm..> | 2023-06-05 08:53 | 252K | |
| 11-22-2023.pdf | 2023-04-25 13:12 | 252K | |
| 11-23-24.pdf | 2024-04-10 12:06 | 252K | |
| 06-23-24.pdf | 2024-04-10 12:06 | 253K | |
| 01-23-24B.pdf | 2023-10-17 12:06 | 253K | |
| 01-22-23-D.pdf | 2022-12-07 12:32 | 253K | |
| 03-23-24.pdf | 2024-04-10 12:06 | 253K | |
| Meter Water PVC 15mm..> | 2023-10-09 15:57 | 253K | |
| Refuse Bags0203 .pdf | 2022-02-03 15:19 | 254K | |
| 01-22-23-C.pdf | 2022-12-07 12:32 | 254K | |
| 04-23-23.pdf | 2024-04-10 12:06 | 254K | |
| Clear Vu Fencing0102..> | 2022-02-01 08:01 | 254K | |
| Repair of TLB.pdf | 2021-11-08 11:51 | 254K | |
| 05-23-24.pdf | 2024-04-10 12:06 | 254K | |
| 04-22-2023.pdf | 2022-12-07 12:32 | 254K | |
| 02-23-24.pdf | 2024-04-10 12:06 | 254K | |
| 02-22-2023.pdf | 2022-12-07 12:32 | 254K | |
| REQ9899.pdf | 2026-02-26 09:39 | 255K | |
| 03-22-2023.pdf | 2022-12-07 12:32 | 255K | |
| DOC102725-1027202515..> | 2025-10-29 09:07 | 256K | |
| Tender No. 04-20-21.pdf | 2021-07-09 14:17 | 256K | |
| REQ8709 ( ICT RISK A..> | 2025-09-02 09:23 | 256K | |
| REQ7416.pdf | 2025-03-12 12:32 | 257K | |
| REQ7414.pdf | 2025-03-12 12:32 | 257K | |
| req7130 toner cartri..> | 2025-07-23 11:44 | 258K | |
| Paper blank A4 80GSM..> | 2025-07-24 14:26 | 258K | |
| REQ5699.pdf | 2024-07-31 10:28 | 258K | |
| REQ5698.pdf | 2024-07-31 10:28 | 258K | |
| REQ5944.pdf | 2024-08-20 17:32 | 258K | |
| 125183 Water Meters.pdf | 2016-05-16 08:37 | 259K | |
| REQ5726.pdf | 2024-08-02 09:00 | 259K | |
| Meter Water PVC 20mm..> | 2023-10-11 07:31 | 259K | |
| TENDER NO 11.24.25.tif | 2026-03-25 11:21 | 260K | |
| REQ5640.pdf | 2024-07-22 09:02 | 260K | |
| PPE Environmental Ma..> | 2025-10-23 15:07 | 260K | |
| REF0579.pdf | 2024-07-16 08:55 | 261K | |
| PPE For EPWP IG Prog..> | 2020-10-01 07:31 | 261K | |
| ADVERT - supply and ..> | 2016-03-24 08:21 | 261K | |
| REF1508.pdf | 2024-07-16 08:55 | 261K | |
| REF1509.pdf | 2024-07-16 08:55 | 261K | |
| Fencing materials241..> | 2021-11-24 15:44 | 261K | |
| CABLE PEX, PEX, COPP..> | 2022-01-03 15:41 | 261K | |
| Termination Kit 25-7..> | 2021-10-07 12:19 | 262K | |
| Distribution Box LK9..> | 2022-01-03 15:41 | 263K | |
| Termination Kit & Jo..> | 2021-10-07 12:19 | 263K | |
| Transformer 150 KVA ..> | 2022-01-03 15:41 | 263K | |
| Circuit Breaker Hein..> | 2022-01-03 15:41 | 263K | |
| Termination Kit 25 x..> | 2021-10-07 12:19 | 264K | |
| Termination Kit 35-9..> | 2021-10-07 12:19 | 264K | |
| Termination Kit & Jo..> | 2021-10-07 12:19 | 264K | |
| Joint kit 25mm-95mm ..> | 2021-10-29 10:44 | 264K | |
| Joint kit 25mm-95mm ..> | 2021-10-29 10:44 | 264K | |
| Joint Kit 25mm-95mmx..> | 2021-10-07 12:19 | 267K | |
| Erratum for majeje p..> | 2025-09-25 07:47 | 268K | |
| 20171114091703863-te..> | 2017-11-14 08:35 | 269K | |
| Refurbishment of cei..> | 2021-08-25 14:01 | 270K | |
| 20170801111008340.pdf | 2017-08-03 12:42 | 270K | |
| TENDER NO 12.24.25.tif | 2026-03-25 11:21 | 271K | |
| EL6-2025-26 Single P..> | 2026-02-05 11:27 | 271K | |
| EL6-2025-26 Single P..> | 2026-01-12 18:52 | 271K | |
| REQ6566.pdf | 2024-11-06 08:14 | 272K | |
| SDBIP Review.pdf | 2024-05-31 09:28 | 273K | |
| WATER METER 20MM PVC..> | 2024-02-09 15:15 | 273K | |
| WATER METER 15MM PVC..> | 2024-02-09 15:15 | 273K | |
| Hiring of a grader a..> | 2025-01-07 11:38 | 274K | |
| req8812 SSL CERTIFIC..> | 2025-09-04 19:32 | 275K | |
| Steel Palisade Fence..> | 2021-10-04 08:21 | 275K | |
| Blank BoQ Aubrey Car..> | 2024-11-14 11:17 | 275K | |
| REFUSE BAG.pdf | 2025-11-18 21:57 | 276K | |
| TENDER NO 13.24.25.tif | 2026-03-25 11:21 | 276K | |
| TLB NEEDED TO ASSIST..> | 2025-09-04 07:27 | 276K | |
| CABLE 35 X 3 CORE.pdf | 2025-12-30 09:35 | 276K | |
| cable 25 x 3 core xl..> | 2025-12-30 09:35 | 276K | |
| CABLE 25x3 core.pdf | 2025-12-30 09:35 | 276K | |
| TERMINATION KIT 16-3..> | 2026-01-06 09:27 | 276K | |
| CABLE 240 x 3 core .pdf | 2025-12-30 09:35 | 276K | |
| REFUSE BAGS HEAVY DU..> | 2025-08-07 15:55 | 276K | |
| Installation of 8 sp..> | 2023-03-10 08:27 | 276K | |
| cable 70 x 3 core .pdf | 2025-12-30 09:35 | 276K | |
| Hiring of Grader for..> | 2025-08-01 14:19 | 276K | |
| TERMINATION KIT 50-1..> | 2026-01-06 09:27 | 276K | |
| REQ8761 CABLE 10MM X..> | 2025-09-02 16:09 | 277K | |
| REQ8762 10MM 4 CORE ..> | 2025-09-04 07:27 | 277K | |
| TERMINATION KIT 25X5..> | 2026-01-06 09:27 | 277K | |
| Hiring of TLB for 21..> | 2025-08-01 14:19 | 277K | |
| TERMINATION KIT 95-1..> | 2026-01-06 09:27 | 277K | |
| req8817 120mm 4 core..> | 2025-09-04 07:27 | 277K | |
| exchange server.pdf | 2017-08-14 06:58 | 277K | |
| TLB NEEDED TO ASSIST..> | 2025-08-06 09:25 | 277K | |
| EXECUTIVE DEFILE DES..> | 2025-10-16 11:00 | 277K | |
| TERMINATION RQE9565.pdf | 2026-01-06 09:27 | 277K | |
| TERMINATION KIT 35-9..> | 2026-01-06 09:27 | 277K | |
| REQ8757 cable 50mm x..> | 2025-09-04 07:27 | 277K | |
| TLB NEEDED TO ASSIST..> | 2025-09-04 07:27 | 277K | |
| TERMINATION KIT 16 X..> | 2026-01-06 09:27 | 277K | |
| REQ8758 50MM 3CORE .pdf | 2025-09-04 07:27 | 277K | |
| Blank BOQ Honeyville..> | 2024-11-14 11:17 | 277K | |
| 8923 DISASTER REALIE..> | 2025-09-16 09:02 | 277K | |
| termination 16 x 35 ..> | 2026-01-06 09:27 | 277K | |
| termination 16 x 35.pdf | 2026-01-06 09:27 | 277K | |
| Mattresses 910mm x 1..> | 2025-06-20 08:54 | 277K | |
| HIRING OF TLB FOR 21..> | 2025-09-02 16:08 | 277K | |
| TOILET PAPER.pdf | 2025-11-18 21:57 | 277K | |
| certificatesdsdd.pdf | 2017-05-31 15:57 | 277K | |
| REQ8765 35MM 4 CORE ..> | 2025-09-04 07:27 | 278K | |
| Tyres for Grader.pdf | 2017-08-04 15:20 | 278K | |
| HIRING OF DOZER FOR ..> | 2025-09-02 16:08 | 278K | |
| REQ8759 CABLE 10MM X..> | 2025-09-04 07:27 | 278K | |
| cyberoam subcription..> | 2017-08-14 06:58 | 278K | |
| CABLE 70MMX3 CORE PE..> | 2025-09-02 16:09 | 278K | |
| REQ8859 200CUBE G5 M..> | 2025-09-25 07:47 | 278K | |
| veeam backup renewal..> | 2017-08-14 06:58 | 278K | |
| TLB NEEDED TO ASSIST..> | 2025-10-21 15:53 | 278K | |
| REQ8814 CABLE 95 X 3..> | 2025-09-04 07:27 | 278K | |
| Hiring of 10 cubes t..> | 2025-08-01 14:19 | 278K | |
| 2000 coldmix asphalt..> | 2025-08-01 15:42 | 278K | |
| CASCADE CLAMP 320MM-..> | 2025-09-15 10:52 | 278K | |
| EXCAVATOR & LOWBED.pdf | 2025-09-04 07:27 | 278K | |
| WATER PUMP FOR JOJO ..> | 2025-09-15 10:52 | 278K | |
| PAPER BLANK A4 RQE95..> | 2026-01-06 09:24 | 278K | |
| ROYAL POWDER SOAP & ..> | 2025-07-28 12:14 | 278K | |
| PPE FOR EPWP231906.pdf | 2023-06-19 13:43 | 278K | |
| 2000 coldmix asphalt..> | 2025-08-01 15:42 | 278K | |
| 259-275mm CASCADE CL..> | 2025-10-17 16:26 | 278K | |
| REQ7398.pdf | 2025-03-24 15:15 | 279K | |
| 2000 coldmix asphalt..> | 2025-08-01 15:42 | 279K | |
| TOILETS 2017.pdf | 2017-02-02 09:52 | 279K | |
| soil 2017.pdf | 2017-02-02 09:52 | 279K | |
| 248-257mm CASCADE CL..> | 2025-10-17 16:26 | 279K | |
| 2000 coldmix asphalt..> | 2025-08-01 15:42 | 279K | |
| tiles 2017.pdf | 2017-02-02 09:53 | 279K | |
| WASTE RAG & FLOOR PI..> | 2025-07-28 12:14 | 279K | |
| HIRING OF TOILET FOR..> | 2025-12-11 10:17 | 279K | |
| EPWP Uniform 230625.pdf | 2025-06-23 09:14 | 279K | |
| FLUSHING OF SEWER SY..> | 2025-10-17 16:25 | 279K | |
| CABLE XLPE SWA 95MMX..> | 2025-09-02 16:09 | 279K | |
| HIRING OF JET PATCHE..> | 2025-12-11 10:17 | 279K | |
| REQ7052.pdf | 2025-09-25 07:47 | 279K | |
| Cable LT PVC 70mm x ..> | 2025-08-28 12:37 | 279K | |
| SUPPLY AND DELIVERY ..> | 2025-09-15 15:53 | 279K | |
| Cements2017.pdf | 2017-02-13 08:26 | 279K | |
| TLB REQUEST FOR DIGG..> | 2025-08-20 12:46 | 279K | |
| TOILET PAPER 500 SHE..> | 2025-08-25 12:17 | 279K | |
| TLB NEEDED TO ASSIST..> | 2025-10-21 15:53 | 280K | |
| 179-189mm CASCADE CL..> | 2025-10-17 16:26 | 280K | |
| PLATE COMPACTOR PETR..> | 2025-09-02 16:08 | 280K | |
| 115025.pdf | 2016-09-27 09:46 | 280K | |
| HIRING OF JET PATCHE..> | 2025-12-11 10:17 | 280K | |
| shutter ply board.pdf | 2016-09-27 09:46 | 280K | |
| Rocky george, white ..> | 2025-08-12 15:56 | 280K | |
| REMOVE SAND, SLUDGE ..> | 2025-10-21 15:53 | 280K | |
| CABLE 120MM 3 CORE X..> | 2025-09-02 16:09 | 280K | |
| HIRING OF 10 CUBES T..> | 2025-09-02 16:08 | 280K | |
| palisade.pdf | 2016-09-13 14:33 | 280K | |
| palisadea.pdf | 2016-09-13 14:33 | 280K | |
| REQ7222 MAYORS DINNE..> | 2025-02-11 15:59 | 280K | |
| REMOVE SAND, SLUDGE ..> | 2025-10-17 16:25 | 280K | |
| REMOVE SAND, SLUDGE ..> | 2025-10-21 15:53 | 280K | |
| 123184.pdf | 2016-09-13 14:33 | 280K | |
| Request for loading ..> | 2025-07-23 13:38 | 280K | |
| Request for fifteen ..> | 2025-07-23 13:38 | 280K | |
| Emergency gas stove2..> | 2025-06-20 08:54 | 280K | |
| 20x white paints 20 ..> | 2025-07-26 18:57 | 280K | |
| 122309.pdf | 2016-09-13 14:33 | 280K | |
| 123193.pdf | 2016-09-13 14:33 | 280K | |
| 126615.pdf | 2016-09-13 14:33 | 280K | |
| 126615a.pdf | 2016-09-13 14:33 | 280K | |
| auctioneer erratum.pdf | 2017-06-06 14:38 | 280K | |
| REMOVE SAND, SLUDGE ..> | 2025-10-17 16:25 | 281K | |
| TWO HUNDRED x1 LITRE..> | 2025-08-28 15:38 | 281K | |
| Request for loading ..> | 2025-07-23 13:38 | 281K | |
| All in one printer (..> | 2025-07-11 13:32 | 281K | |
| GENERATORS 8KVA WITH..> | 2025-09-15 10:52 | 281K | |
| stock brick.pdf | 2016-10-18 15:56 | 281K | |
| Lipped Channel.pdf | 2018-10-04 19:53 | 281K | |
| stock bricks.pdf | 2016-10-18 15:56 | 281K | |
| ADVERT 5767.pdf | 2025-07-16 20:26 | 281K | |
| 189-210mm CASCADE CL..> | 2025-10-21 15:53 | 281K | |
| 126186 Diamond Mesh.pdf | 2017-08-14 12:34 | 281K | |
| ADVERT 5777.pdf | 2025-07-16 20:27 | 281K | |
| 315MM X 6M PORTABLE ..> | 2025-09-15 10:52 | 281K | |
| 127263.pdf | 2016-09-27 09:46 | 281K | |
| REQ8754 70MM 4 CORE ..> | 2025-09-04 09:45 | 281K | |
| ADVERT 5775.pdf | 2025-07-16 20:27 | 281K | |
| 126185 Silver Post.pdf | 2017-08-14 12:34 | 282K | |
| ADVERT 5773.pdf | 2025-07-16 20:26 | 282K | |
| Bio Catalyst Gravelo..> | 2019-09-25 16:00 | 282K | |
| TRIMMER LINE.pdf | 2025-08-19 15:12 | 282K | |
| Bio Catalyst Lulekan..> | 2019-09-25 15:59 | 282K | |
| Laptops and backpack..> | 2023-04-18 12:09 | 282K | |
| REQUEST FOR NEW FOUR..> | 2026-02-19 14:45 | 282K | |
| DRAGLINE HOSE PIPES.pdf | 2025-08-19 15:12 | 282K | |
| ADVERT 5774.pdf | 2025-07-16 20:26 | 282K | |
| BEARING ASSEMBLING f..> | 2025-10-21 15:53 | 282K | |
| 129187 6 tie-down ..> | 2017-11-02 11:09 | 282K | |
| ADVERT 5770.pdf | 2025-07-16 20:26 | 282K | |
| Bio Catalyst Phalabo..> | 2019-09-25 15:57 | 282K | |
| REQUEST FOR NEW TRAC..> | 2025-10-21 15:53 | 282K | |
| ADVERT 5771.pdf | 2025-07-16 20:26 | 282K | |
| BIO-CATALYST FOR PHA..> | 2025-10-17 16:25 | 282K | |
| BIO-CATALYST FOR NAM..> | 2025-10-17 16:25 | 282K | |
| blankets25.pdf | 2025-06-20 08:54 | 282K | |
| 126184 SA Pine 38 x ..> | 2017-08-14 12:34 | 283K | |
| ADVERT 5772.pdf | 2025-07-16 20:26 | 283K | |
| BIO-CATALYST FOR LUL..> | 2025-10-17 16:25 | 283K | |
| ADVERT 5768.pdf | 2025-07-16 20:26 | 283K | |
| ADVERT 5769.pdf | 2025-07-16 20:26 | 283K | |
| REQ7400.pdf | 2025-03-24 15:15 | 283K | |
| REQUEST FOR NINE NEW..> | 2026-02-19 14:45 | 283K | |
| Request of the TLB F..> | 2026-03-25 07:38 | 283K | |
| Repairs of the TLB F..> | 2026-04-01 08:16 | 283K | |
| Manhole.pdf | 2018-10-04 19:53 | 283K | |
| Bio Catalyst Namakga..> | 2019-09-25 16:01 | 283K | |
| Fraud and Corruption..> | 2022-12-28 13:26 | 284K | |
| Book vehicle itinera..> | 2026-02-04 15:28 | 284K | |
| Request for a landfi..> | 2026-03-23 09:13 | 284K | |
| Repair a skip bin FV..> | 2026-03-19 14:52 | 284K | |
| Resilient seated gat..> | 2025-10-17 16:26 | 284K | |
| Aluminium Barcodes f..> | 2025-10-15 12:37 | 284K | |
| Resilient seated gat..> | 2025-10-17 16:26 | 285K | |
| Windows server recov..> | 2026-02-11 11:28 | 285K | |
| Service of a Truck F..> | 2026-03-13 11:16 | 285K | |
| Hire oil filteration..> | 2025-09-16 10:12 | 285K | |
| TLB REQ9309.pdf | 2025-12-11 10:14 | 285K | |
| Paints.pdf | 2018-10-04 19:53 | 285K | |
| Request to appoint a..> | 2025-10-23 15:11 | 285K | |
| Tlb needed to assist..> | 2025-12-11 10:14 | 285K | |
| Supply and deliver m..> | 2025-08-07 15:55 | 285K | |
| Renewal of annual li..> | 2025-08-07 15:52 | 286K | |
| ADVERT 0872.pdf | 2025-07-14 15:18 | 286K | |
| Hiring of a TLB for ..> | 2025-08-01 11:40 | 286K | |
| Hiring of grader for..> | 2025-10-28 08:18 | 286K | |
| Supply and deliver 5..> | 2025-09-15 15:52 | 286K | |
| TLB needed to assist..> | 2025-07-31 14:23 | 286K | |
| Hiring of grader for..> | 2025-10-28 08:18 | 286K | |
| ADVERT 0873.pdf | 2025-07-14 15:18 | 286K | |
| Hire TLB for mainten..> | 2025-09-15 15:52 | 286K | |
| Hire TLB for mainten..> | 2025-09-15 15:52 | 286K | |
| Hiring of dozer for ..> | 2025-10-29 10:06 | 287K | |
| Renewal of minecast ..> | 2026-02-03 10:18 | 287K | |
| Repairs of Nissan UD..> | 2025-07-28 15:08 | 287K | |
| Repair and maintain ..> | 2025-08-07 15:55 | 287K | |
| Supply and deliver 2..> | 2025-09-15 15:52 | 287K | |
| Request for TLB for ..> | 2026-02-03 10:18 | 287K | |
| ANGLE EQUAL, REINFOR..> | 2025-10-23 15:11 | 287K | |
| Rewrite voltage tran..> | 2025-09-16 10:12 | 287K | |
| Hiring of 10 cube ti..> | 2025-10-29 10:06 | 287K | |
| Hiring a Jet Patcher..> | 2025-11-14 16:59 | 288K | |
| ADVERT 4611.pdf | 2025-07-16 20:27 | 288K | |
| 30 meter x 2 x 3 mm ..> | 2025-07-29 15:11 | 288K | |
| Hiring of 10 TIPPER ..> | 2025-10-29 16:05 | 288K | |
| Hiring of a refuse c..> | 2025-11-14 07:39 | 288K | |
| printer high volume2..> | 2022-01-21 13:24 | 288K | |
| Excavator needed to ..> | 2025-07-31 14:23 | 288K | |
| ADVERT 0874.pdf | 2025-07-16 20:25 | 288K | |
| 750mm Cover slab wit..> | 2025-10-23 15:11 | 288K | |
| Truck repairs FBK 63..> | 2026-03-04 15:59 | 288K | |
| ADVERT 3533.pdf | 2025-07-11 11:06 | 288K | |
| Install new swing an..> | 2021-09-28 12:11 | 289K | |
| Remove Dry Sludge sa..> | 2021-08-30 08:12 | 289K | |
| Request for six(6) n..> | 2026-02-04 15:28 | 289K | |
| Flight pumps.pdf | 2021-08-30 08:12 | 289K | |
| Implementation of La..> | 2021-09-06 08:06 | 289K | |
| Unblocking Humus Sum..> | 2021-08-30 08:12 | 289K | |
| Resuscitation of Pha..> | 2021-09-06 08:06 | 289K | |
| ADVERT 0866.pdf | 2025-07-14 15:18 | 289K | |
| Repairs of three Nis..> | 2026-03-25 07:38 | 289K | |
| ADVERT 0867.pdf | 2025-07-16 20:25 | 289K | |
| Sophos Firewall Rene..> | 2021-08-18 08:02 | 290K | |
| 134032.pdf | 2021-08-18 08:02 | 290K | |
| Cordless Hammer Dril..> | 2021-08-18 08:02 | 290K | |
| ADVERT 0865.pdf | 2025-07-14 15:18 | 290K | |
| Handheld 2D barcode ..> | 2025-08-07 15:52 | 290K | |
| Supply split meters2..> | 2025-08-01 11:40 | 290K | |
| Cable SWA 95mm x 4 C..> | 2025-08-28 12:37 | 290K | |
| TENDER NO- 25-23-24.pdf | 2025-04-11 08:46 | 290K | |
| Paints road marking.pdf | 2025-08-28 15:37 | 290K | |
| Supply and delivery ..> | 2025-10-28 08:18 | 290K | |
| ADVERT 3534.pdf | 2025-07-10 09:08 | 290K | |
| Request for tractor ..> | 2026-02-03 10:18 | 290K | |
| Supply and delivery ..> | 2025-10-28 08:18 | 290K | |
| Supply and delivery ..> | 2025-10-28 08:18 | 290K | |
| Hiring of refuse com..> | 2026-02-03 10:18 | 291K | |
| Tyres for a truck.pdf | 2025-08-01 14:16 | 291K | |
| Tyres for a truck RE..> | 2025-08-05 16:00 | 292K | |
| BLACK HIGH BACK CHAI..> | 2025-10-16 11:00 | 292K | |
| SUPPLY AND DELIVERY ..> | 2025-09-15 15:53 | 292K | |
| Request for fourty (..> | 2025-09-25 07:48 | 293K | |
| GEYSER, SHOWER ROSES..> | 2025-10-17 16:25 | 293K | |
| SUPPLY AND DELIVERY ..> | 2025-09-15 15:53 | 293K | |
| SUPPLY AND DELIVERY ..> | 2025-09-15 15:53 | 293K | |
| request for thirty (..> | 2025-09-25 07:48 | 294K | |
| PLANT SPECIES 7852.pdf | 2025-06-18 08:21 | 295K | |
| Termination Kit 70-1..> | 2021-10-07 12:19 | 297K | |
| Solid lock body made..> | 2025-09-15 15:52 | 297K | |
| OHS Signages.pdf | 2024-05-31 09:28 | 297K | |
| Termination Kit 50-1..> | 2021-10-07 12:19 | 297K | |
| Repairs of truck BVJ..> | 2026-03-19 14:52 | 297K | |
| wireless communicati..> | 2025-11-27 08:47 | 299K | |
| Request for tractor ..> | 2026-03-19 15:01 | 299K | |
| Termination Kit 16 x..> | 2021-10-07 12:19 | 300K | |
| remote communication..> | 2025-11-27 08:47 | 301K | |
| REQ6241.pdf | 2024-10-22 08:48 | 305K | |
| Repars of Truck-Skip..> | 2025-07-28 15:08 | 307K | |
| Street Lights300921.pdf | 2021-09-30 14:13 | 312K | |
| 115036.pdf | 2016-09-13 14:33 | 315K | |
| 123320.pdf | 2016-09-13 14:33 | 316K | |
| Tyres for a truck re..> | 2026-03-19 14:52 | 316K | |
| 115038.pdf | 2016-09-13 14:33 | 317K | |
| IT.pdf | 2018-05-31 07:59 | 322K | |
| promotional material..> | 2024-03-06 09:07 | 322K | |
| REQ6528.pdf | 2024-10-31 08:14 | 322K | |
| REQ6248.pdf | 2024-10-22 08:48 | 323K | |
| REQ6249.pdf | 2024-10-22 08:48 | 323K | |
| sewr pump 2017.pdf | 2017-02-24 14:50 | 326K | |
| TIIDA ENGINE REPLACE..> | 2022-01-03 15:40 | 327K | |
| 137810_3009.pdf | 2021-09-30 08:19 | 329K | |
| catering for open-ai..> | 2025-02-17 12:33 | 329K | |
| Rear Tractor tyres08..> | 2022-02-08 07:59 | 330K | |
| Bio-Bacteriological ..> | 2022-02-22 10:50 | 330K | |
| Polycarbonate Roof S..> | 2022-01-25 10:15 | 330K | |
| Bio-Bacteriological ..> | 2022-02-22 10:50 | 330K | |
| Repair of Aircons .pdf | 2022-01-03 15:41 | 330K | |
| REQ00000490.pdf | 2022-02-22 10:50 | 330K | |
| REQ0000497.pdf | 2022-02-22 10:50 | 330K | |
| REQ0000499.pdf | 2022-02-22 10:50 | 330K | |
| SSL CERTIFICATE23032..> | 2022-03-23 13:21 | 330K | |
| spare parts 2017.pdf | 2017-02-24 14:50 | 330K | |
| Laptop Back packs_30..> | 2022-03-30 14:58 | 330K | |
| 127175 Pavement Bloc..> | 2016-10-18 07:21 | 331K | |
| 127175 Pavement Bloc..> | 2016-10-18 07:21 | 331K | |
| CHAINS FOR POLE PRUN..> | 2022-03-14 08:14 | 331K | |
| REF2025.pdf | 2024-06-26 09:03 | 331K | |
| 137817_3009.pdf | 2021-09-30 08:19 | 331K | |
| 8 Ton truck with a c..> | 2021-11-24 15:44 | 331K | |
| ERRATUM NO.1 0PERATI..> | 2023-11-03 09:53 | 332K | |
| Painting of Pavillio..> | 2021-11-24 15:44 | 334K | |
| REQ0000170241121.pdf | 2021-11-24 15:44 | 334K | |
| Pole Timber_091221.pdf | 2021-12-09 09:51 | 334K | |
| REQ6250.pdf | 2024-10-22 08:48 | 334K | |
| BPM Supplier Databas..> | 2016-03-15 10:27 | 334K | |
| Supply Clear Vu invi..> | 2021-09-30 08:19 | 334K | |
| REQ 7231 VVIP (2).pdf | 2025-02-11 15:59 | 335K | |
| Tyres for Trucks0802..> | 2022-02-08 07:59 | 335K | |
| Scope of Work C69 of..> | 2024-11-14 11:17 | 335K | |
| REQ7232 VIP25.pdf | 2025-02-11 15:59 | 338K | |
| Cable 50mm x 4 core ..> | 2022-03-03 08:16 | 339K | |
| Cleaning Material020..> | 2022-02-03 15:19 | 340K | |
| Fitting 400w Floodli..> | 2022-03-03 08:16 | 340K | |
| Fitting Street light..> | 2022-03-03 08:16 | 340K | |
| Transformer 315 KVA ..> | 2022-03-03 08:16 | 341K | |
| Rear Tractor tyres17..> | 2021-11-17 15:40 | 342K | |
| Fitting Post – Top..> | 2022-03-03 08:16 | 343K | |
| IMPLEMENTATION OF SU..> | 2018-08-15 08:15 | 343K | |
| REQ4123.pdf | 2023-11-08 08:26 | 345K | |
| Repairs on a Hino Tr..> | 2021-11-30 14:13 | 345K | |
| Tyres of a Truck 080..> | 2022-02-08 07:59 | 348K | |
| REQ462jun.pdf | 2022-06-07 11:04 | 349K | |
| Paper blank A4 80GSM..> | 2022-02-03 15:19 | 349K | |
| Tyres of a Truck_121..> | 2021-11-12 10:28 | 353K | |
| 136339.pdf | 2022-06-17 13:48 | 354K | |
| REQ4802.pdf | 2024-02-13 11:12 | 354K | |
| 136340.pdf | 2022-06-17 13:48 | 355K | |
| COVID-19 FACE SHIELD..> | 2022-03-30 14:59 | 355K | |
| EL227.pdf | 2024-06-18 15:52 | 357K | |
| REQ464june.pdf | 2022-06-07 11:04 | 357K | |
| 136337.pdf | 2022-06-17 13:48 | 357K | |
| EL103.pdf | 2023-12-12 08:37 | 357K | |
| EL226.pdf | 2024-06-18 15:52 | 357K | |
| EL102.pdf | 2023-12-12 08:37 | 357K | |
| EL104.pdf | 2023-12-12 08:37 | 359K | |
| EL225.pdf | 2024-06-18 15:52 | 359K | |
| EL107.pdf | 2023-12-12 08:37 | 359K | |
| GE104-23-24.pdf | 2024-01-09 09:33 | 360K | |
| EL221.pdf | 2024-06-18 15:52 | 360K | |
| EL223.pdf | 2024-06-18 15:52 | 360K | |
| EL222.pdf | 2024-06-18 15:52 | 362K | |
| el105.pdf | 2023-12-12 08:37 | 362K | |
| EL224.pdf | 2024-06-18 15:52 | 364K | |
| 119500.pdf | 2016-09-13 14:33 | 365K | |
| AIR CON.pdf | 2016-05-16 08:36 | 367K | |
| Erratum Request for..> | 2020-10-26 09:51 | 369K | |
| Covid-19.pdf | 2020-10-01 07:31 | 370K | |
| TENDER 13-23-24.pdf | 2024-01-24 15:22 | 371K | |
| Refuse Removal.pdf | 2020-10-01 07:31 | 372K | |
| Seed Lawns.pdf | 2020-09-18 13:11 | 372K | |
| sanitizers.pdf | 2020-10-01 07:31 | 373K | |
| Supply and delivery ..> | 2022-02-03 09:15 | 375K | |
| 70kg Chlorine Gas Cy..> | 2022-02-22 10:50 | 375K | |
| TENDER 15-23-24.pdf | 2024-01-24 15:22 | 377K | |
| Masks.pdf | 2020-10-01 07:26 | 378K | |
| REQ465june.pdf | 2022-06-07 11:04 | 380K | |
| REQ49722.pdf | 2022-06-07 11:04 | 380K | |
| REQ463june.pdf | 2022-06-07 11:04 | 380K | |
| Bio - Bacteriologica..> | 2022-02-22 10:50 | 383K | |
| Tender No. 13-21-22 ..> | 2022-06-08 09:29 | 385K | |
| Tender No.14-21-22 V..> | 2022-06-08 09:29 | 386K | |
| Tender No.17-21-22 P..> | 2022-06-08 09:29 | 387K | |
| Tender No.16-21-22 R..> | 2022-06-08 09:29 | 387K | |
| Tender No. 03-20-21.pdf | 2021-07-09 14:17 | 387K | |
| Tender No.15-21-22 L..> | 2022-06-08 09:29 | 388K | |
| Tender No.15-21-22 L..> | 2022-06-17 13:48 | 388K | |
| Tender No.11-21-22 P..> | 2022-06-08 09:29 | 389K | |
| EL110.pdf | 2023-12-12 08:37 | 391K | |
| el116.pdf | 2023-12-12 08:37 | 393K | |
| stage and sound.pdf | 2017-08-14 08:26 | 394K | |
| el114.pdf | 2023-12-12 08:37 | 394K | |
| EL109.pdf | 2023-12-12 08:37 | 394K | |
| el113.pdf | 2023-12-12 08:37 | 394K | |
| EL101.pdf | 2023-12-12 08:37 | 395K | |
| el112.pdf | 2023-12-12 08:37 | 395K | |
| el115.pdf | 2023-12-12 08:37 | 395K | |
| EL106.pdf | 2023-12-12 08:37 | 395K | |
| EL111.pdf | 2023-12-12 08:37 | 396K | |
| Jojo Tank Platform.pdf | 2021-08-18 14:56 | 397K | |
| EL108.pdf | 2023-12-12 08:37 | 399K | |
| el117.pdf | 2023-12-12 08:37 | 399K | |
| REQ6386.pdf | 2024-10-11 14:15 | 399K | |
| TENDER 14-23-24.pdf | 2024-01-24 15:22 | 401K | |
| tilling material2022..> | 2022-01-25 10:09 | 402K | |
| Proposal for AudioSo..> | 2019-01-04 15:42 | 406K | |
| REF1506.pdf | 2024-07-16 08:55 | 406K | |
| Manhole covers.pdf | 2022-09-29 14:01 | 407K | |
| Cable PEX 11 KV CU 1..> | 2022-10-13 15:17 | 407K | |
| Pipe upvc Sewerage 1..> | 2022-10-13 15:17 | 407K | |
| floor soap pine gel ..> | 2022-10-13 15:17 | 407K | |
| Manhole chambers.pdf | 2022-09-29 14:01 | 407K | |
| Request for black ga..> | 2022-10-12 11:04 | 407K | |
| 10 cube truck of cru..> | 2022-09-29 14:01 | 407K | |
| 10 cube truck of cru..> | 2022-09-29 14:01 | 407K | |
| Manhole140323.pdf | 2023-03-14 16:39 | 407K | |
| Request for TLB and ..> | 2022-10-12 11:04 | 407K | |
| COPPER CONDUCTOR.pdf | 2022-12-05 07:51 | 407K | |
| Supply and Delivery ..> | 2022-10-12 11:04 | 407K | |
| TLB needed to assist..> | 2022-09-29 14:01 | 407K | |
| PLAIN COUNTER SCREEN..> | 2022-03-30 14:59 | 407K | |
| PLAIN COUNTER SCREEN..> | 2022-03-31 14:30 | 407K | |
| TLB needed to assist..> | 2022-09-29 14:01 | 407K | |
| Supply and Delivery ..> | 2022-10-12 11:04 | 407K | |
| Request for TLB 4x2 ..> | 2022-10-12 11:04 | 407K | |
| Paints 290922.pdf | 2022-09-29 08:35 | 407K | |
| Battery Chargers for..> | 2022-09-29 08:35 | 407K | |
| Generator change ove..> | 2022-09-29 08:35 | 407K | |
| Cleaning Materials 1..> | 2022-10-13 15:17 | 407K | |
| REQUEST FOR CHAIN FO..> | 2022-08-22 07:50 | 407K | |
| REQUEST FOR MANDREL ..> | 2023-03-08 08:18 | 407K | |
| 20 MVA Transformer M..> | 2022-09-29 08:35 | 407K | |
| Repair pump number 2..> | 2023-03-08 08:18 | 407K | |
| Paints020822.pdf | 2022-08-02 11:21 | 407K | |
| TLB needed to assist..> | 2023-03-08 08:18 | 407K | |
| REQUEST FOR SIX(6) C..> | 2023-03-08 08:18 | 407K | |
| TLB needed to assist..> | 2023-03-08 08:18 | 407K | |
| Hiring of a Refuse C..> | 2022-12-05 07:51 | 407K | |
| Construction of 160m..> | 2022-09-29 14:01 | 408K | |
| Unfree, unblock bloc..> | 2023-03-08 08:18 | 408K | |
| Request for services..> | 2023-03-14 16:39 | 408K | |
| Remove sand and grit..> | 2023-03-08 08:18 | 408K | |
| Remove sand and grit..> | 2023-03-08 08:18 | 408K | |
| Remove sand and grit..> | 2023-03-08 08:18 | 408K | |
| Remove sand and grit..> | 2023-03-08 08:18 | 408K | |
| Remove sand and grit..> | 2023-03-08 08:18 | 408K | |
| Remove sand and grit..> | 2023-03-08 08:18 | 408K | |
| Remove sand and grit..> | 2023-03-08 08:18 | 408K | |
| Construction of Chan..> | 2023-03-14 16:39 | 408K | |
| Primary settling Mai..> | 2023-03-08 08:18 | 408K | |
| Construction of 755m..> | 2023-03-10 08:27 | 408K | |
| Clearing of cattail ..> | 2023-03-08 08:18 | 408K | |
| Air Valve for Portab..> | 2022-09-29 14:01 | 408K | |
| Construction of 755m..> | 2022-09-29 14:01 | 408K | |
| Service and Hydrauli..> | 2023-03-10 08:27 | 408K | |
| Service and Hydrauli..> | 2023-03-10 08:27 | 408K | |
| Repairs of a truck23..> | 2023-01-23 09:29 | 408K | |
| Repairs and Maintana..> | 2023-02-13 16:09 | 408K | |
| Transformer 315 KVA ..> | 2023-05-31 07:58 | 408K | |
| Transformer 50 KVA 3..> | 2023-05-31 07:58 | 408K | |
| Transformer 150 KVA ..> | 2023-05-31 07:58 | 408K | |
| Transformer 200 KVA ..> | 2023-05-31 07:58 | 408K | |
| REQUEST FOR TRACTOR ..> | 2023-03-08 08:18 | 408K | |
| Steel Pipeline Fabri..> | 2023-06-27 12:18 | 408K | |
| REQUEST FOR 10 BRUSH..> | 2023-03-08 08:18 | 409K | |
| Request for one zer..> | 2023-03-08 08:18 | 409K | |
| Disaster[1].pdf | 2024-05-02 08:12 | 409K | |
| Palisade Fence290922..> | 2022-09-29 08:35 | 409K | |
| RENEWAL OF SSL CERTI..> | 2023-06-20 14:52 | 409K | |
| Repairing of the fal..> | 2023-05-31 07:58 | 409K | |
| Tyres for a Grader02..> | 2023-06-02 15:42 | 409K | |
| Service provider nee..> | 2023-02-11 11:38 | 409K | |
| Renewal of Sophos An..> | 2023-06-20 14:52 | 409K | |
| REQUEST FOR 1X DOUBL..> | 2022-08-22 07:50 | 409K | |
| Step couplings and B..> | 2023-06-19 13:43 | 409K | |
| Proposal for Compila..> | 2019-01-04 15:03 | 409K | |
| Replace the robot co..> | 2023-05-05 08:48 | 409K | |
| Book vehicle itinera..> | 2023-06-20 14:52 | 409K | |
| Book vehicle itinera..> | 2023-06-20 14:52 | 409K | |
| WEB HOST & MAINTENAN..> | 2023-05-05 08:48 | 409K | |
| PRINTERS221411 .pdf | 2022-11-14 09:31 | 409K | |
| Wireless Access Poin..> | 2023-03-29 09:21 | 410K | |
| Concrete palisade fe..> | 2023-05-02 11:04 | 410K | |
| Pole Timber 12m10523..> | 2023-05-31 07:58 | 410K | |
| RIDE-ON CUTTING BLAD..> | 2023-07-21 15:28 | 410K | |
| IDP BOOKS COLLATED A..> | 2023-05-26 16:02 | 410K | |
| Unblock and repair s..> | 2023-03-08 08:18 | 410K | |
| Unblock the confluen..> | 2023-03-08 08:18 | 410K | |
| Tyres of a truck2006..> | 2023-06-20 14:52 | 410K | |
| Size A1 Calender for..> | 2023-06-02 15:42 | 410K | |
| Size A1 Calendar for..> | 2023-05-31 07:58 | 410K | |
| REQUEST FOR SIXTY (6..> | 2023-04-06 09:58 | 410K | |
| Termination Kit 95-2..> | 2023-04-06 09:58 | 410K | |
| Termination Kit 300-..> | 2023-04-06 09:58 | 410K | |
| Joints Cable 50-95mm..> | 2023-04-06 09:58 | 410K | |
| Supply and delivery ..> | 2023-02-23 16:31 | 410K | |
| Joint term 95-185mm ..> | 2023-04-06 09:58 | 410K | |
| JOINT SCOTCH 185-240..> | 2023-04-06 09:58 | 410K | |
| Fire Hydrant Head 80..> | 2023-04-06 10:21 | 410K | |
| Fire Hydrant and Sta..> | 2023-04-06 10:21 | 410K | |
| REQUEST FOR FIFTEEN ..> | 2023-04-06 09:58 | 410K | |
| Color LaserJet Pro M..> | 2023-06-27 12:18 | 410K | |
| Service provider is ..> | 2023-05-02 11:04 | 410K | |
| Hiring of an Excavat..> | 2023-05-02 11:04 | 410K | |
| Supply and delivery ..> | 2023-05-15 14:26 | 411K | |
| Sophos firewall XGS2..> | 2023-06-20 14:52 | 411K | |
| REF1507.pdf | 2024-07-16 08:55 | 411K | |
| Supply and Delivery ..> | 2023-05-15 14:26 | 411K | |
| Supply and install v..> | 2023-02-13 16:09 | 411K | |
| Hiring of a Tipper t..> | 2023-02-23 16:31 | 411K | |
| Cisco Switch.pdf | 2023-06-27 12:18 | 411K | |
| Hiring of a TLB (4 x..> | 2023-02-23 16:31 | 411K | |
| T630 24 inch PRINTER..> | 2022-11-09 08:53 | 411K | |
| Supply and delivery ..> | 2023-02-23 16:31 | 411K | |
| Hiring of a CPIC100 ..> | 2023-02-11 11:38 | 411K | |
| Supply and delivery ..> | 2023-02-23 16:31 | 411K | |
| Manhole cover & fram..> | 2023-05-31 07:58 | 411K | |
| Hiring of a Refuse C..> | 2023-04-06 09:58 | 412K | |
| Hiring of a D6 Bulld..> | 2023-02-11 11:37 | 412K | |
| Projector.pdf | 2023-06-27 12:18 | 412K | |
| Hiring of an Excavat..> | 2023-04-06 10:21 | 412K | |
| Hiring of a TLB for ..> | 2023-06-14 10:00 | 412K | |
| Cable 50 x 3 core XL..> | 2023-05-31 07:58 | 412K | |
| Cable 10mm x 3 core1..> | 2023-05-31 07:58 | 412K | |
| Hiring of a Grader f..> | 2023-02-23 16:31 | 412K | |
| Hiring of TLB 4 x 2 ..> | 2023-02-11 11:37 | 412K | |
| EARTH WIRE COPPER ST..> | 2023-05-31 07:58 | 412K | |
| Hiring of TLB 4X2 FO..> | 2023-07-21 15:28 | 412K | |
| Hiring of TLB needed..> | 2023-04-06 10:21 | 412K | |
| REQUEST FOR 4x2 TLB ..> | 2023-04-06 09:58 | 412K | |
| Hiring Excavator wit..> | 2023-04-25 15:18 | 413K | |
| Annexure B - Summary..> | 2022-12-13 12:53 | 413K | |
| Repairs of BTU Air c..> | 2023-04-06 10:21 | 413K | |
| Hiring of a TLB for ..> | 2023-05-15 14:26 | 413K | |
| Rent a TLB 30days150..> | 2023-05-15 14:26 | 413K | |
| Clear view Invisible..> | 2023-05-02 11:04 | 413K | |
| Hiring of TLB needed..> | 2023-04-25 15:18 | 413K | |
| Hiring of TLB needed..> | 2023-05-02 11:04 | 413K | |
| Hiring of TLB needed..> | 2023-05-02 11:04 | 413K | |
| TENDER 17-23-24.pdf | 2024-01-24 15:22 | 414K | |
| Toner Cartridges 260..> | 2023-07-26 14:52 | 414K | |
| Waste rags, Floor So..> | 2023-06-13 10:24 | 414K | |
| Building Materials23..> | 2023-02-23 16:31 | 415K | |
| Supply and Delivery ..> | 2019-01-04 15:47 | 415K | |
| CONTRACT NO 162425 P..> | 2025-02-25 05:43 | 415K | |
| Pool of travelling U..> | 2019-01-04 15:45 | 415K | |
| Pool of travelling U..> | 2019-07-15 19:37 | 415K | |
| 420 - 440mm Cascade ..> | 2023-08-15 10:56 | 415K | |
| 155 - 175mm Cascade ..> | 2023-08-15 10:56 | 416K | |
| CABLE 120MM X 4 CORE..> | 2023-01-12 16:49 | 416K | |
| Transformer 50 KVA 3..> | 2022-10-13 15:17 | 417K | |
| Cable 25mm x 3 core ..> | 2022-12-05 07:51 | 417K | |
| Cable 25mm x 4 CORE ..> | 2022-12-05 07:51 | 418K | |
| Transformer 200 KVA ..> | 2022-10-13 15:17 | 418K | |
| Transformer 200 KVA ..> | 2023-01-12 16:49 | 418K | |
| 200W Highmast LED Fi..> | 2022-11-03 08:56 | 418K | |
| Transformer 315 KVA ..> | 2022-10-13 15:17 | 418K | |
| Transformer 150 KVA ..> | 2022-10-13 15:17 | 418K | |
| Transformer 315 KVA ..> | 2023-01-12 16:49 | 418K | |
| Transformer 50 KVA 3..> | 2023-01-12 16:49 | 418K | |
| Transformer 150 KVA ..> | 2023-01-12 16:49 | 418K | |
| Oil transformer 210L..> | 2022-12-05 07:51 | 418K | |
| Cable 95mm x 3 core ..> | 2022-11-14 09:31 | 419K | |
| 45 LOADS OF SUPER JE..> | 2023-08-08 15:18 | 419K | |
| Termination kit 70-1..> | 2022-12-20 09:14 | 419K | |
| 179 - 189mm Cascade ..> | 2023-08-15 10:56 | 419K | |
| Transformer -Pole Mo..> | 2023-08-15 10:56 | 419K | |
| JOINT SCOTCH 185-240..> | 2023-02-01 09:14 | 419K | |
| 265 - 280mm Cascade ..> | 2023-08-15 10:56 | 419K | |
| CABLE 240MMx3 CORE 1..> | 2022-11-09 08:53 | 419K | |
| 159 - 182mm Cascade ..> | 2023-08-15 10:56 | 419K | |
| Termination kit 50-1..> | 2022-12-20 09:14 | 419K | |
| 269 - 282mm Cascade ..> | 2023-08-15 10:56 | 420K | |
| Rent a TLB for 30 da..> | 2022-11-03 08:56 | 420K | |
| Tyres of a Truck0807..> | 2022-07-08 10:57 | 420K | |
| Manhole chamber .pdf | 2022-06-03 10:54 | 420K | |
| Manhole chamber 2203..> | 2022-06-03 11:00 | 420K | |
| REQUEST FOR 120 TONS..> | 2023-01-20 10:12 | 420K | |
| VJ Coupling - 171 x ..> | 2023-08-15 10:56 | 420K | |
| Install Stats Meteri..> | 2023-06-13 09:08 | 421K | |
| Lip Channels070823.pdf | 2023-08-07 09:01 | 421K | |
| REQUEST FOR TLB TO D..> | 2023-01-04 10:22 | 421K | |
| OFFICIAL PHOTOS OF T..> | 2022-11-04 08:51 | 421K | |
| Joint term 95-185mm ..> | 2023-02-01 09:14 | 421K | |
| REQUEST FOR BRUSH CU..> | 2022-08-22 07:50 | 421K | |
| REMOVE SLUDGE, SAND ..> | 2023-08-08 15:18 | 421K | |
| HIRING OF TLB NEEDED..> | 2023-08-07 09:01 | 421K | |
| Install a backup sys..> | 2023-06-13 09:08 | 421K | |
| Repair Robots at R71..> | 2023-08-16 08:51 | 421K | |
| REMOVE SAND, SLUDGE ..> | 2023-08-08 15:18 | 421K | |
| Buckup systems for r..> | 2023-08-16 08:51 | 422K | |
| Cleaning Materials.pdf | 2023-01-24 16:41 | 422K | |
| REMOVE SAND, GRIT AN..> | 2023-08-08 15:18 | 422K | |
| REMOVE SLUDGE, SAND ..> | 2023-08-08 15:18 | 422K | |
| Roofing Materials220..> | 2022-08-22 08:22 | 422K | |
| Hiring of TLB (4X4) ..> | 2023-08-21 10:32 | 422K | |
| Cleaning Materials19..> | 2023-07-19 07:45 | 422K | |
| PHOTOS OF THE DEPUTY..> | 2023-05-26 16:02 | 423K | |
| Erratum of 80mm Stan..> | 2023-04-13 08:36 | 423K | |
| Palisade Panel020822..> | 2022-08-02 11:21 | 423K | |
| Supply and delivery ..> | 2023-08-21 10:32 | 423K | |
| Plumber tools 223080..> | 2023-08-08 15:18 | 423K | |
| Hiring of an Excavat..> | 2023-08-21 10:32 | 423K | |
| Cartridges1907.pdf | 2023-07-19 07:45 | 423K | |
| Supply and delivery ..> | 2023-01-12 17:03 | 423K | |
| CABLE TERMINATION KI..> | 2023-07-19 07:45 | 424K | |
| Paper blank A4 80GSM..> | 2022-07-28 14:30 | 424K | |
| ERRATUM for Paper bl..> | 2022-07-29 12:42 | 424K | |
| Joint Kit 25mm-95mmx..> | 2023-07-19 07:45 | 424K | |
| BIO-CATALYST for Pha..> | 2023-06-05 08:53 | 424K | |
| Request for tractor ..> | 2023-01-04 10:22 | 424K | |
| Supply and delivery ..> | 2023-08-21 10:32 | 425K | |
| Mechanical Fittings1..> | 2023-08-15 10:56 | 425K | |
| Cable Joint Kit 95mm..> | 2023-07-19 07:45 | 425K | |
| REQUEST FOR D6 BULLD..> | 2023-01-27 11:30 | 425K | |
| Hiring of TLB needed..> | 2023-07-19 07:45 | 425K | |
| Training Request for..> | 2023-08-15 10:56 | 425K | |
| Hiring of a Tipper T..> | 2023-08-21 10:32 | 425K | |
| REFUSE BAGS220823.pdf | 2022-08-23 08:46 | 425K | |
| BIO-CATALYST for Gra..> | 2023-06-05 08:53 | 425K | |
| Manholes 290922.pdf | 2022-09-29 08:35 | 425K | |
| BIO-CATALYST for Lul..> | 2023-06-05 08:53 | 425K | |
| Refuse Bags Heavy Du..> | 2023-03-29 09:21 | 425K | |
| Tyres and Batteries ..> | 2023-06-20 14:52 | 425K | |
| Supply and delivery ..> | 2023-08-21 10:32 | 425K | |
| REQUEST FOR HUNDRED ..> | 2023-07-21 15:28 | 425K | |
| BIO-CATALYST for Nam..> | 2023-06-05 08:53 | 425K | |
| Hiring of Tipper tru..> | 2023-04-25 15:18 | 426K | |
| Paper blank A4 80GSM..> | 2023-03-29 09:21 | 426K | |
| Services of Structur..> | 2022-11-24 14:46 | 426K | |
| Tyres221109.pdf | 2022-11-09 08:53 | 426K | |
| cascade.pdf | 2022-03-28 12:31 | 426K | |
| Hiring of refuse com..> | 2023-01-10 08:56 | 426K | |
| Impeller flygt pump ..> | 2023-08-15 10:56 | 426K | |
| Impeller flygt pump ..> | 2023-08-15 10:56 | 426K | |
| HIRING OF AN EXCAVAT..> | 2023-08-07 09:01 | 427K | |
| Splicing Kit Scotch ..> | 2023-02-01 09:14 | 427K | |
| Manholes070823.pdf | 2023-08-07 09:01 | 427K | |
| Supply and delivery ..> | 2023-01-09 10:13 | 427K | |
| Tyres and batteries ..> | 2023-03-29 09:21 | 427K | |
| Body repairs on truc..> | 2023-06-20 14:52 | 427K | |
| Bush Clearing at fie..> | 2023-01-24 16:41 | 427K | |
| Supply and delivery ..> | 2023-01-09 10:13 | 428K | |
| Supply and delivery ..> | 2022-08-18 11:31 | 428K | |
| 135765.pdf | 2022-03-28 12:31 | 428K | |
| Supply and Delivery ..> | 2023-01-12 17:03 | 428K | |
| TENDER 8-23-24.pdf | 2024-01-24 12:18 | 428K | |
| FURNITURE1200622.pdf | 2022-12-06 12:44 | 428K | |
| Splicing Kits Scotch..> | 2023-04-06 10:21 | 429K | |
| Supply and delivery ..> | 2023-01-09 10:13 | 429K | |
| Supply and delivery ..> | 2023-01-09 10:13 | 429K | |
| Plumber Tools230808.pdf | 2023-08-08 15:18 | 429K | |
| Supply and delivery ..> | 2023-01-12 17:03 | 429K | |
| Supply, deliver and ..> | 2023-01-20 10:12 | 429K | |
| Tyres for Tractors22..> | 2022-08-23 13:37 | 430K | |
| Roof Paints070823.pdf | 2023-08-07 09:01 | 430K | |
| Hiring of TLB needed..> | 2023-04-25 15:18 | 430K | |
| Guard house031122.pdf | 2022-11-03 08:56 | 430K | |
| Repairs of Air condi..> | 2022-12-06 12:44 | 430K | |
| Supply and delivery ..> | 2023-01-09 10:13 | 431K | |
| ELECTRIC FENCE.pdf | 2022-11-24 14:46 | 431K | |
| 139823.pdf | 2022-03-28 12:31 | 431K | |
| Supply and delivery ..> | 2023-01-09 10:13 | 431K | |
| Supply and delivery ..> | 2023-08-21 10:32 | 431K | |
| Supply and delivery ..> | 2023-08-21 10:32 | 431K | |
| REQUEST FOR 20 X 1 L..> | 2022-08-22 07:50 | 431K | |
| REQUEST FOR NEW TRAC..> | 2022-11-24 14:46 | 431K | |
| Supply and delivery ..> | 2023-08-21 10:32 | 431K | |
| Tyres for cherry pic..> | 2022-09-12 12:42 | 431K | |
| Cut grass, supply, d..> | 2023-01-20 10:12 | 431K | |
| Annexure C - Insuran..> | 2022-12-13 12:51 | 432K | |
| Tshelang .pdf | 2022-03-28 12:31 | 432K | |
| 138609.pdf | 2022-02-22 10:50 | 433K | |
| 139791.pdf | 2022-03-28 12:31 | 433K | |
| Branding of Bakkies ..> | 2022-06-30 12:52 | 433K | |
| REQUEST FOR INSECTIC..> | 2023-08-07 09:01 | 433K | |
| Walk Behind Roller.pdf | 2022-08-18 11:31 | 433K | |
| Concrete fence.pdf | 2023-01-20 08:14 | 433K | |
| Repairs of a Truck.pdf | 2023-01-20 08:14 | 434K | |
| A4 PAGER NEWSLETTER.pdf | 2022-08-19 09:46 | 434K | |
| Provision of service..> | 2019-01-04 15:12 | 435K | |
| Erratum for Hiring o..> | 2023-05-03 10:30 | 436K | |
| Blue Lights.pdf | 2022-07-18 10:08 | 436K | |
| Request for herbicid..> | 2023-01-30 08:12 | 437K | |
| Truck Tyres 191222.pdf | 2022-12-19 10:53 | 437K | |
| Tyres for a truck 26..> | 2023-07-26 14:52 | 438K | |
| Tyres of a Truck 20j..> | 2023-01-20 08:14 | 438K | |
| TENDER 12-23-24.pdf | 2024-01-24 15:22 | 438K | |
| Disaster[1]replace.pdf | 2024-05-03 08:43 | 439K | |
| TENDER 7-23-24.pdf | 2024-01-24 12:18 | 439K | |
| Brush Cutters.pdf | 2022-04-08 14:31 | 439K | |
| Tender Advert - AFS..> | 2024-05-27 09:24 | 439K | |
| Tender Advert - AFS..> | 2024-06-26 09:03 | 439K | |
| Tender Advert - Pro..> | 2024-05-21 07:48 | 439K | |
| Erratum Consultant E..> | 2024-05-07 08:33 | 440K | |
| Tyres of a Truck 2.pdf | 2022-07-26 07:50 | 441K | |
| Tyres of a Truck (1..> | 2022-07-26 07:42 | 441K | |
| Tender Advert - 15 F..> | 2024-02-19 14:42 | 441K | |
| Tyres and Batteries.pdf | 2023-01-27 11:30 | 441K | |
| Tender Advert - TEN..> | 2024-03-22 16:02 | 442K | |
| Tender Advert - TEN..> | 2024-04-29 14:03 | 442K | |
| Covid-19 face shield..> | 2022-06-15 13:21 | 442K | |
| Tyres of a truck1907..> | 2023-07-19 07:45 | 443K | |
| REQUEST FOR TWO (2) ..> | 2022-10-26 12:15 | 443K | |
| Tyres for a truck17.pdf | 2023-05-17 09:49 | 443K | |
| Tyres for a truck 17..> | 2023-05-17 09:47 | 443K | |
| Pipe upvc Sewerage 1..> | 2022-11-24 14:46 | 444K | |
| TENDER 11-23-24.pdf | 2024-01-24 15:22 | 447K | |
| PROPOSAL FOR THE MAR..> | 2019-08-28 15:12 | 448K | |
| Paper blank A4 80GSM..> | 2022-11-18 09:26 | 449K | |
| Carpenter Tools11182..> | 2022-11-18 09:26 | 449K | |
| Tender Advert - Inve..> | 2023-08-14 14:48 | 450K | |
| Tender Advert - Inve..> | 2023-08-14 14:48 | 450K | |
| Tender Advert - 19 J..> | 2023-06-20 12:28 | 451K | |
| ADVERTISEMENT OF DIF..> | 2019-05-15 09:22 | 453K | |
| ADVERT PROPOSAL FOR ..> | 2020-01-29 11:07 | 454K | |
| Hiring of multi-funt..> | 2025-07-16 20:26 | 455K | |
| REQ6246.pdf | 2024-10-22 08:48 | 456K | |
| Tender Advert__ Tend..> | 2022-01-26 12:14 | 457K | |
| Tyres for a truck270..> | 2022-06-27 13:29 | 457K | |
| TENDER ADVERTS_19082..> | 2022-08-19 08:03 | 457K | |
| Tyres of a Truck 300..> | 2022-06-30 12:52 | 457K | |
| Tender Advert Benfar..> | 2022-02-24 10:35 | 457K | |
| ADVERTISEMENT FOR DI..> | 2019-07-29 09:59 | 457K | |
| TENDER 10-23-24.pdf | 2024-01-24 12:18 | 458K | |
| REF2026.pdf | 2024-06-26 09:03 | 458K | |
| List of vehicles - U..> | 2023-01-05 15:44 | 458K | |
| Tender Advert - TEN..> | 2023-09-20 13:48 | 458K | |
| ADVERTISEMENT OF DIF..> | 2019-10-21 07:43 | 459K | |
| Req No.9532.pdf | 2025-12-24 10:22 | 459K | |
| Tender Advert2217.pdf | 2022-11-17 16:08 | 459K | |
| Tender Advert2812202..> | 2022-12-28 16:41 | 459K | |
| REF2027.pdf | 2024-06-26 09:03 | 459K | |
| Advert Refubrishment..> | 2020-12-17 15:46 | 460K | |
| Advert Refubrishment..> | 2020-12-17 14:31 | 460K | |
| 201711091250.pdf | 2017-11-09 12:50 | 461K | |
| Tender Advert - Vari..> | 2023-10-25 10:54 | 461K | |
| Tender Advert - ELEC..> | 2023-05-25 08:55 | 462K | |
| Advert Investigation..> | 2020-12-17 14:19 | 462K | |
| Annexure A - BPM ASS..> | 2022-12-13 12:54 | 462K | |
| Scope of Work C70 of..> | 2024-11-14 11:17 | 463K | |
| TENDER ADVERT - DIFF..> | 2021-08-26 15:23 | 463K | |
| Tender Advert - 10-2..> | 2021-10-26 12:55 | 463K | |
| Tender Advert - Apri..> | 2023-04-11 12:13 | 463K | |
| catering for marula ..> | 2025-02-17 12:33 | 464K | |
| Advert for the Elect..> | 2021-03-10 13:22 | 464K | |
| Advert - Insurance.pdf | 2020-07-13 08:31 | 469K | |
| 126691 Branding Bann..> | 2016-10-24 12:21 | 470K | |
| Advert Refubrishment..> | 2020-11-13 13:38 | 471K | |
| EL74-22-23.pdf | 2023-03-17 10:42 | 471K | |
| EL88-22-23.pdf | 2023-03-17 10:42 | 471K | |
| Tender Advert - Diff..> | 2022-01-14 10:47 | 472K | |
| Tender Advert - Diff..> | 2022-01-14 10:47 | 472K | |
| EL80-22-23.pdf | 2023-03-17 10:42 | 472K | |
| EL96-22-23.pdf | 2023-03-17 10:42 | 473K | |
| Advert 23-10-2020041..> | 2020-11-04 09:43 | 475K | |
| EL83-22-23.pdf | 2023-03-17 10:42 | 478K | |
| Land Survey24.pdf | 2024-06-18 15:52 | 480K | |
| EL99-22-23.pdf | 2023-03-17 10:42 | 480K | |
| EL87-22-23.pdf | 2023-03-17 10:42 | 481K | |
| Erratum for catering..> | 2022-03-23 15:41 | 481K | |
| Emergency Arrows.pdf | 2024-06-27 08:17 | 481K | |
| EL134.pdf | 2021-03-31 14:54 | 487K | |
| 420mm – 440mm Clam..> | 2022-09-29 14:01 | 488K | |
| 420mm - 440mm Clamp.pdf | 2022-09-29 14:01 | 488K | |
| 3550.pdf | 2021-06-22 15:15 | 489K | |
| 236 – 245mm Cascad..> | 2022-09-29 14:01 | 489K | |
| 236 - 245mm Cascade ..> | 2022-09-29 14:01 | 489K | |
| 212mm – 235mm Casc..> | 2022-09-29 14:01 | 489K | |
| 212mm - 235mm Cascad..> | 2022-09-29 14:01 | 489K | |
| 132mm – 142mm Cas..> | 2022-09-29 14:01 | 489K | |
| 132mm - 142mm Casca..> | 2022-09-29 14:01 | 489K | |
| 259 – 275mm Cascad..> | 2022-09-29 14:01 | 490K | |
| 259 - 275mm Cascade ..> | 2022-09-29 14:01 | 490K | |
| 322mm – 337mm Cas..> | 2022-09-29 14:01 | 490K | |
| 322mm - 337mm Casca..> | 2022-09-29 14:01 | 490K | |
| 455mm – 479mm Casc..> | 2022-09-29 14:01 | 490K | |
| 455mm - 479mm Cascad..> | 2022-09-29 14:01 | 490K | |
| 179 – 189mm Cascad..> | 2022-09-29 14:01 | 490K | |
| 179 - 189mm Cascade ..> | 2022-09-29 14:01 | 490K | |
| 248 – 257mm Cascad..> | 2022-09-29 14:01 | 490K | |
| 248 - 257mm Cascade ..> | 2022-09-29 14:01 | 490K | |
| 159 – 182mm Cascad..> | 2022-09-29 14:01 | 490K | |
| 159 - 182mm Cascade ..> | 2022-09-29 14:01 | 490K | |
| 265mm – 289mm Clam..> | 2022-09-29 14:01 | 490K | |
| 265mm - 289mm Clamp.pdf | 2022-09-29 14:01 | 490K | |
| 271mm – 289mm Cas..> | 2022-09-29 14:01 | 490K | |
| 271mm - 289mm Casca..> | 2022-09-29 14:01 | 490K | |
| Cascade Clamps101022..> | 2022-10-10 14:18 | 490K | |
| PS24.pdf | 2022-12-08 14:18 | 490K | |
| PS25.pdf | 2022-12-08 14:18 | 491K | |
| Meter Prepaid split-..> | 2023-11-15 07:24 | 492K | |
| Plastic Chairs, Stee..> | 2022-10-19 13:58 | 492K | |
| 08-22-23.pdf | 2023-04-25 13:12 | 492K | |
| Protection Grading f..> | 2022-10-10 14:18 | 494K | |
| PS23.pdf | 2022-12-08 14:18 | 495K | |
| Tyres for a truck20j..> | 2023-06-20 14:52 | 496K | |
| Tyres of a Truck .pdf | 2023-02-09 08:45 | 498K | |
| Tyres of a Truck 23j..> | 2023-01-23 09:29 | 498K | |
| supply and delivery ..> | 2022-06-03 10:54 | 499K | |
| supply and delivery ..> | 2022-06-03 11:00 | 499K | |
| Supply and delivery ..> | 2022-06-03 10:54 | 499K | |
| Supply and delivery ..> | 2022-06-03 11:00 | 499K | |
| Transformer Oil 210L..> | 2022-06-15 08:39 | 500K | |
| SUPPLY AND DELIVERY ..> | 2022-06-03 10:54 | 502K | |
| SUPPLY AND DELIVERY ..> | 2022-06-03 11:00 | 502K | |
| SUPPLY AND DELIVERY ..> | 2022-06-03 10:54 | 502K | |
| SUPPLY AND DELIVERY ..> | 2022-06-03 11:00 | 502K | |
| 133973.pdf | 2018-06-17 16:24 | 503K | |
| EL30.pdf | 2022-09-06 16:10 | 504K | |
| EL33.pdf | 2022-09-06 16:10 | 504K | |
| EL31.pdf | 2022-09-06 16:10 | 504K | |
| Oils 210L.pdf | 2022-06-15 08:39 | 505K | |
| EL28.pdf | 2022-09-06 16:10 | 505K | |
| Prepaid Meter 1p Spl..> | 2023-11-15 07:24 | 505K | |
| EL32.pdf | 2022-09-06 16:10 | 505K | |
| Supply and delivery ..> | 2022-06-03 10:54 | 505K | |
| Supply and delivery ..> | 2022-06-03 11:00 | 505K | |
| EL34.pdf | 2022-09-06 16:10 | 505K | |
| EL24.pdf | 2022-09-06 16:10 | 505K | |
| c.pdf | 2022-09-06 16:10 | 505K | |
| Supply and delivery ..> | 2022-06-03 10:54 | 506K | |
| Supply and delivery ..> | 2022-06-03 11:00 | 506K | |
| EL23.pdf | 2022-09-06 16:10 | 506K | |
| PS21.pdf | 2022-12-08 14:18 | 506K | |
| Supply and delivery ..> | 2022-06-03 10:54 | 506K | |
| Supply and delivery ..> | 2022-06-03 11:00 | 506K | |
| EL26.pdf | 2022-09-06 16:10 | 507K | |
| EL21.pdf | 2022-09-06 16:10 | 507K | |
| EL27.pdf | 2022-09-06 16:10 | 507K | |
| Supply and delivery ..> | 2022-06-03 10:54 | 507K | |
| Supply and delivery ..> | 2022-06-03 11:00 | 507K | |
| 134659.pdf | 2018-06-17 16:11 | 507K | |
| 133974.pdf | 2018-06-17 16:28 | 507K | |
| EL29.pdf | 2022-09-06 16:10 | 508K | |
| EL73-22-23.pdf | 2023-03-17 10:42 | 509K | |
| EL25.pdf | 2022-09-06 16:10 | 509K | |
| EL71-22-23.pdf | 2023-03-17 10:42 | 511K | |
| Installation of Pali..> | 2023-01-20 10:12 | 511K | |
| supply and delivery ..> | 2022-06-03 10:54 | 513K | |
| supply and delivery ..> | 2022-06-03 11:00 | 513K | |
| EL75-22-23.pdf | 2023-03-17 10:42 | 514K | |
| Supply and delivery ..> | 2022-06-03 10:54 | 515K | |
| Supply and delivery ..> | 2022-06-03 11:00 | 515K | |
| WOODEN DESKS WITH CR..> | 2023-04-18 12:09 | 515K | |
| PS20.pdf | 2022-12-08 14:18 | 515K | |
| 12000 BTU Air condit..> | 2023-04-18 12:09 | 515K | |
| EL79-22-23.pdf | 2023-03-17 10:42 | 515K | |
| 12000 BTU Air Condit..> | 2023-04-18 12:09 | 515K | |
| HIGH BACK CHAIRS BLA..> | 2023-04-18 12:09 | 515K | |
| BLINDS WINDOWS2318.pdf | 2023-04-18 12:09 | 516K | |
| VISITORS CHAIRS18042..> | 2023-04-18 12:09 | 516K | |
| FILLING CABINETS18.pdf | 2023-04-18 12:09 | 517K | |
| PS22.pdf | 2022-12-08 14:18 | 518K | |
| Laptops and Bags (00..> | 2023-06-27 12:18 | 520K | |
| Asphalt Town.pdf | 2024-04-29 14:03 | 523K | |
| Asphalt Lulekani.pdf | 2024-04-29 14:03 | 523K | |
| section 56 books.pdf | 2024-05-23 08:10 | 523K | |
| Asphalt Namakgale.pdf | 2024-04-29 14:03 | 523K | |
| REQ495june.pdf | 2022-06-07 11:04 | 524K | |
| REQ506june.pdf | 2022-06-07 11:04 | 524K | |
| REQ50706.pdf | 2022-06-07 11:04 | 524K | |
| Chairs and Workstati..> | 2022-12-06 12:44 | 524K | |
| RFQ 668.pdf | 2022-08-31 13:28 | 526K | |
| Construct Eract and ..> | 2020-05-29 14:00 | 527K | |
| REQ5921.pdf | 2024-08-20 17:32 | 529K | |
| REQ493june.pdf | 2022-06-07 11:04 | 529K | |
| supply and delivery ..> | 2021-05-05 08:06 | 529K | |
| RFQ 640.pdf | 2022-08-31 13:28 | 529K | |
| REQ1520.pdf | 2022-08-31 13:28 | 530K | |
| Magnum Hiboy 262805..> | 2020-07-27 12:54 | 532K | |
| RFQ552.pdf | 2022-08-31 13:28 | 535K | |
| REQ1554.pdf | 2022-08-31 13:28 | 535K | |
| Prepaid meter 1p spl..> | 2023-06-05 08:53 | 540K | |
| Lever union locksets..> | 2020-07-27 12:54 | 542K | |
| Supply and installat..> | 2021-04-14 10:09 | 544K | |
| REQ1527.pdf | 2022-08-31 13:28 | 545K | |
| TOP DRESSING AT IMPA..> | 2021-11-05 11:02 | 548K | |
| Cascade Clamps 20_09..> | 2022-03-09 11:27 | 549K | |
| Cascade Clamps 16_09..> | 2022-03-09 11:27 | 549K | |
| manhole chamber_0903..> | 2022-03-09 11:27 | 549K | |
| Brush cutters_090322..> | 2022-03-09 11:27 | 549K | |
| Cascade Clamps_09032..> | 2022-03-09 11:27 | 549K | |
| SOPHOS SUBSCRIPTION ..> | 2021-05-05 08:06 | 549K | |
| Supply and delivery ..> | 2021-11-18 15:17 | 549K | |
| SERVICE OF AIR CONDI..> | 2021-11-10 12:06 | 550K | |
| Meter prepaid split-..> | 2023-06-05 08:53 | 550K | |
| supply and delivery ..> | 2021-11-17 12:06 | 551K | |
| Supply and installat..> | 2021-04-14 10:09 | 552K | |
| REQ5219.pdf | 2024-04-22 16:01 | 554K | |
| Repair dosing syphon..> | 2022-03-09 11:27 | 554K | |
| Prepaid meter 1p Spl..> | 2022-06-15 13:27 | 556K | |
| RFQ DOC 1_3007.pdf | 2021-07-30 10:31 | 556K | |
| ENTERTAINMENT.pdf | 2022-02-17 08:17 | 556K | |
| REQ2364.pdf | 2023-01-19 15:06 | 557K | |
| REQ2253.pdf | 2023-01-09 10:13 | 558K | |
| REQ2363.pdf | 2023-01-19 15:06 | 558K | |
| MANHOLE.pdf | 2021-12-01 12:27 | 558K | |
| REQ2252.pdf | 2023-01-09 10:13 | 558K | |
| 126320 Council Table..> | 2016-08-05 09:17 | 559K | |
| REQ2290.pdf | 2023-01-09 10:13 | 561K | |
| REQ2294.pdf | 2023-01-09 10:13 | 561K | |
| RFQ 3.pdf | 2021-07-23 15:23 | 562K | |
| RFQ 3230721.pdf | 2021-07-23 15:23 | 562K | |
| REQ2300.pdf | 2023-01-09 10:13 | 562K | |
| REQ2299.pdf | 2023-01-09 10:13 | 562K | |
| RFQ 1.pdf | 2021-05-03 15:43 | 562K | |
| RFQ DOC 2_3007.pdf | 2021-07-30 10:31 | 564K | |
| RFQ DOC 3_3007.pdf | 2021-07-30 10:31 | 564K | |
| RFQ 6.pdf | 2021-06-30 08:22 | 565K | |
| RFQ 5.pdf | 2021-06-30 08:22 | 565K | |
| ERRATUM FOR 139797.pdf | 2021-08-19 14:34 | 567K | |
| RFQ DOC1.pdf | 2021-08-18 14:56 | 567K | |
| 126481 Truck Hire.pdf | 2018-01-24 15:15 | 567K | |
| RFQ 4.pdf | 2021-06-30 08:22 | 567K | |
| 139813_11052021.pdf | 2021-05-11 15:28 | 567K | |
| 139811_11052021.pdf | 2021-05-11 15:28 | 567K | |
| RFQ DOC2.pdf | 2021-08-18 14:56 | 568K | |
| 139814_11052021.pdf | 2021-05-11 15:28 | 568K | |
| RFQ 4 (1).pdf | 2021-07-23 15:23 | 568K | |
| RFQ 4230721.pdf | 2021-07-23 15:23 | 568K | |
| 133283 Tyres.pdf | 2018-01-24 15:10 | 568K | |
| 139812_11052021.pdf | 2021-05-11 15:28 | 569K | |
| Erratum for briefing..> | 2023-04-18 15:31 | 569K | |
| BPM MARULA SOCIAL MA..> | 2022-02-24 07:53 | 574K | |
| decoration for marul..> | 2022-03-23 08:48 | 577K | |
| RFQ DOC_0909.pdf | 2021-09-09 07:54 | 578K | |
| RFQ DOC0607.pdf | 2021-07-06 14:21 | 580K | |
| RFQ 1 (1).pdf | 2021-07-23 15:23 | 581K | |
| RFQ 1230721.pdf | 2021-07-23 15:23 | 581K | |
| VIP Catering.pdf | 2022-03-23 08:48 | 581K | |
| RFQ DOC.pdf | 2021-05-03 15:41 | 582K | |
| 30 DAYS TLB 281022.pdf | 2022-10-28 11:41 | 583K | |
| hiring of tlb 281022..> | 2022-10-28 11:41 | 583K | |
| TLB 281022.pdf | 2022-10-28 11:41 | 583K | |
| RFQ DOC130721.pdf | 2021-07-13 07:53 | 584K | |
| RFQ 1_0709.pdf | 2021-09-07 14:35 | 584K | |
| Suppy and fit Steel ..> | 2022-10-19 13:58 | 584K | |
| rfq_0709.pdf | 2021-09-07 14:35 | 585K | |
| road marking paints0..> | 2022-06-01 09:02 | 587K | |
| 134386.pdf | 2024-04-22 16:01 | 590K | |
| rfq041021.pdf | 2021-10-04 08:21 | 592K | |
| RFQ DOC3_1509.pdf | 2021-09-15 15:38 | 597K | |
| RFQ DOC2_1509.pdf | 2021-09-15 15:38 | 598K | |
| RFQ DOC1_1509.pdf | 2021-09-15 15:38 | 601K | |
| Prepaid meter 1p spl..> | 2021-09-06 13:54 | 602K | |
| RFQ 2.pdf | 2021-07-23 15:23 | 604K | |
| RFQ 2230721.pdf | 2021-07-23 15:23 | 604K | |
| REQ521424.pdf | 2024-04-24 12:05 | 605K | |
| REQ5214.pdf | 2024-04-22 16:01 | 605K | |
| Meter prepaid split-..> | 2021-09-06 13:54 | 606K | |
| DEBT COLLECTION TEND..> | 2025-05-26 16:12 | 612K | |
| LAND AUDIT FOR BPM T..> | 2025-05-26 16:12 | 620K | |
| RFQ1461.pdf | 2022-09-02 15:19 | 622K | |
| REQ1464.pdf | 2022-09-02 15:19 | 624K | |
| PLAN CABINET FOR MAP..> | 2023-10-11 07:31 | 624K | |
| RFQ for Branding _St..> | 2017-08-29 14:21 | 625K | |
| RFQ for Panel beatin..> | 2017-08-29 14:21 | 625K | |
| RFQ for Fixing of th..> | 2017-08-29 14:39 | 625K | |
| RFQ for Repairing of..> | 2017-08-29 14:21 | 625K | |
| RFQ for Repairing of..> | 2017-08-29 14:21 | 625K | |
| RFQ for Repairing th..> | 2017-08-29 14:39 | 625K | |
| RFQ for Repairs on a..> | 2017-08-29 14:39 | 625K | |
| RFQ for Spray Painti..> | 2017-08-29 14:21 | 625K | |
| FRQ for Purchasing a..> | 2017-08-29 14:39 | 625K | |
| RFQ for Purchasing a..> | 2017-08-29 14:39 | 625K | |
| RFQ for Wheel alignm..> | 2017-08-29 14:21 | 625K | |
| RFQ for Fixing of th..> | 2017-08-29 14:39 | 625K | |
| RFQ for Fixing of th..> | 2017-08-29 14:39 | 625K | |
| RFQ for Panel beatin..> | 2017-08-29 14:21 | 625K | |
| RFQ for Tyres for a ..> | 2017-08-29 14:21 | 626K | |
| REQ475june.pdf | 2022-06-07 11:04 | 626K | |
| RFQ for Tyres for a ..> | 2017-08-29 14:21 | 626K | |
| RFQ for Safety kits ..> | 2017-08-29 14:39 | 626K | |
| RFQ for Tyre for a H..> | 2017-08-29 14:39 | 626K | |
| RFQ for Tyres for a ..> | 2017-08-29 14:21 | 626K | |
| RFQ for Full safety ..> | 2017-08-29 14:21 | 626K | |
| Hiring Of Refuse Rem..> | 2017-10-25 13:20 | 627K | |
| RFQ for Tyres for a ..> | 2017-08-29 14:39 | 627K | |
| REQ466june.pdf | 2022-06-07 11:04 | 628K | |
| Book 3 of 3 _Tender ..> | 2021-09-07 09:39 | 628K | |
| tissues 2017.pdf | 2017-02-24 14:50 | 628K | |
| REQ5213.pdf | 2024-04-22 16:01 | 630K | |
| RFQ1460.pdf | 2022-09-02 15:19 | 631K | |
| REQ521324.pdf | 2024-04-24 12:05 | 634K | |
| plumber tools_090322..> | 2022-03-09 11:27 | 652K | |
| plumber tool_090322.pdf | 2022-03-09 11:27 | 652K | |
| Bio - Bacteriologica..> | 2022-03-09 11:27 | 654K | |
| LOGOS.pdf | 2024-03-01 16:01 | 654K | |
| REQ2692.pdf | 2023-04-11 08:37 | 656K | |
| Provision of web bas..> | 2025-05-26 16:12 | 657K | |
| REQ2768.pdf | 2023-04-11 08:37 | 657K | |
| REQ2769.pdf | 2023-04-11 08:37 | 657K | |
| REQ2295.pdf | 2023-01-09 10:13 | 658K | |
| REQ54.pdf | 2021-10-29 10:33 | 659K | |
| 127944 - traffic led..> | 2018-09-21 16:18 | 659K | |
| 135160 - hb chairs.pdf | 2018-09-21 16:18 | 659K | |
| REQ2296.pdf | 2023-01-09 10:13 | 659K | |
| 135161 - Airconditio..> | 2018-09-21 16:18 | 660K | |
| Request for two (2) ..> | 2024-08-13 15:57 | 660K | |
| Request for two (2) ..> | 2024-08-13 15:57 | 660K | |
| Refuse bags heavy du..> | 2024-08-14 09:09 | 660K | |
| Request for five(5) ..> | 2024-08-13 15:57 | 660K | |
| TLB needed to assist..> | 2024-08-16 08:51 | 660K | |
| Request for two (2) ..> | 2024-08-13 15:57 | 660K | |
| Truck tyres for BVJ ..> | 2024-08-16 08:51 | 660K | |
| Cable SWA 95X 4 Core..> | 2024-04-04 11:18 | 660K | |
| request for bush cle..> | 2023-12-12 08:37 | 660K | |
| REQ3436.pdf | 2023-08-01 08:02 | 660K | |
| Truck tyres for DZB ..> | 2024-08-16 08:51 | 660K | |
| 133592 - alarm syste..> | 2018-09-21 16:18 | 661K | |
| Request for hiring S..> | 2024-06-19 16:31 | 661K | |
| Install Ethernet com..> | 2024-04-20 18:48 | 661K | |
| Truck tyres for skip..> | 2024-08-16 08:51 | 661K | |
| TLB needed to assist..> | 2024-08-16 08:51 | 661K | |
| CABLE 120MM 3CORE XL..> | 2024-02-22 07:27 | 661K | |
| TLB needed to assist..> | 2024-08-16 08:51 | 661K | |
| Install 5kW hybrid i..> | 2024-06-07 08:50 | 661K | |
| Extention of line at..> | 2024-06-07 08:50 | 661K | |
| TRANSFORMER 315 KVA ..> | 2024-02-22 07:27 | 661K | |
| TRANSFORMER 200 KVA ..> | 2024-02-22 07:27 | 661K | |
| Joint kit 16mm-50mm ..> | 2024-06-26 09:03 | 661K | |
| Renewal of mimecast ..> | 2023-12-28 16:04 | 661K | |
| Printer toner for MF..> | 2023-12-28 16:04 | 661K | |
| Supply and delivery ..> | 2024-07-28 18:33 | 661K | |
| Refuse bag heavy dut..> | 2024-05-31 09:28 | 661K | |
| REQ2301.pdf | 2023-01-09 10:13 | 661K | |
| REPAIR & MAINTENANCE..> | 2024-01-09 09:33 | 661K | |
| CLEANING MATERIAL NE..> | 2023-09-21 14:10 | 662K | |
| Supply and delivery ..> | 2024-03-25 10:12 | 662K | |
| Supply and delivery ..> | 2024-07-28 18:33 | 662K | |
| Cable 120mm 3core XL..> | 2024-04-04 11:18 | 662K | |
| 87- 104 Cascade Clai..> | 2024-02-22 07:27 | 662K | |
| TRANSFORMER 150 KVA ..> | 2024-02-22 07:27 | 662K | |
| Transformer oil filt..> | 2024-04-29 14:03 | 662K | |
| refuse bags needed.pdf | 2023-09-21 14:10 | 662K | |
| Water meter 15mm wit..> | 2024-07-12 08:44 | 662K | |
| Water meter 20mm wit..> | 2024-07-12 08:44 | 662K | |
| Cable 120MM X 4 CORE..> | 2024-06-26 09:03 | 662K | |
| Registered land surv..> | 2024-06-19 08:44 | 662K | |
| Hiring of lowbed at ..> | 2024-04-29 14:03 | 662K | |
| 315- 325 VJ Coupling..> | 2024-02-22 07:27 | 662K | |
| Joint kit 25mm-95mm ..> | 2024-06-26 09:03 | 662K | |
| conduction of instut..> | 2024-06-11 15:52 | 662K | |
| conduction of instut..> | 2024-06-19 09:12 | 662K | |
| REQ2888.pdf | 2023-04-25 08:06 | 662K | |
| REQ2889.pdf | 2023-04-25 08:06 | 662K | |
| repair of scum buffe..> | 2023-09-21 14:09 | 662K | |
| Hiring of tipper tru..> | 2024-01-10 15:52 | 662K | |
| Hiring of tipper tru..> | 2024-01-18 08:53 | 662K | |
| CABLE SWA 95MM X 4 C..> | 2024-02-22 07:27 | 662K | |
| Cable LT PVC 16MMX 2..> | 2024-06-26 09:03 | 662K | |
| Supply and Installat..> | 2024-03-15 14:12 | 662K | |
| service provider nee..> | 2024-02-22 07:27 | 662K | |
| branding.pdf | 2024-03-04 12:08 | 662K | |
| CABLE 35MM X4CORE CU..> | 2024-02-22 07:27 | 662K | |
| Request for bush cle..> | 2024-04-20 18:48 | 662K | |
| 87- 104 VJ Coupling2..> | 2024-02-22 07:27 | 662K | |
| Cable XPLE 185mm X3 ..> | 2024-06-26 09:03 | 662K | |
| Supply and delivery ..> | 2024-06-07 08:50 | 662K | |
| Joint kit 25mm-95mm ..> | 2024-06-26 09:03 | 662K | |
| HIRING OF TLB FOR 21..> | 2024-01-10 15:52 | 662K | |
| HIRING OF TLB FOR 21..> | 2024-01-18 08:53 | 662K | |
| Supply and delivery ..> | 2024-07-28 18:33 | 663K | |
| Hiring of dozer for ..> | 2024-07-28 18:33 | 663K | |
| HIRING OF BULLDOZER ..> | 2024-01-10 15:52 | 663K | |
| HIRING OF BULLDOZER ..> | 2024-01-18 08:53 | 663K | |
| Hiring of excavator ..> | 2024-03-25 10:12 | 663K | |
| RENTAL OF TLB FOR 30..> | 2024-01-24 14:11 | 663K | |
| Hiring of tipper tru..> | 2024-05-28 11:52 | 663K | |
| paper blank needed.pdf | 2023-09-21 14:10 | 663K | |
| Cable 25mm x 3 core ..> | 2024-06-26 09:03 | 663K | |
| Cable LT PVC 16MMX 4..> | 2024-06-26 09:03 | 663K | |
| Supply and delivery ..> | 2024-03-25 10:12 | 663K | |
| computer tool box24.pdf | 2024-03-11 10:02 | 663K | |
| SUPPLY AND DELIVERY ..> | 2024-07-28 18:33 | 663K | |
| Cable LT PVC 35MMX 4..> | 2024-06-26 09:03 | 663K | |
| Supply and delivery ..> | 2024-07-28 18:33 | 663K | |
| Supply and delivery ..> | 2024-06-07 08:50 | 663K | |
| SUPPLY AND PRINTING ..> | 2024-03-19 08:31 | 663K | |
| SUPPLY & DELIVERY OF..> | 2024-01-09 09:33 | 663K | |
| 400mm Short Collar24..> | 2024-02-22 07:27 | 663K | |
| 315mm Adaptors24.pdf | 2024-02-22 07:27 | 663K | |
| 375mm Short Collar24..> | 2024-02-22 07:27 | 663K | |
| cable 35mm x4 core c..> | 2024-03-15 14:12 | 663K | |
| TLB needed to assist..> | 2023-06-01 08:46 | 664K | |
| SUPPLY & DELIVERY OF..> | 2024-01-09 09:33 | 664K | |
| free stand projector..> | 2024-03-13 08:36 | 664K | |
| cable 50mmx4 cu.pdf | 2024-03-15 14:12 | 664K | |
| REQ3270.pdf | 2023-07-12 16:00 | 664K | |
| hiring of TLB 010623..> | 2023-06-01 08:46 | 664K | |
| SUPPLY AND PRINTING ..> | 2024-02-13 11:11 | 664K | |
| 15 Inch blades24.pdf | 2024-05-07 08:33 | 664K | |
| service provider nee..> | 2024-02-22 07:27 | 664K | |
| SUPPLY & DELIVERY OF..> | 2024-01-09 09:33 | 664K | |
| Hiring of TLB for 21..> | 2024-05-07 08:33 | 664K | |
| BTU AIR CONDITIONERS..> | 2024-03-15 09:43 | 664K | |
| Supply and delivery ..> | 2024-07-28 18:33 | 664K | |
| DTS.2002.pdf | 2024-02-20 09:51 | 664K | |
| REQ5498 Request for ..> | 2024-06-15 19:45 | 664K | |
| REQ07.pdf | 2021-10-29 10:33 | 665K | |
| Excavator needed to ..> | 2023-06-01 08:46 | 665K | |
| request for TLB 4x2 ..> | 2024-01-25 12:01 | 665K | |
| REQUEST FOR 2 HUSQUR..> | 2024-02-13 11:11 | 665K | |
| TLB 4x2 request for ..> | 2024-05-13 11:14 | 665K | |
| EL259-23-24-185X3.pdf | 2024-05-31 15:32 | 665K | |
| Request for 4x2 TLB ..> | 2024-07-12 08:45 | 665K | |
| Request for 4x2 TLB ..> | 2024-07-12 08:45 | 665K | |
| Hiring of dozer for ..> | 2024-07-28 18:34 | 665K | |
| REQ3271.pdf | 2023-07-12 16:00 | 665K | |
| EL252-23-24-70X3.pdf | 2024-05-31 15:32 | 665K | |
| EL253-23-24-120X3.pdf | 2024-05-31 15:32 | 665K | |
| request for 4x2 TLB ..> | 2024-03-27 09:41 | 665K | |
| removal of excessive..> | 2023-09-21 14:09 | 665K | |
| Hiring of a excavato..> | 2024-05-20 15:59 | 665K | |
| EL255-23-24-150X3.pdf | 2024-05-31 15:32 | 665K | |
| Hiring of grader for..> | 2024-04-29 14:03 | 665K | |
| TLB needed to assist..> | 2024-05-13 11:14 | 666K | |
| hiring of bulldozer ..> | 2024-05-20 07:47 | 666K | |
| TLB needed to assist..> | 2024-02-06 09:28 | 666K | |
| TLB needed to assist..> | 2024-02-06 09:28 | 666K | |
| Excavator needed at ..> | 2024-03-01 16:01 | 666K | |
| remove sand and grit..> | 2024-03-01 16:01 | 666K | |
| Remove sand and grit..> | 2024-03-01 16:01 | 666K | |
| Remove sand and grit..> | 2024-03-01 16:01 | 666K | |
| BTU air conditioners..> | 2024-05-20 07:47 | 666K | |
| Request for 4 husquv..> | 2024-02-13 11:11 | 666K | |
| EL257-23-24-95X4.pdf | 2024-05-31 15:32 | 666K | |
| TLB needed at Luleka..> | 2024-03-01 16:01 | 666K | |
| Remove sand and grit..> | 2024-03-01 16:01 | 666K | |
| request for one new ..> | 2024-02-13 11:11 | 666K | |
| Excavator needed at ..> | 2024-07-23 14:51 | 667K | |
| Remove sand and grit..> | 2024-03-01 16:01 | 667K | |
| Supply and delivery ..> | 2024-07-28 18:33 | 667K | |
| Tissue paper 500 she..> | 2024-01-25 12:01 | 667K | |
| EL258-23-24-95X3.pdf | 2024-05-31 15:32 | 667K | |
| Provision for imple..> | 2024-07-25 16:28 | 667K | |
| EL260-23-24-240X3.pdf | 2024-05-31 15:32 | 667K | |
| EL251-23-24-50X4.pdf | 2024-05-31 15:32 | 667K | |
| Tissue paper 500 she..> | 2024-06-15 19:44 | 667K | |
| EL250-23-24-35X4.pdf | 2024-05-31 15:32 | 667K | |
| Request for 4x2 TLB ..> | 2024-07-23 14:51 | 668K | |
| TLB needed to assist..> | 2024-07-23 14:51 | 668K | |
| EL256-23-24-35X3.pdf | 2024-05-31 15:32 | 668K | |
| request for husquvar..> | 2024-02-13 11:11 | 668K | |
| TLB needed to assist..> | 2024-07-23 14:51 | 668K | |
| REQ41.pdf | 2021-10-29 10:33 | 668K | |
| REQ65.pdf | 2021-10-29 10:33 | 669K | |
| FOX CONDUCTOR.pdf | 2024-03-27 09:41 | 671K | |
| UNIFORM FOR 5 LAW EN..> | 2025-08-21 13:49 | 672K | |
| REQ10.pdf | 2021-10-29 10:33 | 672K | |
| TECHNICAL SERVICES.pdf | 2024-03-01 16:01 | 672K | |
| REQ5516.pdf | 2024-06-19 16:31 | 673K | |
| namakgale wwtw2401.pdf | 2024-01-18 16:01 | 673K | |
| LED2703.pdf | 2024-03-27 09:41 | 674K | |
| manhole cover2703.pdf | 2024-03-27 09:39 | 674K | |
| excavator of hard ro..> | 2024-03-27 09:39 | 675K | |
| phalaborwa plant2401..> | 2024-01-18 16:01 | 675K | |
| POLES AND HARDWARE.pdf | 2024-03-27 09:41 | 676K | |
| EL22.pdf | 2022-09-06 16:10 | 676K | |
| concrete cross bar.pdf | 2024-02-02 14:01 | 678K | |
| REQ58.pdf | 2021-10-29 10:33 | 678K | |
| namakgale wwtw42.pdf | 2024-01-18 16:01 | 678K | |
| request for TLB2703.pdf | 2024-03-27 09:41 | 678K | |
| body repairs.pdf | 2024-01-08 11:38 | 678K | |
| paper 16112020.pdf | 2020-11-16 07:56 | 678K | |
| technical services20..> | 2024-02-20 09:18 | 679K | |
| namakgale plant24011..> | 2024-01-18 16:01 | 679K | |
| technical2002.pdf | 2024-02-20 09:18 | 679K | |
| supply &delivery of ..> | 2024-03-25 10:21 | 679K | |
| Tyres for Truck.pdf | 2024-01-08 11:38 | 680K | |
| 200 litres240118.pdf | 2024-01-18 08:53 | 682K | |
| REQ5710 Paints.pdf | 2024-08-01 15:23 | 683K | |
| 40 drums240118.pdf | 2024-01-18 08:53 | 683K | |
| Supply and delivery ..> | 2024-08-29 14:17 | 683K | |
| REQ3051.pdf | 2023-05-22 15:38 | 683K | |
| De-bushing of the po..> | 2024-08-29 14:17 | 683K | |
| 8 fittings.pdf | 2024-01-08 11:38 | 683K | |
| 50W street light fit..> | 2024-08-19 09:45 | 683K | |
| REQ1118.pdf | 2024-08-29 14:17 | 683K | |
| Hiring of excavator ..> | 2024-08-20 08:59 | 683K | |
| Construction and ins..> | 2024-08-29 14:17 | 683K | |
| Replacement of 3 x 3..> | 2024-08-29 14:17 | 683K | |
| E650 KVA meters conn..> | 2024-08-19 09:45 | 683K | |
| request for tlb2302.pdf | 2024-02-23 15:55 | 683K | |
| Unblocking and remov..> | 2024-08-26 10:06 | 684K | |
| Unblocking and remov..> | 2024-08-29 14:17 | 684K | |
| MAINTENANCE OF AIRCO..> | 2024-08-19 09:45 | 684K | |
| 400W flood lights LE..> | 2024-08-19 09:45 | 684K | |
| water pump2302.pdf | 2024-02-23 15:55 | 684K | |
| Request for 1x doubl..> | 2024-08-26 10:06 | 684K | |
| Hiring of TLB for 21..> | 2024-08-20 08:59 | 684K | |
| REQUEST FOR SIXTY(60..> | 2024-08-19 09:45 | 684K | |
| Unblock of secondary..> | 2024-08-29 14:17 | 684K | |
| Replacement of 03x30..> | 2024-08-26 10:06 | 684K | |
| REQ4170.pdf | 2024-08-01 15:23 | 684K | |
| Repairs of Ablushing..> | 2024-08-29 14:17 | 684K | |
| E550 conventional ma..> | 2024-08-19 09:45 | 684K | |
| Repairs of Ablushing..> | 2024-08-26 10:06 | 684K | |
| TLB needed to assist..> | 2024-08-29 14:17 | 684K | |
| WS22-24-25.pdf | 2024-08-29 14:17 | 684K | |
| WS28-24-25.pdf | 2024-08-29 14:17 | 684K | |
| WS19-24-25.pdf | 2024-08-29 14:17 | 685K | |
| c.s.s.pdf | 2024-02-21 09:18 | 685K | |
| URBAN RENEWAL STRATE..> | 2025-05-26 16:12 | 685K | |
| DTS2002.pdf | 2024-02-20 09:51 | 685K | |
| STAIRCASE CONSTRUCTI..> | 2024-03-20 11:11 | 685K | |
| Hiring of tipper tru..> | 2024-08-20 08:59 | 685K | |
| el161.pdf | 2021-06-02 12:17 | 686K | |
| el170.pdf | 2021-06-02 12:11 | 686K | |
| el171.pdf | 2021-06-02 12:11 | 686K | |
| el172.pdf | 2021-06-02 11:57 | 686K | |
| ELECTRIFICATION OF M..> | 2024-03-27 09:41 | 687K | |
| el175.pdf | 2021-06-02 11:57 | 687K | |
| ELECTRIFICATION OF M..> | 2024-03-27 09:41 | 687K | |
| el160.pdf | 2021-06-02 12:17 | 687K | |
| cm151.pdf | 2021-06-02 12:17 | 687K | |
| el174.pdf | 2021-06-02 11:57 | 688K | |
| el183.pdf | 2021-06-02 11:57 | 688K | |
| cm152.pdf | 2021-06-02 12:17 | 688K | |
| truck tyres.pdf | 2024-01-08 11:38 | 688K | |
| el166.pdf | 2021-06-02 12:11 | 688K | |
| el176.pdf | 2021-06-02 11:57 | 689K | |
| selwane tsc18240.pdf | 2024-01-18 08:53 | 690K | |
| el163.pdf | 2021-06-02 12:17 | 691K | |
| el168.pdf | 2021-06-02 12:11 | 691K | |
| tyres for compactor ..> | 2024-03-20 11:11 | 691K | |
| el162.pdf | 2021-06-02 12:17 | 691K | |
| EL40-Cable.pdf | 2021-11-08 09:38 | 691K | |
| EL32-Cable 50x3 core..> | 2021-10-28 07:50 | 691K | |
| EL33-Cable 50mm x 4 ..> | 2021-10-28 07:50 | 691K | |
| EL30 - Cable 25mm x ..> | 2021-10-28 07:50 | 691K | |
| EL30 CU281021.PDF | 2021-10-28 07:50 | 691K | |
| EL30 Cable 25mm x 3..> | 2021-10-28 07:50 | 691K | |
| EL35-Cable 95mm x 3 ..> | 2021-10-28 07:50 | 691K | |
| EL31-Cable 35mm x 4 ..> | 2021-10-28 07:50 | 691K | |
| EL31Cable 35mm x 4 C..> | 2021-10-28 07:50 | 691K | |
| EL34-Cable 95mm x 3 ..> | 2021-10-28 07:50 | 691K | |
| EL31281021.PDF | 2021-10-28 07:50 | 691K | |
| EL36-Cable LT PVC 16..> | 2021-10-28 07:50 | 691K | |
| el54 16112020.pdf | 2020-11-16 07:56 | 691K | |
| el56 16112020.pdf | 2020-11-16 07:56 | 691K | |
| hiring of excavator ..> | 2022-10-28 11:41 | 691K | |
| el179.pdf | 2021-06-02 11:57 | 691K | |
| REQ13.pdf | 2021-10-29 10:33 | 692K | |
| el164.pdf | 2021-06-02 12:17 | 692K | |
| REQ08.pdf | 2021-10-29 10:33 | 692K | |
| ge31-Refuse 16112020..> | 2020-11-16 07:56 | 692K | |
| el57 16112020.pdf | 2020-11-16 07:56 | 692K | |
| el178.pdf | 2021-06-02 11:57 | 692K | |
| palisade2302.pdf | 2024-02-23 08:19 | 694K | |
| el173.pdf | 2021-06-02 11:57 | 694K | |
| DTS.pdf | 2024-03-20 11:11 | 694K | |
| el184.pdf | 2021-06-02 11:57 | 695K | |
| ge30-toilet rolls 16..> | 2020-11-16 07:56 | 695K | |
| coldmix .pdf | 2024-03-25 10:21 | 695K | |
| REQ129815.pdf | 2023-03-06 09:46 | 695K | |
| el165.pdf | 2021-06-02 12:11 | 696K | |
| computer tool box.pdf | 2024-03-07 15:59 | 696K | |
| parks nursery2401.pdf | 2024-01-18 08:53 | 696K | |
| coldmix namakgale.pdf | 2024-03-25 10:21 | 696K | |
| el169.pdf | 2021-06-02 12:11 | 697K | |
| supply of 1500 coldm..> | 2024-03-25 10:21 | 697K | |
| free blockages.pdf | 2017-11-03 07:26 | 697K | |
| servicing of fire ex..> | 2018-02-14 14:25 | 698K | |
| removal of sands.pdf | 2017-11-03 07:22 | 698K | |
| free stand projector..> | 2024-03-13 12:58 | 700K | |
| RFQ DOC 0250821.pdf | 2021-08-25 14:03 | 701K | |
| el180.pdf | 2021-06-02 11:57 | 701K | |
| ws31-pipe 16112020.pdf | 2020-11-16 07:56 | 701K | |
| EL42-Cable.pdf | 2021-11-08 09:38 | 702K | |
| EL43-Cable.pdf | 2021-11-08 09:38 | 702K | |
| EL41-Cable.pdf | 2021-11-08 09:38 | 702K | |
| MFMP TRAINING TENDER..> | 2025-05-26 09:29 | 703K | |
| 129199.pdf | 2018-05-10 17:52 | 704K | |
| 225mm PVC Pipe.pdf | 2017-11-03 07:27 | 705K | |
| Tissues.pdf | 2018-03-14 10:56 | 705K | |
| IMAPALA STADIUM MATE..> | 2021-12-01 12:27 | 706K | |
| cm150.pdf | 2021-06-02 12:17 | 707K | |
| RFQ No. 0507.pdf | 2022-12-14 09:17 | 707K | |
| REQ628.pdf | 2022-04-01 14:05 | 708K | |
| REQ626.pdf | 2022-04-01 14:05 | 709K | |
| el55-Lights 16112020..> | 2020-11-16 07:56 | 709K | |
| 134664.pdf | 2018-06-17 16:01 | 709K | |
| 138926.pdf | 2022-04-01 14:05 | 710K | |
| 138927.pdf | 2022-04-01 14:05 | 710K | |
| 138913.pdf | 2022-04-01 14:05 | 710K | |
| PROVISION OF CONSULT..> | 2025-02-19 15:36 | 711K | |
| REQ631.pdf | 2022-04-01 14:05 | 711K | |
| 138912.pdf | 2022-04-01 14:05 | 711K | |
| REQ630.pdf | 2022-04-01 14:05 | 712K | |
| REQ632.pdf | 2022-04-01 14:05 | 712K | |
| 138928.pdf | 2022-04-01 14:05 | 713K | |
| RFQ VAT RECOVERY REF..> | 2022-02-24 07:52 | 714K | |
| ws32-short 16112020.pdf | 2020-11-16 07:56 | 715K | |
| ws30-valve 16112020.pdf | 2020-11-16 07:56 | 716K | |
| tender document nkat..> | 2025-02-11 16:01 | 716K | |
| tender document culv..> | 2025-02-11 16:01 | 718K | |
| TENDER DOCUMENT CLIN..> | 2025-02-11 16:01 | 719K | |
| Rehabilitation of Ch..> | 2025-02-27 09:27 | 719K | |
| Landfill210721.pdf | 2021-07-21 14:59 | 719K | |
| el167.pdf | 2021-06-02 12:11 | 720K | |
| CONSULTANT FOR SUBST..> | 2025-05-26 09:29 | 720K | |
| Actuarial Valuation2..> | 2021-07-21 14:59 | 724K | |
| RFQ VAT RECOVERY REF..> | 2022-03-25 15:46 | 725K | |
| el177.pdf | 2021-06-02 11:57 | 725K | |
| el18220210618.pdf | 2021-06-18 13:35 | 727K | |
| el18120210618.pdf | 2021-06-18 13:35 | 727K | |
| el18320210618.pdf | 2021-06-18 13:35 | 728K | |
| 139382.pdf | 2021-06-18 14:17 | 729K | |
| REQ243.pdf | 2021-12-07 07:36 | 729K | |
| REQ69.pdf | 2021-11-08 12:04 | 730K | |
| EL13023022021.pdf | 2021-02-23 15:11 | 730K | |
| REQ11.pdf | 2021-11-08 12:04 | 730K | |
| el18418062021.pdf | 2021-06-18 13:35 | 730K | |
| CRUSHER DUST 120_021..> | 2021-11-02 16:10 | 730K | |
| el1802010618.pdf | 2021-06-18 13:35 | 731K | |
| REQ11371.pdf | 2022-07-28 12:15 | 732K | |
| Trapezoidalpitch dra..> | 2025-02-25 05:43 | 732K | |
| SUPPLY AND DELIVERY ..> | 2018-08-21 10:28 | 732K | |
| REQ2124.pdf | 2023-01-30 08:12 | 733K | |
| REQ315.pdf | 2022-01-25 10:21 | 733K | |
| REQ488.pdf | 2022-03-03 15:10 | 733K | |
| TENDER DOCUMENT FOR ..> | 2019-02-05 11:10 | 734K | |
| REQ2382.pdf | 2023-01-30 08:12 | 734K | |
| 135873.pdf | 2021-06-18 14:17 | 734K | |
| REQ1139.pdf | 2022-07-18 18:07 | 734K | |
| req2208.pdf | 2022-12-12 17:33 | 735K | |
| req2206.pdf | 2022-12-12 17:33 | 735K | |
| req2207.pdf | 2022-12-12 17:33 | 735K | |
| RFQ VAT RECOVERY REF..> | 2022-01-18 16:22 | 735K | |
| 135871.pdf | 2021-06-18 14:17 | 736K | |
| 135872.pdf | 2021-06-18 14:17 | 736K | |
| REQ2316.pdf | 2023-01-17 08:17 | 736K | |
| REQ2311.pdf | 2023-01-17 08:17 | 737K | |
| TENDER DOCUMENT FOR ..> | 2019-02-05 11:18 | 737K | |
| 155-175MM CASCADE CL..> | 2021-08-16 14:24 | 737K | |
| REQ217.pdf | 2021-12-07 07:36 | 737K | |
| REPAIR NONE ROTATING..> | 2021-07-28 10:00 | 737K | |
| CASH COUNTING MACHIN..> | 2020-10-29 09:08 | 738K | |
| UNBLOCK TWO PRIMARY_..> | 2021-08-16 14:24 | 738K | |
| UNBLOCK HUMUS SUMPS_..> | 2021-08-16 14:24 | 738K | |
| 139816.pdf | 2021-06-18 14:17 | 738K | |
| Travelling Agency TE..> | 2024-11-06 08:02 | 738K | |
| el4008042021.pdf | 2021-04-08 13:10 | 738K | |
| Travelling Agency Te..> | 2024-11-01 08:59 | 738K | |
| 121-135MM CASCADE CL..> | 2021-08-16 14:24 | 738K | |
| REQ314.pdf | 2022-01-25 10:21 | 738K | |
| 135866.pdf | 2021-06-18 14:17 | 738K | |
| TRAINING CODE 14.pdf | 2021-08-13 11:52 | 739K | |
| TRAINING CODE 14_160..> | 2021-08-16 15:14 | 739K | |
| 236-245MM CASCADE CL..> | 2021-08-16 14:24 | 739K | |
| LAPTOP BAG.pdf | 2021-05-06 10:50 | 739K | |
| CRUSHER DUST.pdf | 2021-08-16 11:05 | 739K | |
| 135786.pdf | 2021-06-18 14:17 | 739K | |
| Tender Data - 08-24-..> | 2024-11-14 11:17 | 739K | |
| REQ2307.pdf | 2023-01-17 08:17 | 740K | |
| 179-189MM CASCADE CL..> | 2021-08-16 14:24 | 740K | |
| CONTROL STRUCTURAL H..> | 2021-04-19 14:04 | 740K | |
| CABLE 50MM X 4 CORE.pdf | 2021-05-11 08:46 | 740K | |
| SUBSTATION UPGRADE21..> | 2021-09-01 15:30 | 740K | |
| 100M³ SUPPLY AND DE..> | 2021-03-17 16:03 | 740K | |
| SUPPLY AND DELIVERY ..> | 2021-03-17 16:03 | 740K | |
| REQ2016.pdf | 2022-11-08 08:29 | 740K | |
| REQ1138.pdf | 2022-07-18 18:07 | 740K | |
| FOGGING MACHINE.pdf | 2021-08-24 12:45 | 740K | |
| REQ218_190122.pdf | 2022-01-19 08:27 | 741K | |
| ERRATUM FOR BUSH CLE..> | 2021-01-28 08:00 | 741K | |
| LOCAL GOVERNMENT_270..> | 2021-09-27 16:01 | 741K | |
| REQ345 ERRATUM_03022..> | 2022-02-03 13:24 | 741K | |
| ASPHALT COLDMIX17092..> | 2021-09-17 10:29 | 741K | |
| REQ345_190122.pdf | 2022-01-19 08:27 | 741K | |
| REQ2018.pdf | 2022-11-08 08:29 | 741K | |
| 02 SUPPLY AND DELIVE..> | 2021-03-17 16:03 | 741K | |
| 13.2MM ROAD STONES.pdf | 2021-08-16 11:05 | 741K | |
| REQ31322.pdf | 2022-01-25 10:21 | 742K | |
| VPN LICENCE & INSTAL..> | 2022-07-28 08:41 | 742K | |
| BUSH CLEARANCE AT NA..> | 2021-07-28 10:00 | 742K | |
| REQ2000.pdf | 2022-11-08 08:29 | 742K | |
| G5 MATERIAL.pdf | 2021-08-16 11:05 | 742K | |
| POTGIETER STATION.pdf | 2021-08-06 10:57 | 742K | |
| PURCHASING OF NEW CH..> | 2021-08-06 14:46 | 742K | |
| REQ2011.pdf | 2022-11-08 08:29 | 742K | |
| REQ2004.pdf | 2022-11-08 08:29 | 743K | |
| CUTTING EDGE.pdf | 2021-06-10 09:08 | 743K | |
| REQ621 150322.pdf | 2022-03-15 15:47 | 743K | |
| REQ621- ERRATUM.pdf | 2022-03-16 14:35 | 743K | |
| TRAINING FOR FIRST A..> | 2021-10-06 11:25 | 743K | |
| REQ2287.pdf | 2023-01-09 10:13 | 743K | |
| IMPALA PARK STADIUM2..> | 2021-03-29 15:06 | 743K | |
| CAT 65 EMULSION.pdf | 2021-08-16 11:05 | 743K | |
| REQ621.pdf | 2022-03-17 15:59 | 743K | |
| REQ2437.pdf | 2023-02-07 14:03 | 743K | |
| TREATING VEGETATIVE.pdf | 2021-08-06 10:57 | 743K | |
| 100M³ SUPPLY AND DE..> | 2021-03-17 16:03 | 743K | |
| SUPPLY AND DELIVERY1..> | 2021-03-17 16:03 | 743K | |
| 70% ALCOHOL.pdf | 2021-05-03 08:13 | 743K | |
| 70 ALCOHOL.pdf | 2021-05-03 08:13 | 743K | |
| REQ2002.pdf | 2022-11-08 08:29 | 743K | |
| REQ312.pdf | 2022-01-28 08:25 | 743K | |
| gabien +25005112020.pdf | 2020-11-05 14:02 | 743K | |
| HI-Q TENDER DOCUMENT..> | 2024-11-01 08:59 | 743K | |
| HI-Q TENDER DODUMENT..> | 2024-11-06 08:02 | 743K | |
| REQ2001.pdf | 2022-11-08 08:29 | 743K | |
| REQ1056.pdf | 2022-06-22 15:27 | 744K | |
| REQ1113.pdf | 2022-06-22 15:27 | 744K | |
| TRAINING FOR CUSTOME..> | 2021-10-06 11:25 | 744K | |
| REQ2005.pdf | 2022-11-08 08:29 | 744K | |
| REQ1288.pdf | 2022-07-28 12:15 | 744K | |
| TRAINING FOR TLB OPE..> | 2021-10-06 11:25 | 744K | |
| TRAINING FOR FACILIT..> | 2021-10-18 14:00 | 744K | |
| RENTAL OF MULTIFUNCT..> | 2025-05-26 09:29 | 744K | |
| BUSH HATS.pdf | 2021-09-06 08:06 | 744K | |
| REQ1438- ROAD AND ST..> | 2022-08-18 11:32 | 744K | |
| 1000X1.0009032021.pdf | 2021-03-09 10:23 | 744K | |
| REQ2009.pdf | 2022-11-08 08:29 | 744K | |
| BPM MARULA SOCIAL MA..> | 2022-02-17 08:17 | 744K | |
| REQ2017.pdf | 2022-11-08 08:29 | 745K | |
| FOSKOR PUMP STATION.pdf | 2021-08-06 10:57 | 745K | |
| T.UNIFORM.pdf | 2023-01-19 15:06 | 745K | |
| REQ1137.pdf | 2022-07-18 18:07 | 745K | |
| 96M3 OF READYMIX1502..> | 2022-02-15 09:48 | 745K | |
| REQ2014.pdf | 2022-11-08 08:29 | 745K | |
| REQ2012.pdf | 2022-11-08 08:29 | 745K | |
| REQ2436.pdf | 2023-02-07 14:03 | 745K | |
| PURCHASE OF NEW Z460..> | 2021-08-06 14:46 | 745K | |
| NAMAKGALE WARD 42903..> | 2021-03-29 15:06 | 745K | |
| REQ1086.pdf | 2022-06-22 15:31 | 746K | |
| TRAINING FOR HERBICI..> | 2021-10-06 11:25 | 746K | |
| REQ2003.pdf | 2022-11-08 08:29 | 746K | |
| 2000 C0LD MIX ASPHAL..> | 2021-03-17 16:03 | 746K | |
| TRAINING FOR DISCIPL..> | 2021-10-18 14:00 | 746K | |
| MAYORAL GALA DINNER ..> | 2022-02-17 08:17 | 746K | |
| REQ2439.pdf | 2023-02-07 14:03 | 746K | |
| 80X25LITRES HAND SAN..> | 2021-03-17 16:03 | 746K | |
| C0LD MIX ASPHALT 25K..> | 2021-02-17 15:22 | 746K | |
| PROCUREMENT OF THE F..> | 2021-10-04 08:54 | 746K | |
| EDGING LOGS.pdf | 2021-08-06 14:46 | 746K | |
| REQ2438.pdf | 2023-02-07 14:03 | 746K | |
| BID Document for Pan..> | 2020-09-10 08:58 | 746K | |
| TRAINING FOR CONFLIC..> | 2021-10-18 14:00 | 747K | |
| CATERING220809.pdf | 2022-09-09 09:56 | 747K | |
| REQ1385- ROAD AND ST..> | 2022-08-18 11:32 | 747K | |
| REQ1439- ROAD AND ST..> | 2022-08-18 11:32 | 747K | |
| REQ1466- ROAD AND ST..> | 2022-08-19 10:12 | 747K | |
| WIFI EXTENDER.pdf | 2021-05-06 10:50 | 748K | |
| clearing ward 190511..> | 2020-11-05 14:02 | 748K | |
| C450015042021.pdf | 2021-04-15 14:39 | 748K | |
| BPM MARULA SOCIAL MA..> | 2022-02-23 15:58 | 748K | |
| REQ1082.pdf | 2022-06-22 15:31 | 748K | |
| REQ1078.pdf | 2022-06-22 15:31 | 748K | |
| Hire of Refuse remov..> | 2021-05-27 08:07 | 748K | |
| TRAINING FOR AIR CON..> | 2021-10-06 11:25 | 748K | |
| USB FLASH.pdf | 2021-05-06 10:50 | 748K | |
| A4 PAGER NEWSLETTER_..> | 2021-08-16 14:24 | 748K | |
| Cleaning and Hygiene..> | 2021-05-20 14:17 | 749K | |
| TRAINING FOR RECORD ..> | 2021-10-18 14:00 | 750K | |
| BPM MARULA SOCIAL MA..> | 2022-02-17 08:17 | 750K | |
| TRAINING FOR HAZZARD..> | 2021-10-06 11:25 | 751K | |
| PURCHASE OF NEW EQUI..> | 2021-08-06 14:46 | 751K | |
| HEAVY DUTY BLOWER MO..> | 2021-05-11 08:46 | 752K | |
| REQ930 220622.pdf | 2022-06-22 11:02 | 752K | |
| COMPUTER TOOL.pdf | 2021-05-06 10:50 | 752K | |
| heavy duty blower051..> | 2020-11-05 14:02 | 753K | |
| TRAINING FOR ETHICS ..> | 2021-10-18 14:00 | 753K | |
| PROCUREMENT OF NEW T..> | 2021-10-04 08:54 | 754K | |
| SSL CERTIFICATE.pdf | 2021-08-13 11:52 | 754K | |
| SSL CERTIFICATE_1608..> | 2021-08-16 15:14 | 754K | |
| REPAIR OF PRECAST WA..> | 2020-10-29 09:08 | 755K | |
| REQ1140.pdf | 2022-07-18 18:07 | 755K | |
| consultncy.pdf | 2025-02-19 15:36 | 759K | |
| 01 SUPPLY AND DELIVE..> | 2021-03-17 16:03 | 759K | |
| TRAFFIC ROADMARKING.pdf | 2021-05-28 07:58 | 760K | |
| el14716042021.pdf | 2021-04-16 15:02 | 760K | |
| REQUEST TO PURCHASE ..> | 2021-08-06 14:46 | 762K | |
| REQ498150222.pdf | 2022-02-15 09:48 | 762K | |
| MAYORAL GALA DINNER.pdf | 2022-02-17 08:17 | 763K | |
| el14616042021.pdf | 2021-04-16 15:02 | 764K | |
| 135239.pdf | 2023-01-30 08:12 | 764K | |
| RFQ - Assessment of ..> | 2025-10-29 10:38 | 765K | |
| General Items.pdf | 2016-09-14 10:02 | 765K | |
| el14516042021.pdf | 2021-04-16 15:02 | 766K | |
| ZORBER TENDER DOCUME..> | 2024-11-01 08:59 | 768K | |
| CHAIN C85058.pdf | 2021-08-06 14:46 | 772K | |
| BLOWER MOWER.pdf | 2021-05-03 08:16 | 774K | |
| TRAINING FOR OCCUPAT..> | 2021-10-06 11:25 | 777K | |
| 139590.pdf | 2023-01-17 08:17 | 778K | |
| procurement uniform ..> | 2025-03-24 15:55 | 779K | |
| REQ3060 130623.pdf | 2023-06-13 13:54 | 779K | |
| REQ3060.pdf | 2023-05-29 08:38 | 781K | |
| REQ2222.pdf | 2023-01-17 08:17 | 781K | |
| tender document nkat..> | 2025-02-14 09:02 | 783K | |
| REQ2361.pdf | 2023-01-30 08:12 | 783K | |
| REQUEST TO PROCURE04..> | 2021-10-04 08:54 | 783K | |
| tender document culv..> | 2025-02-14 09:02 | 784K | |
| Split Meters Tender ..> | 2022-08-26 08:02 | 785K | |
| tender document high..> | 2025-02-14 09:02 | 785K | |
| TENDER DOCUMENT CLIN..> | 2025-02-14 09:02 | 785K | |
| tender document high..> | 2025-02-11 16:01 | 786K | |
| SERVICING OF SERVER ..> | 2022-07-28 08:54 | 791K | |
| FACILITATE STRATEGIC..> | 2021-11-15 15:57 | 794K | |
| provision of consult..> | 2025-08-28 12:28 | 799K | |
| REQ3059.pdf | 2023-05-29 08:38 | 800K | |
| Provision of consult..> | 2025-08-28 12:28 | 800K | |
| GRAVEL TO block pavi..> | 2025-08-28 12:28 | 800K | |
| librarysdddf.pdf | 2017-05-31 15:57 | 801K | |
| DESK & COUNTER SHIEL..> | 2021-08-24 12:45 | 803K | |
| REMOVE & INSTALL.pdf | 2021-05-28 07:58 | 804K | |
| REQ2404.pdf | 2023-02-28 16:23 | 809K | |
| TRAINING FOR BID COM..> | 2021-10-18 14:00 | 810K | |
| TENDER DOCUMENT POOL..> | 2022-08-26 08:03 | 818K | |
| 134003.pdf | 2018-06-17 16:06 | 818K | |
| TRAINING FOR PEST CO..> | 2021-10-18 14:00 | 821K | |
| Tender Document for ..> | 2022-07-14 15:13 | 824K | |
| REQ1330-ICT EQUIPMEN..> | 2022-08-11 08:53 | 825K | |
| LAND AUDIT (re-adver..> | 2025-10-10 11:36 | 825K | |
| Tender Document for ..> | 2022-07-14 15:07 | 826K | |
| Tender Document for ..> | 2022-07-14 15:10 | 826K | |
| REQ1899.pdf | 2022-11-15 08:34 | 827K | |
| MFMP TRAINING ADDEND..> | 2025-06-12 15:38 | 828K | |
| REQ2315.pdf | 2023-01-17 08:17 | 828K | |
| TRAINING FOR HORTICU..> | 2021-10-18 14:00 | 829K | |
| PROVISION OF A WEB-B..> | 2026-02-26 09:37 | 830K | |
| Provision of consult..> | 2025-08-14 15:23 | 831K | |
| REQ2314.pdf | 2023-01-17 08:17 | 832K | |
| REQ2305.pdf | 2023-01-17 08:17 | 832K | |
| provision of consult..> | 2025-08-14 15:23 | 833K | |
| Provision of consult..> | 2025-08-14 15:22 | 833K | |
| REQ1332-ICT EQUIPMEN..> | 2022-08-11 08:53 | 834K | |
| TENDER DOCUMENT POOL..> | 2022-09-08 09:33 | 835K | |
| REQ2306.pdf | 2023-01-17 08:17 | 839K | |
| ADVERT - SHORT TERM ..> | 2016-09-13 11:26 | 842K | |
| TRAINING FOR ANTI-CO..> | 2021-10-18 14:00 | 842K | |
| NEW LANDFILL SITE TE..> | 2025-09-10 23:02 | 842K | |
| TRAINING FOR GRADER ..> | 2021-10-06 11:25 | 842K | |
| Provision of consult..> | 2025-09-01 16:11 | 845K | |
| WS90-20-2108042021.pdf | 2021-04-08 13:10 | 846K | |
| Scan03-19-2026-10061..> | 2026-03-19 13:07 | 846K | |
| WS92-20-2108042021.pdf | 2021-04-08 13:10 | 848K | |
| GIS SOFTWARE SOLUTIO..> | 2024-03-13 08:36 | 848K | |
| Provision for consul..> | 2025-09-01 16:11 | 852K | |
| CONSULTANT FOR SUBST..> | 2025-06-11 09:06 | 852K | |
| TENDER DOCUMENT FOR ..> | 2019-05-21 10:14 | 852K | |
| REFURBISHMENT OF MUN..> | 2020-10-29 09:08 | 858K | |
| Cleaning Material 20..> | 2017-02-24 14:50 | 859K | |
| el185.pdf | 2021-06-02 11:57 | 859K | |
| el181.pdf | 2021-06-02 11:57 | 861K | |
| EL121.pdf | 2023-12-28 13:07 | 861K | |
| RENTAL OF MULTIFUNCT..> | 2025-06-12 15:38 | 861K | |
| DIARIES1511.pdf | 2021-11-15 15:57 | 862K | |
| Provision of consult..> | 2025-08-28 12:28 | 867K | |
| specialist (auditor)..> | 2025-09-01 16:11 | 868K | |
| K3 TOUCHLESS INFRARE..> | 2021-06-02 08:05 | 870K | |
| Erratum Disaster Rec..> | 2024-05-08 16:17 | 872K | |
| Consulting Engineer ..> | 2025-10-10 10:55 | 873K | |
| Consulting Engineer ..> | 2025-10-10 10:55 | 873K | |
| RENTAL OF MULTIFUNCT..> | 2025-08-19 12:45 | 873K | |
| DEBT COLLECTION ADDE..> | 2025-06-12 15:38 | 878K | |
| Supply and Delivery ..> | 2018-08-21 10:28 | 882K | |
| Panel of contractors..> | 2026-02-13 16:03 | 884K | |
| Panel of contractors..> | 2026-02-06 14:08 | 888K | |
| Panel of contractors..> | 2026-02-13 16:03 | 888K | |
| Panel of contractors..> | 2026-02-23 16:03 | 888K | |
| Panel of contractors..> | 2026-02-19 14:44 | 888K | |
| Tender no. 11-20-21 ..> | 2021-06-03 11:18 | 889K | |
| Panel od contractors..> | 2026-02-18 15:56 | 890K | |
| Panel of contractors..> | 2026-02-06 14:08 | 890K | |
| Terms of Reference f..> | 2019-02-05 17:47 | 895K | |
| Meter reading tender..> | 2024-11-01 08:59 | 895K | |
| Extention 9 tender d..> | 2025-10-10 11:36 | 902K | |
| TOR human settlement..> | 2024-03-13 08:36 | 906K | |
| Panel of contractors..> | 2026-02-19 14:44 | 907K | |
| Provision of consult..> | 2025-08-14 15:23 | 907K | |
| Panel of engineering..> | 2026-02-06 14:08 | 908K | |
| TENDER 9-23-24.pdf | 2024-01-24 12:18 | 910K | |
| Panel of contractors..> | 2026-02-18 15:56 | 914K | |
| Panel of contractors..> | 2026-02-06 14:08 | 914K | |
| SURVEYING OF PORTION..> | 2024-12-09 15:58 | 921K | |
| Tender document Secu..> | 2024-11-18 09:06 | 941K | |
| Tender document Secu..> | 2024-12-09 15:58 | 941K | |
| Tender document Secu..> | 2024-12-10 14:31 | 942K | |
| Trainings.pdf | 2017-10-10 15:09 | 942K | |
| Trainings1.pdf | 2017-10-10 15:09 | 942K | |
| PROVISION OF CONSULT..> | 2025-10-10 13:33 | 950K | |
| 139588.pdf | 2023-01-17 08:17 | 950K | |
| RFQ1805.pdf | 2023-03-28 08:02 | 952K | |
| RFQ1806.pdf | 2023-03-28 08:02 | 952K | |
| CONSULTANT FOR UPGRA..> | 2025-10-16 11:01 | 954K | |
| SUPPLY AND INSTALLAT..> | 2025-10-14 10:10 | 964K | |
| Water Materials.pdf | 2016-09-14 08:41 | 966K | |
| Erratum for decorati..> | 2022-03-23 15:41 | 966K | |
| Tender Document for ..> | 2022-08-31 08:56 | 1.0M | |
| Tender Document for ..> | 2022-08-31 11:35 | 1.0M | |
| Tender Document - In..> | 2025-09-16 09:02 | 1.0M | |
| APPOINTMENT OF SERVI..> | 2022-09-29 08:59 | 1.0M | |
| TENDER 4-23-24.pdf | 2024-01-24 12:18 | 1.0M | |
| Terms of Reference f..> | 2019-02-05 17:42 | 1.0M | |
| Phalaborwa Extention..> | 2024-12-09 15:58 | 1.0M | |
| REQ0991.pdf | 2023-01-30 14:18 | 1.0M | |
| RFQ 13634813.pdf | 2022-07-13 08:50 | 1.0M | |
| SUPPLY AND INSTALLAT..> | 2025-10-10 13:33 | 1.0M | |
| 134655.pdf | 2018-05-10 17:51 | 1.0M | |
| ELECTRIFICATION OF M..> | 2025-05-26 09:29 | 1.0M | |
| EPWP PROGRAMME PPE.pdf | 2021-06-02 08:05 | 1.0M | |
| PROVISION FOR OPERAT..> | 2025-08-29 14:33 | 1.0M | |
| REQ310_190122.pdf | 2022-01-19 08:29 | 1.0M | |
| TENDER DOCUMENT FOR ..> | 2019-08-07 09:28 | 1.0M | |
| RFQ 13634713.pdf | 2022-07-13 08:50 | 1.0M | |
| TENDER 6-23-24.pdf | 2024-01-24 12:18 | 1.1M | |
| RFQ1808.pdf | 2023-03-28 08:02 | 1.1M | |
| RFQ1807.pdf | 2023-03-28 08:02 | 1.1M | |
| PANEL OF ATTORNEYS T..> | 2026-02-10 12:50 | 1.1M | |
| Electrical Items 201..> | 2017-02-24 14:50 | 1.1M | |
| 5154.pdf | 2024-05-31 16:35 | 1.1M | |
| electrical el15-25.pdf | 2018-09-27 07:43 | 1.1M | |
| Tender No. 06-21-22 ..> | 2021-06-03 14:11 | 1.1M | |
| TENDER 2-23-24.pdf | 2024-01-24 12:18 | 1.1M | |
| TENDER DOCUMENT FOR ..> | 2018-09-12 17:26 | 1.1M | |
| Tender Document-01-2..> | 2021-06-09 16:24 | 1.1M | |
| ELECTRIFICATION OF M..> | 2025-06-10 15:39 | 1.1M | |
| Tender Document-03-2..> | 2021-06-09 16:24 | 1.1M | |
| TENDER DOCUMENT FOR ..> | 2019-10-24 07:37 | 1.1M | |
| Tender Document-02-2..> | 2021-06-09 16:24 | 1.1M | |
| ELECTRIFICATION OF M..> | 2025-10-10 11:36 | 1.1M | |
| TENDER DOCUMENT FOR ..> | 2023-05-05 08:57 | 1.1M | |
| TENDER 3-23-24.pdf | 2024-01-24 12:18 | 1.1M | |
| TENDER 5-23-24.pdf | 2024-01-24 12:18 | 1.2M | |
| Topographical Survey..> | 2024-06-19 09:06 | 1.2M | |
| TERMS OF REFERENCE F..> | 2019-09-05 21:51 | 1.2M | |
| Tender Document No. ..> | 2022-01-18 08:13 | 1.2M | |
| Tender Document No. ..> | 2022-01-18 08:13 | 1.2M | |
| Tender Document No. ..> | 2022-01-18 08:13 | 1.2M | |
| Addendum Tender No. ..> | 2022-01-28 15:20 | 1.2M | |
| Tender Document No. ..> | 2022-01-18 08:13 | 1.2M | |
| TENDER NO.11-21-22 T..> | 2021-11-11 07:46 | 1.2M | |
| Tender Document No. ..> | 2022-01-18 08:13 | 1.3M | |
| ERRATUM PPE TENDER ..> | 2022-09-19 13:32 | 1.3M | |
| Tender Document No. ..> | 2022-12-28 16:56 | 1.3M | |
| Tender No. 20-21-22...> | 2022-06-29 15:01 | 1.3M | |
| PPE TENDER DOCUMENT..> | 2022-08-26 08:01 | 1.3M | |
| Tender Document Pool..> | 2019-02-05 14:51 | 1.3M | |
| ERRATUM 2 PPE TENDER..> | 2022-09-21 11:05 | 1.3M | |
| Provision of Service..> | 2018-08-21 10:28 | 1.3M | |
| Tender No.05-21-22 E..> | 2021-06-08 08:00 | 1.3M | |
| Tender No.10-21-22 P..> | 2021-11-02 07:49 | 1.3M | |
| 2nd Addendum Tender ..> | 2021-11-12 08:15 | 1.3M | |
| Tender Document for ..> | 2022-12-14 09:22 | 1.4M | |
| Tender Document. Inv..> | 2023-08-21 09:03 | 1.4M | |
| Tender Document Pro..> | 2023-05-05 08:57 | 1.4M | |
| Erratum Provision of..> | 2024-06-04 13:53 | 1.4M | |
| Provision of consult..> | 2024-05-16 08:35 | 1.4M | |
| tender document PPE.pdf | 2025-09-17 18:24 | 1.4M | |
| Erratum Provision of..> | 2024-06-04 13:53 | 1.4M | |
| Provision of consult..> | 2024-05-16 08:35 | 1.4M | |
| investigation consul..> | 2024-04-18 09:29 | 1.4M | |
| SUPPLY AND INSTALLAT..> | 2023-12-07 12:32 | 1.4M | |
| Ba-Phalaborwa Munici..> | 2019-05-21 10:06 | 1.4M | |
| MFMP TRAINING TENDER..> | 2024-04-09 18:41 | 1.4M | |
| Addendum Tender Docu..> | 2023-07-06 14:12 | 1.5M | |
| Tender Document Pro..> | 2023-06-20 11:54 | 1.5M | |
| Tender Document Pro..> | 2023-06-20 11:54 | 1.5M | |
| Tender Document Pro..> | 2023-06-20 11:54 | 1.5M | |
| Addendum Tender Docu..> | 2023-07-06 14:12 | 1.5M | |
| Tender Document Pro..> | 2023-06-20 11:54 | 1.5M | |
| Addendum Tender Docu..> | 2023-07-06 14:12 | 1.5M | |
| Addendum Tender Docu..> | 2023-07-06 14:12 | 1.5M | |
| Addendum Tender Docu..> | 2023-07-06 14:12 | 1.5M | |
| Tender Document Pro..> | 2023-06-20 11:54 | 1.5M | |
| Tender Document.Adde..> | 2023-09-14 08:53 | 1.5M | |
| Tender Document co-..> | 2023-05-05 08:57 | 1.5M | |
| SURVEYING OF PORTION..> | 2024-04-09 18:41 | 1.5M | |
| Amended Insurance Te..> | 2023-01-05 15:44 | 1.5M | |
| Insurance Tender Doc..> | 2022-12-13 12:58 | 1.5M | |
| Tender Document No. ..> | 2022-01-18 08:13 | 1.5M | |
| Erratum Provision of..> | 2024-06-04 13:53 | 1.5M | |
| Provision of consult..> | 2024-05-16 08:35 | 1.5M | |
| Tender Document for ..> | 2023-05-10 15:41 | 1.5M | |
| Tender Doccument Ren..> | 2019-08-08 16:17 | 1.5M | |
| SPECIFICATION FOR SU..> | 2022-08-05 12:44 | 1.5M | |
| Travelling Agency te..> | 2023-12-04 16:23 | 1.5M | |
| VOIP tender document..> | 2023-11-21 14:51 | 1.5M | |
| TOR. Gravelotte Ceme..> | 2023-10-13 14:48 | 1.5M | |
| Phalaborwa Extention..> | 2024-04-09 18:41 | 1.5M | |
| Relocation of Beacon..> | 2024-06-18 15:52 | 1.6M | |
| TENDER DOCUMENT FOR ..> | 2020-02-05 09:26 | 1.6M | |
| TENDER DOCUMENT FOR ..> | 2019-10-24 08:21 | 1.6M | |
| Tender no. 04-21-22 ..> | 2021-06-03 11:18 | 1.6M | |
| Tender Document - Pr..> | 2020-07-16 09:17 | 1.6M | |
| Appointment of a ser..> | 2023-10-13 14:48 | 1.7M | |
| Req No. 3076 Procure..> | 2025-07-04 12:33 | 1.7M | |
| Tender document Supp..> | 2019-08-16 09:53 | 1.7M | |
| RFQ1802.pdf | 2023-03-28 08:02 | 1.7M | |
| Book 1 of 3 Tender D..> | 2021-09-07 09:39 | 1.7M | |
| Tender Document - Pr..> | 2024-05-16 08:35 | 1.7M | |
| Tender document Supp..> | 2020-11-05 07:43 | 1.8M | |
| Supply,delivery to s..> | 2023-10-13 14:50 | 1.8M | |
| Tender no 12-20-21 -..> | 2021-06-03 11:18 | 1.8M | |
| Addendum Tender Docu..> | 2020-11-10 13:51 | 1.8M | |
| Tender Document - In..> | 2020-11-05 07:43 | 1.8M | |
| Tender document 08-2..> | 2021-08-31 08:22 | 1.8M | |
| Book 2 of 3 Tender ..> | 2021-09-07 09:39 | 1.8M | |
| TENDER DOCUMENT FOR ..> | 2019-08-16 08:09 | 1.9M | |
| Errutum Tender Doccu..> | 2024-06-28 13:16 | 1.9M | |
| AFS TENDER DOCUMENT ..> | 2024-06-19 09:06 | 1.9M | |
| TENDER DOCUMENT ____..> | 2020-11-04 13:07 | 2.0M | |
| TENDER DOCUMENT FOR ..> | 2022-08-26 08:03 | 2.0M | |
| ERRATUM TENDER DOCUM..> | 2022-09-19 15:09 | 2.0M | |
| BPM LEASING OF LAPTO..> | 2023-11-21 14:51 | 2.0M | |
| Appointment of a ser..> | 2023-07-11 10:27 | 2.0M | |
| Appointment of a ser..> | 2023-11-21 14:51 | 2.0M | |
| ELECTRIFICATION OF 1..> | 2021-03-15 15:39 | 2.3M | |
| ELECTRIFICATION OF 1..> | 2021-03-18 10:25 | 2.3M | |
| Water Items RFQ.pdf | 2017-03-10 12:55 | 2.6M | |
| BLANK BOQ Selwane wa..> | 2025-10-10 10:55 | 2.7M | |
| BLANK BOQ Lulekani w..> | 2025-10-10 10:55 | 2.7M | |
| LULEKANI WARD 15 ACC..> | 2022-09-21 11:03 | 2.9M | |
| ELECTRIFICATION OF S..> | 2021-03-15 15:39 | 3.0M | |
| ELECTRIFICATION OF S..> | 2021-03-18 10:25 | 3.0M | |
| Tender Doc for VoIP.pdf | 2019-08-05 10:46 | 3.0M | |
| phalaborwa tender do..> | 2024-11-06 15:09 | 3.2M | |
| LULEKANI WARD 15 ACC..> | 2023-05-05 08:57 | 3.6M | |
| Benfarm Phase 2 Bid ..> | 2022-07-26 07:51 | 8.3M | |
![[ ]](/icons/compressed.gif) | namakgale.zip | 2025-02-19 15:36 | 8.8M | |
| Refurbishment of Nam..> | 2021-01-11 15:06 | 10M | |
| 2025-26 PERFORMANCE ..> | 2025-08-06 14:50 | 10M | |
| 2025-26 PERFORMANCE ..> | 2025-08-06 14:50 | 12M | |
| MASHISHIMALE TENDER ..> | 2022-07-14 14:47 | 12M | |
| HUMULANI TENDER DOCU..> | 2022-07-14 14:45 | 12M | |
| MAKHUSHANE TENDER DO..> | 2022-07-14 14:46 | 13M | |
| 2025-26 PERFORMANCE ..> | 2025-08-06 14:50 | 14M | |
| Honeyville to Dinoko..> | 2024-11-06 15:09 | 22M | |
| Aubrey Carwash to Ka..> | 2024-11-06 15:11 | 23M | |
| 2025-26 PERFORMANCE ..> | 2025-08-06 14:49 | 25M | |
| DRAWINGS TO BE INSER..> | 2025-02-11 16:19 | 42M | |
| 2020 21 ANNUAL REPOR..> | 2022-03-23 14:19 | 65M | |
| 2020 21 ANNUAL REPOR..> | 2022-03-23 14:20 | 83M | |
|
|---|
